Misplaced Pages

Cytidine triphosphate: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:35, 25 August 2011 editChuispastonBot (talk | contribs)100,206 editsm r2.7.1) (robot Adding: gl:Citidín trifosfato← Previous edit Latest revision as of 17:02, 30 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name 
(24 intermediate revisions by 21 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{Unreferenced stub|auto=yes|date=December 2009}}
{{Chembox {{Chembox
| verifiedrevid = 400825086 | verifiedrevid = 446646289
|ImageFile=CTP chemical structure.png | ImageFile=Cytidintriphosphat_protoniert.svg
|ImageSize=250px | ImageSize=240px
| ImageAlt = Skeletal formula of cytidine triphosphate as an anion (3- charge)
|IUPACName=methyl(hydroxy-phosphonooxyphosphoryl)hydrogen phosphate
|OtherNames=CTP; Cytidine-5'-triphosphate; Cytidine 5'-(tetrahydrogen triphosphate) | ImageFile1 = Cytidine triphosphate anion 3D spacefill.png
| ImageSize1 = 220
⚫ |Section1= {{Chembox Identifiers
| ImageAlt1 = Space-filling model of the cytidine triphosphate molecule as an anion (4- charge)
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| IUPACName=Cytidine 5′-(tetrahydrogen triphosphate)
| SystematicName=''O''<sup>1</sup>-<nowiki/>{methyl} tetrahydrogen triphosphate
| OtherNames=CTP; Cytidine-5'-triphosphate
⚫ |Section1={{Chembox Identifiers
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 19952488 | ChemSpiderID = 19952488
| InChI = 1/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 | InChI = 1/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
Line 19: Line 24:
| StdInChIKey = NPIWPFUCEAMYFN-LLWADOMFSA-N | StdInChIKey = NPIWPFUCEAMYFN-LLWADOMFSA-N
| CASNo=65-47-4 | CASNo=65-47-4
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | PubChem=6176
| UNII = K0118UX80T
⚫ | PubChem=6176
| IUPHAR_ligand = 1741 | IUPHAR_ligand = 1741
| SMILES = c1cn(c(=O)nc1N)2(((O2)CO(=O)(O)O(=O)(O)OP(=O)(O)O)O)O | SMILES = c1cn(c(=O)nc1N)2(((O2)CO(=O)(O)O(=O)(O)OP(=O)(O)O)O)O
| MeSHName = Cytidine+triphosphate | MeSHName = Cytidine+triphosphate
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula=C<sub>9</sub>H<sub>16</sub>N<sub>3</sub>O<sub>14</sub>P<sub>3</sub> | Formula=C<sub>9</sub>H<sub>16</sub>N<sub>3</sub>O<sub>14</sub>P<sub>3</sub>
| MolarMass=483.156 | MolarMass=483.156
| Appearance= | Appearance=
| Density= | Density=
| MeltingPt= | MeltingPt=
| BoilingPt= | BoilingPt=
| Solubility= | Solubility=
}} }}
|Section3= {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt= | FlashPt=
| AutoignitionPt =
| Autoignition=
}} }}
}} }}


'''Cytidine triphosphate''' ('''CTP''') is a ] ]. CTP, much like ], consists of a ribose sugar, and three phosphate groups. The major difference between the two molecules is the base used, which in CTP is ].
'''Cytidine triphosphate''' is a ] ].


CTP is a ] in the synthesis of ]. CTP is a ] in the synthesis of ].


CTP is a high-energy molecule equal to ], but its role in the organism is more specific than that of ATP. CTP is a ] similar to ATP, but its role as an energy coupler is limited to a much smaller subset of metabolic reactions.
<!--This statement represents an illogical equation, which needs clarification: Is it meant that the energy donation of CTP is equal to that of ATP? Or is it meant that the role of CTP is equal in significance to that of ATP? Or is it meant that the number of CTP molecules present in the organism is equal to that of ATP?--> <!--This statement represents an illogical equation, which needs clarification: Is it meant that the energy donation of CTP is equal to that of ATP? Or is it meant that the role of CTP is equal in significance to that of ATP? Or is it meant that the number of CTP molecules present in the organism is equal to that of ATP?-->
CTP is used as the source of energy, and as a ] in metabolic reactions like the synthesis of ] and ] of proteins. CTP is a ] in metabolic reactions like the synthesis of ], where it is used for activation and transfer of diacylglycerol and lipid head groups,<ref name="Plantbiochemistry">{{Cite book|last1=Buchanan|first1=Bob B.|url=https://archive.org/details/biochemistrymole00buch|title=Biochemistry & molecular biology of plants|last2=Gruissem|first2=Wilhelm|last3=Jones|first3=Russell L.|publisher=American society of plant physiology|year=2000|isbn=978-0-943088-39-6|edition=1st|url-access=registration|name-list-style=vanc}}</ref> and ] of proteins.


CTP also acts as an inhibitor of the enzyme ] CTP acts as an inhibitor of the enzyme ], which is used in ].<ref>Blackburn, G. Michael. ''Nucleic Acids in Chemistry and Biology''. The Royal Society of Chemistry, 2006, p. 119-120.</ref>


==See also== ==See also==
⚫ * ]
⚫ * ]
* ] * ]
⚫ * ]
* ]
⚫ * ]

==References==
{{Reflist|2}}


{{Nucleobases, nucleosides, and nucleotides}} {{Nucleobases, nucleosides, and nucleotides}}
{{Purinergics}}


{{DEFAULTSORT:Cytidine Triphosphate}} {{DEFAULTSORT:Cytidine Triphosphate}}

] ]
]
] ]

{{Organic-compound-stub}}
{{Biochemistry-stub}}

]
]
]
]
]
]
]
]
]
]
]
]
]
]