| Revision as of 15:45, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 462931960 of page Cipemastat for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 19:31, 27 December 2022 edit JWBE (talk | contribs)Extended confirmed users10,129 edits added Category:1-Piperidinyl compounds using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Watchedfields = changed |
| ⚫ |
| UNII = 02HQ4TYQ60 |
|
|
| verifiedrevid = 462864887 |
|
| verifiedrevid = 477380487 |
|
| ImageFile = Cipemastat.svg |
|
| ImageFile = Cipemastat.svg |
|
| ImageSize = |
|
| ImageSize = 180 |
|
| IUPACName = (2''R'',3''R'')-3-(cyclopentylmethyl)-''N''-hydroxy-4-oxo-4-(piperidin-1-yl)-2-butanamide |
|
| PIN = (2''R'',3''R'')-3-(Cyclopentylmethyl)-''N''-hydroxy-4-oxo-4-(piperidin-1-yl)-2-butanamide |
|
| OtherNames = |
|
| OtherNames = |
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 02HQ4TYQ60 |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 190648-49-8 --> |
|
|
|
| IUPHAR_ligand = 6466 |
| ⚫ |
| PubChem = 9824350 |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
| ⚫ |
| SMILES = CC1(C)NC(=O)N(C((CC2CCCC2)C(=O)N3CCCCC3)C(=O)NO)C1=O |
|
|
⚫ |
| CASNo = 190648-49-8 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem = 9824350 |
|
⚫ |
| SMILES = CC1(C)NC(=O)N(C((CC2CCCC2)C(=O)N3CCCCC3)C(=O)NO)C1=O |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8000097 |
|
| ChemSpiderID = 8000097 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C22H36N4O5/c1-22(2)20(29)26(21(30)24(22)3)14-17(18(27)23-31)16(13-15-9-5-6-10-15)19(28)25-11-7-4-8-12-25/h15-17,31H,4-14H2,1-3H3,(H,23,27)/t16-,17+/m1/s1 |
|
|
| InChIKey = GFUITADOEPNRML-SJORKVTEBV |
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C22H36N4O5/c1-22(2)20(29)26(21(30)24(22)3)14-17(18(27)23-31)16(13-15-9-5-6-10-15)19(28)25-11-7-4-8-12-25/h15-17,31H,4-14H2,1-3H3,(H,23,27)/t16-,17+/m1/s1 |
|
| StdInChI = 1S/C22H36N4O5/c1-22(2)20(29)26(21(30)24(22)3)14-17(18(27)23-31)16(13-15-9-5-6-10-15)19(28)25-11-7-4-8-12-25/h15-17,31H,4-14H2,1-3H3,(H,23,27)/t16-,17+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = GFUITADOEPNRML-SJORKVTESA-N |
|
| StdInChIKey = GFUITADOEPNRML-SJORKVTESA-N |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 115653 |
|
| ChEMBL = 115653 |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=22|H=36|N=4|O=5 |
|
| C=22 | H=36 | N=4 | O=5 |
|
|
| Appearance = |
|
| MolarMass = 436.545 g/mol |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
|
|
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Cipemastat''' (], also known as '''Ro 32-3555''' and by the tentative trade name '''Trocade''') is a selective inhibitor of ] that has been investigated as an anti-] agent.<ref>{{cite journal |vauthors=Hemmings F, Farhan M, Rowland J, Banken L, Jain R |title=Tolerability and pharmacokinetics of the collagenase-selective inhibitor Trocade in patients with rheumatoid arthritis |journal=Rheumatology (Oxford) |volume=40 |issue=5 |pages=537–43 |year=2001 |pmid=11371662 |doi=10.1093/rheumatology/40.5.537|doi-access=free }}</ref> It is being developed by ]. |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{musculoskeletal-drug-stub}} |