| Revision as of 11:31, 29 May 2009 editAnypodetos (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers39,350 edits No ATC code← Previous edit |
Latest revision as of 22:35, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers171,861 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (32 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{Use dmy dates|date=May 2020}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| IUPAC_name = 1-(2-Chloroethyl)-1-nitroso-3-urea |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = Chlorozotocin.png |
|
|
|
| verifiedrevid = 293076130 |
| ⚫ |
| CAS_number = 54749-90-5 |
|
|
|
| IUPAC_name = 2-{amino}-2-deoxy-<small>D</small>-glucose |
| ⚫ |
| ATC_prefix = none |
|
|
⚫ |
| image = Chlorozotocin (Haworth).svg |
|
| ATC_suffix = |
|
|
|
| width = 160 |
| ⚫ |
| PubChem = 451706 |
|
|
|
| alt = Haworth projection of chlorozotocin |
|
| DrugBank = |
|
|
|
|
| ⚫ |
| C=9|H=16|Cl=1|N=3|O=7 |
|
|
|
<!--Clinical data--> |
|
| molecular_weight = 313.69 g/mol |
|
|
| bioavailability = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| protein_bound = |
|
|
| metabolism = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| elimination_half-life = |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
|
| pregnancy_category= |
|
|
|
<!--Identifiers--> |
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| CAS_number = 54749-90-5 |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
⚫ |
| ATC_prefix = none |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| PubChem = 451706 |
|
| legal_status = |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| routes_of_administration = |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 3053LTY75Z |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C19170 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2094020 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 397854 |
|
|
| smiles = ClCCN(N=O)C(=O)N(C=O)(O)(O)(O)CO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C9H16ClN3O7/c10-1-2-13(12-20)9(19)11-5(3-14)7(17)8(18)6(16)4-15/h3,5-8,15-18H,1-2,4H2,(H,11,19)/t5-,6+,7+,8+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MKQWTWSXVILIKJ-LXGUWJNJSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=9 | H=16 | Cl=1 | N=3 | O=7 |
|
}} |
|
}} |
|
|
|
|
|
'''Chlorozotocin''' is a ] used for cancer therapy. |
|
'''Chlorozotocin''' is a ]. It is used for cancer therapy.{{Citation needed|date=July 2011}} |
|
|
|
|
|
|
The International Agency for Research on Cancer concluded it was "probably carcinogenic" in 1990<ref>{{Cite book|url=https://www.ncbi.nlm.nih.gov/books/NBK526156/|title=SUMMARY OF FINAL EVALUATIONS|last=Humans|first=IARC Working Group on the Evaluation of Carcinogenic Risk to|date=1990|publisher=International Agency for Research on Cancer|language=en}}</ref> |
|
|
|
|
|
|
It is an analogue of ].<ref name="Wolfe2006">{{cite book| vauthors = Wolfe MM |title=Therapy of digestive disorders|url=https://books.google.com/books?id=gUrxEDKGfx4C&pg=PA477|year=2006|publisher=Elsevier Health Sciences|isbn=978-1-4160-0317-5|page=477}}</ref> |
|
{{pharma-stub}} |
|
|
|
|
|
|
|
==References== |
| ⚫ |
] |
|
|
|
{{reflist}} |
| ⚫ |
] |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
{{antineoplastic-drug-stub}} |