| Revision as of 14:33, 12 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 20:41, 20 July 2024 edit undoMilda 444 (talk | contribs)64 edits + picture of sample |
| (16 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=February 2009}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 401957170 |
|
| verifiedrevid = 401958568 |
|
| Reference=<ref> at ]</ref> |
|
| Reference =<ref> at ]</ref> |
|
| ImageFile = Cholesteryl chloride.png |
|
| ImageFile = Cholesteryl chloride.png |
|
| ImageSize = |
|
| ImageSize = |
|
|
| ImageFile2 = Cholesterylchlorid.jpg |
| ⚫ |
| IUPACName = <small>(''3S,8S,9S,10R,13R,14S,17R'')-3-Chloro-10,13-dimethyl-17--2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-''1H''-cyclopentaphenanthrene</small> |
|
|
|
| ImageSize2 = |
| ⚫ |
| OtherNames = 3-Chlorocholest-5-ene<br>3β-Chlorocholest-5-ene |
|
|
|
| IUPACName = 3β-Chlorocholest-5-ene |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| SystematicName = (1''R'',3a''S'',3b''S'',7''S'',9a''R'',9b''S'',11a''R'')-7-Chloro-9a,11a-dimethyl-1--2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1''H''-cyclopentaphenanthrene |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| OtherNames = 3-Chlorocholest-5-ene |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16498751 |
|
| ChemSpiderID = 16498751 |
|
| InChI = 1/C27H45Cl/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
|
| InChI = 1/C27H45Cl/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| Line 21: |
Line 24: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 910-31-6 |
|
| CASNo = 910-31-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 92850 |
|
|
|
| UNII = 39EHZ05V39 |
| ⚫ |
| SMILES = Cl4C/C3=C/C1(CC2(1CC2(C)CCCC(C)C)C)3(C)CC4 |
|
|
⚫ |
| PubChem = 92850 |
|
|
| EC_number = 213-004-4 |
|
|
| DrugBank = DB14045 |
|
⚫ |
| SMILES = Cl4C/C3=C/C1(CC2(1CC2(C)CCCC(C)C)C)3(C)CC4 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>27</sub>H<sub>45</sub>Cl |
|
| Formula = C<sub>27</sub>H<sub>45</sub>Cl |
|
| MolarMass = 405.10 |
|
| MolarMass = 405.10 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = 94-96 °C |
|
| MeltingPtC = 94 to 96 |
|
| BoilingPt = |
|
| MeltingPt_notes = |
|
| Solubility = |
|
| BoilingPt = |
|
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| SPhrases = {{S22}} {{S24/25}} |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Cholesteryl chloride''', also called '''3-chlorocholest-5-ene''' or '''3β-chlorocholest-5-ene''', is an ], an ] derivate ]. It is a ] material forming clockwise ]s. It is a transparent liquid, or a soft crystalline material with melting point around 94-96 °C. |
|
'''Cholesteryl chloride''', also called '''3-chlorocholest-5-ene''' or '''3β-chlorocholest-5-ene''', is an ], an ] derivate ]. It is a ] material forming clockwise ]s. It is a transparent liquid, or a soft crystalline material with melting point around 94-96 °C. |
|
|
|
|
|
It can be used with ], ], and/or ] in some ] liquid crystals. |
|
It can be used with ], ], and/or ] in some ] liquid crystals. |
|
|
|
|
|
It is used in some hair colors, make-ups, and some other cosmetic preparations.<ref>{{HPD|2719}}</ref> |
|
It is used in some hair colors, make-ups, and some other cosmetic preparations.<ref>{{CPID|id=2719}}</ref> |
|
|
|
|
|
It can be also used as a component of the liquid crystals used for ]s. |
|
It can be also used as a component of the liquid crystals used for ]s. |
| Line 53: |
Line 60: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |