| Revision as of 17:54, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikiped← Previous edit |
Latest revision as of 07:54, 25 March 2024 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,052 edits auto mw |
| (15 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 447891800 |
|
⚫ |
| IUPAC_name = ''trans''-3,3,5-Trimethylcyclohexyl pyridine-3-carboxylate |
|
⚫ |
| image = Ciclonicate.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 53449-58-4 |
|
⚫ |
| ATC_prefix = C04 |
|
⚫ |
| ATC_suffix = AC07 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL = 2104521 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 7H634NXI03 |
|
| UNII = 7H634NXI03 |
|
|
| PubChem = 10444661 |
| ⚫ |
| verifiedrevid = 443600474 |
|
|
|
| ChemSpiderID = 8620080 |
| ⚫ |
| IUPAC_name = ''trans''-3,3,5-Trimethylcyclohexyl pyridine-3-carboxylate |
|
|
|
| smiles = O=C(O1C(C)CC(C)(C)C1)c2cccnc2 |
| ⚫ |
| image = Ciclonicate.png |
|
|
|
| StdInChI = 1S/C15H21NO2/c1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12/h4-6,10-11,13H,7-9H2,1-3H3/t11-,13-/m1/s1 |
| ⚫ |
| CAS_number = 53449-58-4 |
|
|
|
| StdInChIKey = GQSGZTBDVNUIQS-DGCLKSJQSA-N |
| ⚫ |
| ATC_prefix = C04 |
|
|
|
|
| ⚫ |
| ATC_suffix = AC07 |
|
|
|
<!--Chemical data--> |
|
| PubChem = 68703 |
|
|
⚫ |
| C=15 | H=21 | N=1 | O=2 |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=15|H=21|N=1|O=2 |
|
|
| molecular_weight = 247.33274 |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Ciclonicate''' is a ].<ref>{{cite journal | author = Gregoratti L; Crespi B; Groothold G; Fuligni E; Ghiringhelli L | title = Treatment of arteriosclerotic peripheral vascular diseases with ciclonicate | journal = Minerva cardioangiologica | year = 1982 | volume = 30 | issue = 11 | pages = 659–668 | pmid = 7155375}}</ref> |
|
'''Ciclonicate''' is a ].<ref>{{cite journal |vauthors=Gregoratti L, Crespi B, Groothold G, Fuligni E, Ghiringhelli L | title = Treatment of arteriosclerotic peripheral vascular diseases with ciclonicate | journal = Minerva Cardioangiologica | year = 1982 | volume = 30 | issue = 11 | pages = 659–668 | pmid = 7155375}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Peripheral vasodilators}} |
|
{{Peripheral vasodilators}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|