| Revision as of 20:04, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 08:59, 23 June 2023 edit undoGraeme Bartlett (talk | contribs)Administrators249,716 edits caps for c in carboxylate in SMILES |
| (34 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=April 2011}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 355707858 |
|
| verifiedrevid = 424908581 |
| ⚫ |
| ImageFile =Copper ibuprofenate.png |
|
|
| ImageSize = 200px |
|
| Name = |
|
⚫ |
| ImageFile = Copper(II) Ibuprofenate.jpg |
| ⚫ |
| IUPACName = biscopper(II) |
|
|
|
| ImageFile1 = IBPCOP.jpg |
| ⚫ |
| OtherNames = |
|
|
⚫ |
| IUPACName = biscopper(II) |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = |
|
|
| SystematicName = |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 66840-44-6 |
|
| CASNo = 66840-44-6 |
|
| EINECS = |
|
| EINECS = |
|
| PubChem = |
|
| PubChem = |
|
| SMILES = C(C(C)C1=CC=C(CC(C)C)C=C1)=O.C(C(C)C1=CC=C(CC(C)C)C=C1)=O. |
|
| SMILES = c0cc(CC(C)C)ccc0C(C)(O123)O(O(O1)C(C)c0ccc(CC(C)C)cc0)(O(O2)C(C)c0ccc(CC(C)C)cc0)O(O3)C(C)c0ccc(CC(C)C)cc0 |
|
|
| StdInChI=1S/4C13H17O2.2Cu/c4*1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;;/h4*4-7,9-10H,8H2,1-3H3;;/q4*-3;2*+6 |
|
| InChI = |
|
|
|
| StdInChIKey=HEFOJHHJEKPEDO-UHFFFAOYSA-N |
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
| Line 19: |
Line 22: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
| Section2 = {{Chembox Properties |
|
| ATCCode_suffix = |
|
|
⚫ |
| C=52 | H=68 | O=8 | Cu=2 |
|
| ATC_Supplemental =}} |
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
| ⚫ |
| C=26 | H=36 | O=4 | Cu=1 |
|
|
| Appearance = Green powder |
|
| Appearance = Green powder |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| Melting_notes = |
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = Slightly soluble |
|
| Solubility = Slightly soluble |
|
| SolubleOther = Slightly soluble |
|
| SolubleOther = Slightly soluble |
| Line 35: |
Line 36: |
|
| pKa = |
|
| pKa = |
|
| pKb = }} |
|
| pKb = }} |
|
| Section3 = {{Chembox Structure |
|
| Section3 = {{Chembox Structure |
|
| CrystalStruct = |
|
| CrystalStruct = |
|
| Coordination = |
|
| Coordination = |
|
| MolShape = }} |
|
| MolShape = }} |
|
| Section4 = {{Chembox Thermochemistry |
|
| Section4 = {{Chembox Thermochemistry |
|
| DeltaHf = |
|
| DeltaHf = |
|
| DeltaHc = |
|
| DeltaHc = |
|
| Entropy = |
|
| Entropy = |
|
| HeatCapacity = }} |
|
| HeatCapacity = }} |
|
| Section5 = {{Chembox Pharmacology |
|
| Section5 = {{Chembox Pharmacology |
|
| AdminRoutes = |
|
| AdminRoutes = |
|
| Bioavail = |
|
| Bioavail = |
| Line 56: |
Line 57: |
|
| Legal_AU = |
|
| Legal_AU = |
|
| Legal_CA = |
|
| Legal_CA = |
|
| PregCat = |
|
| Pregnancy_category = |
|
| PregCat_AU = |
|
| Pregnancy_AU = |
|
| PregCat_US = }} |
|
| Pregnancy_US = }} |
|
| Section6 = {{Chembox Explosive |
|
| Section6 = {{Chembox Explosive |
|
| ShockSens = |
|
| ShockSens = |
|
| FrictionSens = |
|
| FrictionSens = |
|
| ExplosiveV = |
|
| DetonationV = |
|
| REFactor = }} |
|
| REFactor = }} |
|
| Section7 = {{Chembox Hazards |
|
| Section7 = {{Chembox Hazards |
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
| MainHazards = |
|
| NFPA-H = |
|
| NFPA-H = |
|
| NFPA-F = |
|
| NFPA-F = |
|
| NFPA-R = |
|
| NFPA-R = |
|
| NFPA-O = |
|
| NFPA-S = |
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| ExploLimits = |
|
| ExploLimits = |
|
| PEL = }} |
|
| PEL = }} |
|
| Section8 = {{Chembox Related |
|
| Section8 = {{Chembox Related |
|
| OtherAnions = |
|
| OtherAnions = |
|
| OtherCations = |
|
| OtherCations = |
|
| OtherFunctn = |
|
| OtherFunction = |
|
| Function = |
|
| OtherFunction_label = |
|
| OtherCpds = ] |
|
| OtherCompounds = ] |
|
]}} |
|
]}} |
|
}} |
|
}} |
|
'''Copper ibuprofenate''' is a ] consisting of ] and the ] form of the ] ].<ref name="latif">{{cite journal|last=A. Latif |first=Abuhijleh|year=1997|title=Synthesis and characterization of copper-ibuprofenate complexes with 2,2'-bipyridine and 1,10-phenanthrolines and their hydrolytic activities in phosphate diester cleavage|journal=Polyhedron|volume=16|issue=4|pages=733–740| doi = 10.1016/0277-5387(96)00214-8}}</ref><ref name="Frazier">{{cite journal|last=Frazier|first=D. R. |coauthors= S. K. Lynch and G. O. Carlisle|year=1981|title=Synthesis and magnetic properties of biscopper(II) |journal=Journal of Inorganic and Nuclear Chemistry|volume=43|issue=11| doi = 10.1016/0022-1902(81)80610-0}}</ref><ref name="Abu">{{cite journal |author=Abuhijleh AL |title=Mononuclear and binuclear copper(II) complexes of the antiinflammatory drug ibuprofen: synthesis, characterization, and catecholase-mimetic activity |journal=J. Inorg. Biochem. |volume=55 |issue=4 |pages=255–62 |year=1994 |month=September |pmid=7964714 |doi= 10.1016/0162-0134(94)85010-0}}</ref> |
