Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 10:14, 11 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit		Latest revision as of 08:48, 18 April 2024 edit undoCitation bot (talk | contribs)Bots5,391,861 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Abductive | Category:Ellagitannins | #UCB_Category 1/38
(29 intermediate revisions by 19 users not shown)
Line 1:		Line 1:
	{{other uses|Trigalloyl glucose (disambiguation)}}
	{{chembox		{{chembox
	| Verifiedfields = changed		| Verifiedfields = changed
	| Watchedfields = changed		| Watchedfields = changed
	| verifiedrevid = 399731262		| verifiedrevid = 460107508
	| Name = Corilagin		| Name = Corilagin
	| ImageFile = Corilagin.svg		| ImageFile = Corilagin.svg
	| ImageSize = 200px
	| ImageName = Chemical structure of corilagin		| ImageName = Chemical structure of corilagin
	| IUPACName = <nowiki>oxan-4-yl] 3,4,5-trihydroxybenzoate</nowiki>		| IUPACName = <nowiki>oxan-4-yl] 3,4,5-trihydroxybenzoate</nowiki>
	| OtherNames = 1,3,6,-trigalloyl glucose<br>beta-1-O-]-3,6-(R)-hexahydroxydiphenoyl-d-]<!-- <br> -->		| OtherNames = beta-1-O-]-3,6-(R)-hexahydroxydiphenoyl-d-]<!-- <br> -->
	|Section1= {{Chembox Identifiers		|Section1={{Chembox Identifiers
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
	| ChemSpiderID = 398744		| ChemSpiderID = 4265734
	| InChIKey = RNKMOGIPOMVCHO-SJMVAQJGBQ		| InChIKey = RNKMOGIPOMVCHO-SJMVAQJGBQ
	| SMILES1 = c1c(cc(c(c1O)O)O)C(=O)OC2((((O2)OC(=O)c3cc(c(c(c3)O)O)O)O)OC(=O)c4cc(c(c(c4)O)O)O)O		| SMILES1 = c1c(cc(c(c1O)O)O)C(=O)OC2((((O2)OC(=O)c3cc(c(c(c3)O)O)O)O)OC(=O)c4cc(c(c(c4)O)O)O)O
	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}		| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
	| StdInChI = 1S/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-21(37)23(44-25(40)9-3-13(30)19(35)14(31)4-9)22(38)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2/t17-,21-,22-,23+,27+/m1/s1		| StdInChI = 1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)23-19(35)13(43-27)5-42-25(40)7-3-11(30)17(33)20(36)14(7)15-8(26(41)44-23)4-12(31)18(34)21(15)37/h1-4,13,19,22-23,27-38H,5H2/t13-,19-,22-,23+,27+/m1/s1
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
	| StdInChIKey = RNKMOGIPOMVCHO-SJMVAQJGSA-N		| StdInChIKey = TUSDEZXZIZRFGC-XIGLUPEJSA-N
	| CASNo = <!-- blanked - oldvalue: 23094-69-1 -->		| CASNo = 23094-69-1
	| CASNo_Ref = {{cascite|correct|??}}=		| CASNo_Ref = {{cascite|correct|CAS}}
	| CASOther =		| CASNoOther =
			| UNII_Ref = {{fdacite|correct|FDA}}
⚫	| PubChem = 80057787
			| UNII = 62LOS9TW6D
		⚫	| PubChem = 73568
	| ChEMBL_Ref = {{ebicite|changed|EBI}}		| ChEMBL_Ref = {{ebicite|changed|EBI}}
	| ChEMBL = 389895		| ChEMBL = 449392
	| SMILES = O=C(O2O((O)(OC(=O)c1cc(O)c(O)c(O)c1)2O)COC(=O)c3cc(O)c(O)c(O)c3)c4cc(O)c(O)c(O)c4		| SMILES = O12COC(=O)c3cc(O)c(O)c(O)c3c4c(O)c(O)c(O)cc4C(=O)O1(O)(OC(=O)c5cc(O)c(O)c(O)c5)O2
	| InChI = 1/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-21(37)23(44-25(40)9-3-13(30)19(35)14(31)4-9)22(38)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2/t17-,21-,22-,23+,27+/m1/s1		| InChI = 1/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-21(37)23(44-25(40)9-3-13(30)19(35)14(31)4-9)22(38)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2/t17-,21-,22-,23+,27+/m1/s1
