| Revision as of 11:25, 4 May 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, Pubchem, StdInChI and StdInChIKey← Previous edit |
Latest revision as of 05:28, 30 October 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,645 edits consistent citation formatting |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 403961107 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = ''N''-(2-Oxothiolan-3-yl)acetamide |
|
|
⚫ |
| verifiedrevid = 444443115 |
| ⚫ |
| image = Citiolone.png |
|
|
⚫ |
| IUPAC_name = (''RS'')-''N''-(2-Oxothiolan-3-yl)acetamide |
| ⚫ |
| CAS_number = 1195-16-0 |
|
|
⚫ |
| image = Citiolone.png |
| ⚫ |
| PubChem = 14520 |
|
|
|
|
| ⚫ |
| ChemSpiderID = 13864 |
|
|
|
<!--Clinical data--> |
|
| SMILES = O=C1SCCC1NC(=O)C |
|
|
|
| tradename = |
| ⚫ |
| StdInChI=1S/C6H9NO2S/c1-4(8)7-5-2-3-10-6(5)9/h5H,2-3H2,1H3,(H,7,8) |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| StdInChIKey = NRFJZTXWLKPZAV-UHFFFAOYSA-N |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| ATC_prefix = A05 |
|
|
| ATC_suffix = BA04 |
|
| pregnancy_category = |
|
| PubChem = 14520 |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| DrugBank = |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 1195-16-0 |
|
⚫ |
| ATC_prefix = A05 |
|
|
| ATC_suffix = BA04 |
|
⚫ |
| PubChem = 14520 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104457 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 13864 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 70JKL15MUH |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07105 |
|
| KEGG = D07105 |
|
|
|
| ⚫ |
| C=6|H=9|N=1|O=2|S=1 |
|
|
|
<!--Chemical data--> |
|
| molecular_weight = 159.21 g/mol |
|
|
⚫ |
| C=6 | H=9 | N=1 | O=2 | S=1 |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| StdInChI = 1S/C6H9NO2S/c1-4(8)7-5-2-3-10-6(5)9/h5H,2-3H2,1H3,(H,7,8) |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| elimination_half-life = |
|
|
⚫ |
| StdInChIKey = NRFJZTXWLKPZAV-UHFFFAOYSA-N |
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category= |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Citiolone''' is a drug used in liver therapy. It is a derivative of the ] ]. |
|
'''Citiolone''' is a drug used in ] therapy. |
|
|
|
|
|
It is a derivative of the ] ].<ref>{{cite journal | vauthors = de Barrio M, Tornero P, Prieto A, Sainza T, Zubeldia JM, Herrero T | title = Recurrent fixed drug eruption caused by citiolone | journal = Journal of Investigational Allergology & Clinical Immunology | volume = 7 | issue = 3 | pages = 193–194 | year = 1997 | pmid = 9252880 }}</ref> Citilone has also been studied with regards to ] due to it being a ] free radical scavenger. The drug has been shown to protect ] cells subjected to temperature conditions of 8-25 °C.<ref>{{cite journal | vauthors = Kruuv J, Glofcheski DJ | title = Further evidence for two modes of hypothermia damage | journal = Cryobiology | volume = 30 | issue = 3 | pages = 313–321 | date = June 1993 | pmid = 8370318 | doi = 10.1006/cryo.1993.1030 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Bile and liver therapy}} |
|
{{Bile and liver therapy}} |