| Revision as of 10:16, 29 November 2010 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Hydroxycinnamic acid template← Previous edit |
Latest revision as of 19:56, 20 December 2023 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Vinylogous carboxylic acids using HotCat |
| (44 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile1=Cynarine.svg |
|
|
|
| Watchedfields = changed |
|
|ImageSize1=200px |
|
|
|
| verifiedrevid = 399494542 |
| ⚫ |
|ImageFile2=Cynarine3d.png |
|
|
⚫ |
| ImageFile1 = Cynarine.svg |
|
|ImageSize2=200px |
|
|
⚫ |
| ImageFile2 = Cynarine3d.png |
|
|IUPACName=(1''R'',3''R'',4''S'',5''R'')-1,3-bis<nowiki>oxy]-4,5-dihydroxycyclohexane-1-carboxylic acid |
|
| PIN = (1''R'',3''R'',4''S'',5''R'')-1,3-Bis{oxy}-4,5-dihydroxycyclohexane-1-carboxylic acid |
|
|OtherNames=1,5-Dicaffeoylquinic acid; Cynarin; Cinarin; Cinarine |
|
| OtherNames = 1,5-Dicaffeoylquinic acid; Cynarin; Cinarin; Cinarine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|CAS}} |
|
| CASNo=30964-13-7 |
|
| CASNo = 212891-05-9 |
|
| PubChem=5281769 |
|
| PubChem = 5281769 |
| ⚫ |
| SMILES=C1(((C1(C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
}} |
|
|
|
| ChEMBL = 2105478 |
|
⚫ |
| SMILES = C1(((C1(C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445082 |
|
|
| InChI = 1/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 |
|
|
| InChIKey = YDDUMTOHNYZQPO-RVXRWRFUBT |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YDDUMTOHNYZQPO-RVXRWRFUSA-N |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 85D81U9JAV |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=25|H=25|O=12 |
|
| C=25|H=24|O=12 |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Cynarine''' is a ] and a biologically active chemical constituent of ].<ref>{{cite journal | doi = 10.1038/1741062a0 | pmid = 13214078 | title = Constitution of Cynarine, the Active Principle of the Artichoke | year = 1954 | last1 = Panizzi | first1 = Luigi | last2 = Scarpati | first2 = Maria Luisa | journal = Nature | volume = 174 | issue = 4440 | pages = 1062}}</ref> Chemically, it is an ester formed from ] and two units of ]. |
|
'''Cynarine''' is a ] ] and a biologically active chemical constituent of ] (''Cynara cardunculus'').<ref>{{cite journal |doi = 10.1038/1741062a0 |pmid = 13214078 |title = Constitution of Cynarine, the Active Principle of the Artichoke |year = 1954 |last1 = Panizzi |first1 = Luigi |last2 = Scarpati |first2 = Maria Luisa |journal = Nature |volume = 174 |issue = 4440 |pages = 1062–3|s2cid = 4254603 |doi-access = free }}</ref> |
|
|
|
|
|
|
Chemically, it is an ] formed from ] and two units of ]. |
| ⚫ |
==References== |
|
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Hydroxycinnamic acid}} |
|
{{Hydroxycinnamic acid}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
⚫ |
{{aromatic-stub}} |
|
|
|
| ⚫ |
{{polyphenol-stub}} |
|
|
|
|
|
] |
|
|
] |
|