	| MeSHName =		| MeSHName =
	}}		}}
	|Section2= {{Chembox Properties		|Section2={{Chembox Properties
	| Formula = C<sub>27</sub>H<sub>24</sub>O<sub>18</sub>		| Formula = C<sub>27</sub>H<sub>22</sub>O<sub>18</sub>
	| MolarMass = 636.46 g/mol		| MolarMass = 634.45 g/mol
	| ExactMass = 636.096264 u
	| Appearance =		| Appearance =
	| Density =		| Density =
Line 40:		Line 39:
	}}		}}
	}}		}}
			'''Corilagin''' is an ]. Corilagin was first isolated in 1951 from Dividivi extract and from '']'',<ref>{{Cite journal | vauthors = Schmidt OT, Lademann R | doi = 10.1002/jlac.19515710305 | title = Corilagin, ein weiterer kristallisierter Gerbstoff aus Dividivi. X. Mitteilung über natürliche Gerbstoffe | journal = Justus Liebigs Annalen der Chemie | volume = 571 | issue = 3 | pages = 232–237 | year = 1951 }}</ref><ref>{{Cite journal | vauthors = Schmidt OT, Schmidt DM | doi = 10.1002/jlac.19525780105 | title = Die Umwandlung von Chebulagsäure in Corilagin XIV. Mitteilung über natürliche Gerbstoffe | journal = Justus Liebigs Annalen der Chemie | volume = 578 | pages = 25–30 | year = 1952 }}</ref> hence the name of the molecule. It can also be found in '']'' and in the leaves of '']'' (pomegranate).<ref>{{Cite journal | vauthors = Tanaka T, Nonaka GI, Nishioka I | doi = 10.1016/S0031-9422(00)83125-8 | title = Punicafolin, an ellagitannin from the leaves of Punica granatum | journal = Phytochemistry | volume = 24 | issue = 9 | pages = 2075–2078 | year = 1985 | bibcode = 1985PChem..24.2075T }}</ref>
	'''Corilagin''' is a ]. It can be found in '']''.
			It is a weak ].<ref name=Satomi>{{cite journal | vauthors = Satomi H, Umemura K, Ueno A, Hatano T, Okuda T, Noro T | title = Carbonic anhydrase inhibitors from the pericarps of Punica granatum L | journal = Biological & Pharmaceutical Bulletin | volume = 16 | issue = 8 | pages = 787–90 | date = August 1993 | pmid = 8220326 | doi = 10.1248/bpb.16.787 | doi-access = free }}</ref>
⚫	==References==
	{{reflist}}
			] and corilagin inhibit ]–dependent ] and has been shown to attenuate ] in a mouse model.<ref>{{cite journal | vauthors = Wei Y, Kim TJ, Peng DH, Duan D, Gibbons DL, Yamauchi M, Jackson JR, Le Saux CJ, Calhoun C, Peters J, Derynck R, Backes BJ, Chapman HA | display-authors = 6 | title = Fibroblast-specific inhibition of TGF-β1 signaling attenuates lung and tumor fibrosis | journal = The Journal of Clinical Investigation | volume = 127 | issue = 10 | pages = 3675–3688 | date = October 2017 | pmid = 28872461 | pmc = 5617667 | doi = 10.1172/JCI94624 }}</ref> ] is also indicated in many health conditions, including ] and ] susceptibility.<ref>{{cite web |url=https://medicalxpress.com/news/2018-12-skin-ages-fat-immunity.html |title=Researchers identify how skin ages, loses fat and immunity |website=medicalxpress.com |access-date=5 January 2019 }}</ref>
	{{Gallotannin}}
		⚫	== References ==
⚫	]
			{{Reflist}}
			{{ellagitannin}}
	{{Natural-phenol-stub}}
		⚫	]
	]
			]
			{{Aromatic-stub}}