Misplaced Pages

Combretol: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 22:35, 18 March 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Quick-adding category Phenol ethers (using HotCat)← Previous edit Latest revision as of 17:03, 16 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII 
(19 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 423619746
| Name = Combretol | Name = Combretol
| ImageFile = Combretol.PNG | ImageFile = Combretol.svg
| ImageSize = 200px
| ImageName = Chemical structure of combretol | ImageName = Chemical structure of combretol
| IUPACName = 5-hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one | IUPACName = 5-Hydroxy-3,3′,4′,5′,7-pentamethoxyflavone
| OtherNames = 5-Hydroxy-3,3',4',5',7-pentamethoxyflavone<!-- <br> --> | PIN = 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4''H''-1-benzopyran-4-one
| OtherNames = 3,7,3',4',5'-pentamethylmyricetin<!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo =
| CASNo_Ref = | CASNo = 5084-19-5
| CASNo_Ref = <ref>{{cite web |title=KNApSAcK Metabolite Information - C00004777 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00004777 |website=www.knapsackfamily.com}}</ref>
| CASOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2G3ZF4VTE5
| ChEBI = 70005
| ChEMBL = 518300
| PubChem = 12303802 | PubChem = 12303802
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C(=C3)OC)OC)OC)O | SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C(=C3)OC)OC)OC)O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| InChI =
| ChemSpiderID = 21131195
| InChI = 1/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3
| InChIKey = SUNUQCQIFHHEOW-UHFFFAOYAT
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SUNUQCQIFHHEOW-UHFFFAOYSA-N
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>20</sub>H<sub>20</sub>O<sub>8</sub> | Formula = C<sub>20</sub>H<sub>20</sub>O<sub>8</sub>
| MolarMass = 388.36 g/mol | MolarMass = 388.36 g/mol
| ExactMass = 388.115818 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
}} }}
'''Combretol''' is an ], a type of flavonoid. It is the 3,7,3',4',5'-O-methylation of ] and can be extracted from '']''<ref></ref>. '''Combretol''' is an ], a type of flavonoid. It is the 3,7,3',4',5'-O-methylation of ] and can be extracted from '']''<ref>Combretol from Combretum quadrangulare. Stang Mongkolsuk, F. M. Dean and L. E. Houghton, J. Chem. Soc. C, 1966, page 125, {{doi|10.1039/J39660000125}}</ref> and from '']''.<ref></ref>


==References== == References ==
{{reflist}} {{reflist}}


{{flavonol}} {{flavonol}}


] ]
] ]



{{polyphenol-stub}} {{aromatic-stub}}