| Revision as of 11:23, 5 May 2011 editOnegumas (talk | contribs)36 editsm pl← Previous edit |
Latest revision as of 14:31, 30 August 2017 edit undoKolbertBot (talk | contribs)Bots1,166,042 editsm Bot: HTTP→HTTPS |
| (10 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 310328256 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Cladinose.png |
|
|
⚫ |
| verifiedrevid = 427562600 |
| ⚫ |
|ImageSize=150px |
|
|
⚫ |
| ImageFile=Cladinose.png |
| ⚫ |
|IUPACName=(''4R,5S,6S'')-4-Methoxy-4,6-dimethyl-tetrahydropyran-2,5-diol |
|
|
⚫ |
| ImageSize=150px |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| IUPACName=(''4R,5S,6S'')-4-Methoxy-4,6-dimethyl-tetrahydropyran-2,5-diol |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| CASNo=470-12-2 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=443504 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| SMILES=C1((CC(O1)O)(C)OC)O |
|
|
⚫ |
| CASNo=470-12-2 |
|
⚫ |
| PubChem=443504 |
|
⚫ |
| SMILES=C1((CC(O1)O)(C)OC)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 391713 |
|
|
| InChI = 1/C8H16O4/c1-5-7(10)8(2,11-3)4-6(9)12-5/h5-7,9-10H,4H2,1-3H3/t5-,6?,7-,8+/m0/s1 |
|
|
| InChIKey = YHVUVJYEERGYNU-SBEGJHHSBA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C8H16O4/c1-5-7(10)8(2,11-3)4-6(9)12-5/h5-7,9-10H,4H2,1-3H3/t5-,6?,7-,8+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YHVUVJYEERGYNU-SBEGJHHSSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>8</sub>H<sub>16</sub>O<sub>4</sub> |
|
| Formula=C<sub>8</sub>H<sub>16</sub>O<sub>4</sub> |
|
| MolarMass =176.21 g/mol |
|
| MolarMass =176.21 g/mol |
|
⚫ |
| Appearance= |
|
| ExactMass = 176.104859 |
|
|
|
| Density= 1.156 g/mL |
| ⚫ |
| Appearance= |
|
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
| Line 29: |
Line 39: |
|
'''Cladinose''' is a ] ] that in several ] (such as ]) is attached to the ] ring. |
|
'''Cladinose''' is a ] ] that in several ] (such as ]) is attached to the ] ring. |
|
|
|
|
|
In ], a relatively new class of antibiotics, the cladinose is replaced with a ] group. |
|
In ], a relatively new class of antibiotics, the cladinose is replaced with a ] group. |
|
] with cladinose visible at bottom]]<br style="clear:left;"/> |
|
] A with cladinose visible at bottom]]{{clear|left}} |
|
|
|
|
|
==External links== |
|
==External links== |
|
* {{MeshName|Cladinose}} |
|
* {{MeshName|Cladinose}} |
|
* |
|
* |
|
* |
|
* |
|
|
|
|
|
] |
|
] |
| Line 42: |
Line 52: |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|