|
'''Copper ibuprofenate''' is a ] consisting of ] and the ] form of the ] ].<ref name="Frazier">{{cite journal|last=Frazier|first=D. R. |author2=S. K. Lynch |author3=G. O. Carlisle|year=1981|title=Synthesis and magnetic properties of biscopper(II) |journal=Journal of Inorganic and Nuclear Chemistry|volume=43|issue=11|pages=2747–2748 | doi = 10.1016/0022-1902(81)80610-0}}</ref><ref name="Abu">{{cite journal |author=Abuhijleh AL |title=Mononuclear and binuclear copper(II) complexes of the antiinflammatory drug ibuprofen: synthesis, characterization, and catecholase-mimetic activity |journal=J. Inorg. Biochem. |volume=55 |issue=4 |pages=255–62 |date=September 1994 |pmid=7964714 |doi= 10.1016/0162-0134(94)85010-0}}</ref> The compound is prepared by the reaction of sodium ibuprofenate with ]. |
|
|
|
|
|
⚫ |
It has been suggested that copper complexes of anti-inflammatory drugs are more active than the parent drug<ref name="Sorenson">{{cite journal |author=Sorenson JR |title=Copper complexes offer a physiological approach to treatment of chronic diseases |journal=Prog Med Chem |series=Progress in Medicinal Chemistry |volume=26 |pages=437–568 |year=1989 |pmid=2690187 |doi= 10.1016/s0079-6468(08)70246-7|isbn=9780444810380 }}<!--|accessdate=2010-02-01--></ref> and produce fewer gastrointestinal ].<ref name="Gordijo">{{cite journal |vauthors=Gordijo CR, Barbosa CA, Da Costa Ferreira AM, Constantino VR, de Oliveira Silva D |title=Immobilization of ibuprofen and copper-ibuprofen drugs on layered double hydroxides |journal=J Pharm Sci |volume=94 |issue=5 |pages=1135–48 |date=May 2005 |pmid=15793807 |doi=10.1002/jps.20336 }}</ref> In 2008, a ] was issued for the utilization of ibuprofenate complexes (including copper ibuprofenate) as a ].<ref>{{US patent reference |
|
==Usage== |
|
|
|
| number = 7462227 |
| ⚫ |
Research has suggested that copper complexes of anti-inflammatory drugs are more active than the drug by itself,<ref name="latif" /><ref name="Sorenson">{{cite journal |author=Sorenson JR |title=Copper complexes offer a physiological approach to treatment of chronic diseases |journal=Prog Med Chem |volume=26 |issue= |pages=437–568 |year=1989 |pmid=2690187 |doi= |url= |accessdate=2010-02-01}}</ref> and produce fewer gastrointestinal ].<ref name="Gordijo">{{cite journal |author=Gordijo CR, Barbosa CA, Da Costa Ferreira AM, Constantino VR, de Oliveira Silva D |title=Immobilization of ibuprofen and copper-ibuprofen drugs on layered double hydroxides |journal=J Pharm Sci |volume=94 |issue=5 |pages=1135–48 |year=2005 |month=May |pmid=15793807 |doi=10.1002/jps.20336 }}</ref> In 2008, a ] was issued for the utilization of ibuprofenate complexes (including copper ibuprofenate) as a ].<ref name="uspto">{{cite web|url=http://patft.uspto.gov/netacgi/nph-Parser?Sect1=PTO2&Sect2=HITOFF&p=1&u=/netahtml/PTO/search-bool.html&r=1&f=G&l=50&co1=AND&d=PTXT&s1=7462227&OS=7462227&RS=7462227|title=Ibuprofen complexes as wood preservatives - US pat. no, 7,462,227|publisher=US Patent Office|accessdate=1 February 2010}}</ref><ref name="patentstorm">{{cite web|url=http://www.patentstorm.us/patents/7462227/fulltext.html|title=US Patent 7462227 - Ibuprofen complexes as wood preservatives|publisher=Patent Storm|accessdate=1 February 2010}}</ref> |
|
|
|
| issue-date = 2007-07-26 |
|
|
| inventor = Anderson, Albert Gordon; Feaster, John; Patel, Damini; Scialdone, Mark |
|
|
| title = Ibuprofen complexes as wood preservatives |
|
|
}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
==Further reading== |
| ⚫ |
] |
|
|
|
*{{cite journal|last=A. Latif |first=Abuhijleh|year=1997|title=Synthesis and characterization of copper-ibuprofenate complexes with 2,2'-bipyridine and 1,10-phenanthrolines and their hydrolytic activities in phosphate diester cleavage|journal=Polyhedron|volume=16|issue=4|pages=733–740| doi = 10.1016/0277-5387(96)00214-8}} |
| ⚫ |
] |
|
|
|
|
|
⚫ |
] |
|
⚫ |
] |