Revision as of 22:35, 18 March 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Quick-adding category Phenol ethers (using HotCat)← Previous edit |
Latest revision as of 17:03, 16 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
(19 intermediate revisions by 13 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 423619746 |
|
| Name = Combretol |
|
| Name = Combretol |
|
| ImageFile = Combretol.PNG |
|
| ImageFile = Combretol.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of combretol |
|
| ImageName = Chemical structure of combretol |
|
| IUPACName = 5-hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|
| IUPACName = 5-Hydroxy-3,3′,4′,5′,7-pentamethoxyflavone |
|
| OtherNames = 5-Hydroxy-3,3',4',5',7-pentamethoxyflavone<!-- <br> --> |
|
| PIN = 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4''H''-1-benzopyran-4-one |
|
|
| OtherNames = 3,7,3',4',5'-pentamethylmyricetin<!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
|
| CASNo_Ref = |
|
| CASNo = 5084-19-5 |
|
|
| CASNo_Ref = <ref>{{cite web |title=KNApSAcK Metabolite Information - C00004777 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00004777 |website=www.knapsackfamily.com}}</ref> |
|
| CASOther = |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2G3ZF4VTE5 |
|
|
| ChEBI = 70005 |
|
|
| ChEMBL = 518300 |
|
| PubChem = 12303802 |
|
| PubChem = 12303802 |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C(=C3)OC)OC)OC)O |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C(=C3)OC)OC)OC)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 21131195 |
|
|
| InChI = 1/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3 |
|
|
| InChIKey = SUNUQCQIFHHEOW-UHFFFAOYAT |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SUNUQCQIFHHEOW-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>20</sub>H<sub>20</sub>O<sub>8</sub> |
|
| Formula = C<sub>20</sub>H<sub>20</sub>O<sub>8</sub> |
|
| MolarMass = 388.36 g/mol |
|
| MolarMass = 388.36 g/mol |
|
| ExactMass = 388.115818 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Combretol''' is an ], a type of flavonoid. It is the 3,7,3',4',5'-O-methylation of ] and can be extracted from '']''<ref></ref>. |
|
'''Combretol''' is an ], a type of flavonoid. It is the 3,7,3',4',5'-O-methylation of ] and can be extracted from '']''<ref>Combretol from Combretum quadrangulare. Stang Mongkolsuk, F. M. Dean and L. E. Houghton, J. Chem. Soc. C, 1966, page 125, {{doi|10.1039/J39660000125}}</ref> and from '']''.<ref></ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{polyphenol-stub}} |
|
{{aromatic-stub}} |