| Revision as of 09:01, 2 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (rep← Previous edit |
Latest revision as of 21:56, 7 January 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Chlorobenzenes to Chlorobenzene derivatives |
| (16 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414205323 |
|
| verifiedrevid = 432143295 |
|
|ImageFile=Chloramben.png |
|
|
⚫ |
| ImageFile =3-amino-2,5-dichlorobenzoic acid 200.svg |
|
|ImageSize=150px |
|
| ImageSize =160 |
| ⚫ |
|IUPACName=3-Amino-2,5-dichlorobenzoic acid |
|
|
|
| ImageAlt = Skeletal formula of chloramben |
| ⚫ |
|OtherNames=Ambiben, Amiben |
|
|
|
| ImageFile1 = Chloramben-3D-spacefill.png |
|
|
| ImageSize1 = 180 |
|
|
| ImageAlt1 = Adding space-filling model, adding alt text |
|
|
| IUPACName =3-Amino-2,5-dichlorobenzoic acid |
|
⚫ |
| OtherNames =Ambiben, Amiben |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=133-90-4 |
|
| CASNo =133-90-4 |
|
| PubChem=8630 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| EINECS = 205-123-5 |
|
|
|
| UNII = EWG424FFB5 |
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
| UNNumber = 3077 |
|
|
| PubChem =8630 |
|
⚫ |
| EINECS = 205-123-5 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C19056 |
|
| KEGG = C19056 |
|
| SMILES=C1=C(C=C(C(=C1N)Cl)C(=O)O)Cl |
|
| SMILES =C1=C(C=C(C(=C1N)Cl)C(=O)O)Cl |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8309 |
|
|
| ChEMBL = 446021 |
|
|
| ChEBI = 82183 |
|
|
| InChI = 1/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3/h1-2H,10H2,(H,11,12) |
|
|
| InChIKey = HSSBORCLYSCBJR-UHFFFAOYAE |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3/h1-2H,10H2,(H,11,12) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = HSSBORCLYSCBJR-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7|H=5|Cl=2|N=1|O=2 |
|
| C=7 | H=5 | Cl=2 | N=1 | O=2 |
|
| Appearance=Colorless crystalline solid<ref name=extoxnet>, Extension Toxicology Network, Oregon State University</ref> |
|
| Appearance =Colorless crystalline solid<ref name=extoxnet>, Extension Toxicology Network, Oregon State University</ref> |
|
| Density= |
|
| Density = |
|
|
| MeltingPtC = 194 to 197 |
|
| MeltingPt=194-197 °C (dec.)<ref name=Sigma> at ]</ref><br>200-201 °C<ref name=extoxnet/> |
|
| MeltingPt_notes = (decomposes)<ref name=Sigma> at ]</ref><br>200-201 °C<ref name=extoxnet/> |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility=700 mg/L<ref name=extoxnet/> |
|
| Solubility =700 mg/L<ref name=extoxnet/> |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
| RPhrases = {{R45}} {{R36/37/38}}<ref name=Sigma/> |
|
| GHSPictograms = {{GHS07}}{{GHS08}} |
|
|
| GHSSignalWord = Danger |
|
| SPhrases = {{S53}} {{S22}} {{S26}} {{S36/37/39}} {{S45}}<ref name=Sigma/> |
|
|
|
| HPhrases = {{H-phrases|315|319|335|350}} |
| ⚫ |
| LD50 = 3500 mg/kg (rat)<ref name=extoxnet/><br>3725 mg/kg (mouse)<ref name=extoxnet/> |
|
|
|
| PPhrases = {{P-phrases|201|202|261|264|271|280|281|302+352|304+340|305+351+338|308+313|312|321|332+313|337+313|362|403+233|405|501}} |
|
⚫ |
| LD50 = 3500 mg/kg (rat)<ref name=extoxnet/><br>3725 mg/kg (mouse)<ref name=extoxnet/> |
|
}} |
|
}} |
|
}} |
|
}} |
| Line 41: |
Line 63: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |