| Revision as of 22:46, 6 September 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits Added CSID, (std)InChI, and (std)InChIkey← Previous edit |
Latest revision as of 22:50, 6 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,249 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (18 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 376090672 |
|
| verifiedrevid = 448828501 |
|
| IUPAC_name = (3''S'',5''S'',8''R'',10''S'',13''R'',14''S'',17''R'')-5,14-dihydroxy-3-((2''R'',4''S'',5''S'',6''R'')-5-hydroxy-4-methoxy-6-methyltetrahydro-2''H''-pyran-2-yloxy)-13-methyl-17-(5-oxo-2,5-dihydrofuran-3-yl)hexadecahydro-1''H''-cyclopentaphenanthrene-10-carbaldehyde |
|
| IUPAC_name = (3''S'',5''S'',8''R'',10''S'',13''R'',14''S'',17''R'')-5,14-dihydroxy-3-((2''R'',4''S'',5''S'',6''R'')-5-hydroxy-4-methoxy-6-methyltetrahydro-2''H''-pyran-2-yloxy)-13-methyl-17-(5-oxo-2,5-dihydrofuran-3-yl)hexadecahydro-1''H''-cyclopentaphenanthrene-10-carbaldehyde |
|
| image = Cymarine.png |
|
| image = Cymarine.png |
| Line 15: |
Line 17: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 508-77-0 |
|
| CAS_number = 508-77-0 |
|
| ATC_prefix = C01 |
|
| ATC_prefix = C01 |
|
| ATC_suffix = AC03 |
|
| ATC_suffix = AC03 |
|
| PubChem = 10504 |
|
| PubChem = 441853 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 390429 |
|
| smiles = O=C\1OC/C(=C/1)2CC6(O)2(C)CC46CC5(O)C(O3O((O)(OC)C3)C)CC45C=O |
|
| smiles = O=C\1OC/C(=C/1)2CC6(O)2(C)CC46CC5(O)C(O3O((O)(OC)C3)C)CC45C=O |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C30H44O9/c1-17-26(33)23(36-3)13-25(38-17)39-19-4-9-28(16-31)21-5-8-27(2)20(18-12-24(32)37-15-18)7-11-30(27,35)22(21)6-10-29(28,34)14-19/h12,16-17,19-23,25-26,33-35H,4-11,13-15H2,1-3H3/t17-,19+,20-,21+,22-,23+,25+,26-,27-,28+,29+,30+/m1/s1 |
|
|
| InChIKey = XQCGNURMLWFQJR-ZNDDOCHDBF |
|
|
| StdInChI = 1S/C30H44O9/c1-17-26(33)23(36-3)13-25(38-17)39-19-4-9-28(16-31)21-5-8-27(2)20(18-12-24(32)37-15-18)7-11-30(27,35)22(21)6-10-29(28,34)14-19/h12,16-17,19-23,25-26,33-35H,4-11,13-15H2,1-3H3/t17-,19+,20-,21+,22-,23+,25+,26-,27-,28+,29+,30+/m1/s1 |
|
| StdInChI = 1S/C30H44O9/c1-17-26(33)23(36-3)13-25(38-17)39-19-4-9-28(16-31)21-5-8-27(2)20(18-12-24(32)37-15-18)7-11-30(27,35)22(21)6-10-29(28,34)14-19/h12,16-17,19-23,25-26,33-35H,4-11,13-15H2,1-3H3/t17-,19+,20-,21+,22-,23+,25+,26-,27-,28+,29+,30+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XQCGNURMLWFQJR-ZNDDOCHDSA-N |
|
| StdInChIKey = XQCGNURMLWFQJR-ZNDDOCHDSA-N |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = UK3LS8435E |
|
| UNII = UK3LS8435E |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1651908 |
|
| ChEMBL = 1651908 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=30 | H=44 | O=9 |
|
| C=30 | H=44 | O=9 |
|
| molecular_weight = 548.665 g/mol |
|
|
| synonyms = Cymarine; K-Strophanthin-α; NSC 7522; Strophantin K; WV 90043a; k-Strophanthin-α |
|
| synonyms = Cymarine; K-Strophanthin-α; NSC 7522; Strophantin K; WV 90043a; k-Strophanthin-α |
|
|
| melting_point = 148 |
|
}} |
|
}} |
|
|
|
|
|
'''Cymarin''' (or '''cymarine''') is a ]. '']'' used as a source of fiber by ] and '']'' ({{zh|c=羅布麻}}) used as a ] in ] both contain cymarin.<ref>''Edible and Medicinal plants of the West'', Gregory L. Tilford, ISBN 0-87842-359-1</ref> Cymarin is a cardiogenic toxin that causes cardiac arrhythmia in humans.<ref>'']'', 12th Edition, '''2830'''</ref> Cymarin is used in modern medicine in formulated pharmaceutical preparations used to treat a variety of tumors.{{Citation needed|date=August 2011}} |
|
'''Cymarin''' (or '''cymarine''') is a ]. Plants of the genus '']'', including '']'' and '']'', contain cymarin.<ref>{{cite book | title = Edible and Medicinal plants of the West | vauthors = Tilford GL | isbn = 0-87842-359-1}}</ref> Cymarin is a cardiac glycoside and an anti-] and ] agent.<ref>{{PubChem|441853}}</ref> |
|
|
|
|
|
== References == |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commonscatinline}} |
|
|
|
|
|
{{Cardiac glycosides}} |
|
{{Cardiac glycosides}} |
|
|
|
|
|
|
|
|
|
|
|
] |
|
] |