| Revision as of 16:59, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{chembox}} taken from revid 461879306 of page 2,3-Dimethoxy-4,5-methylenedioxyamphetamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 05:03, 13 January 2025 edit ShelfSkewed (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers292,831 edits Dab link |
| Line 1: |
Line 1: |
|
|
{{short description|Bioactive phenylethylamine}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 413103401 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = DMMDA-2 |
|
|
⚫ |
| verifiedrevid = 477210401 |
|
| ImageFile = DMMDA-2.svg |
|
|
| ImageSize = 200px |
|
| Name = DMMDA-2 |
|
⚫ |
| ImageFile = DMMDA-2.svg |
| ⚫ |
| ImageName = |
|
|
|
| ImageSize = |
|
| IUPACName = 2,3-Dimethoxy-4,5-methylenedioxyamphetamine |
|
|
⚫ |
| ImageName = |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| PIN = 1-(6,7-Dimethoxy-2''H''-1,3-benzodioxol-5-yl)propan-2-amine |
| ⚫ |
| InChI = 1/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| InChI = 1/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3 |
|
| InChIKey = UQXNREZPUUGSKM-UHFFFAOYAC |
|
| InChIKey = UQXNREZPUUGSKM-UHFFFAOYAC |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 424156 |
|
| ChEMBL = 424156 |
|
|
| PubChem = 16766527 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3 |
|
| StdInChI = 1S/C12H17NO4/c1-7(13)4-8-5-9-11(17-6-16-9)12(15-3)10(8)14-2/h5,7H,4,6,13H2,1-3H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UQXNREZPUUGSKM-UHFFFAOYSA-N |
|
| StdInChIKey = UQXNREZPUUGSKM-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|chemspider}} |
|
| CASNo = <!-- blanked - oldvalue: 15183-26-3 --> |
|
| CASNo = 15183-26-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = EPG4XUJ647 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID=21106292 |
|
| ChemSpiderID =21106292 |
|
| SMILES = CC(N)Cc1cc2OCOc2c(OC)c1OC |
|
| SMILES = CC(N)Cc1cc2OCOc2c(OC)c1OC |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>4</sub> |
|
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>4</sub> |
|
| MolarMass = 239.27 g/mol |
|
| MolarMass = 239.27 g/mol |
|
|
| MeltingPtC = 178 to 180 |
|
| MeltingPt = 178–180 °C |
|
|
|
| MeltingPt_notes = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''DMMDA-2''' is a ] ] discussed by ] in his book '']''; however, he was not the first to synthesize it.<ref name="urlErowid Online Books : PIHKAL - #59 DMMDA-2">{{cite web |url=http://www.erowid.org/library/books_online/pihkal/pihkal059.shtml |title=#59 DMMDA-2|publisher= Erowid|work=PiHKAL: a chemical love story|access-date= 22 November 2011}}</ref> Shulgin comments in his book that a 50 milligram dose of DMMDA-2 produces similar effects to ].<ref name="urlErowid Online Books : PIHKAL - #59 DMMDA-2" /> DMMDA-2 can be synthesized from ].<ref name="urlErowid Online Books : PIHKAL - #59 DMMDA-2" /> |
|
|
|
|
|
DMMDA-2 is equivalent to 5 mescaline units. DMMDA-2's isomer DMMDA is equivalent to 12 mescaline units.<ref>{{Cite journal | author = Clare, Brian W. | year = 1990 | title = Structure-Activity Correlations for Psychotomimetics. 1. Phenylalkylamines: Electronic, Volume, and Hydrophobicity Parameters | journal = Journal of Medicinal Chemistry | volume = 33 | issue = 7 | pages = 687–702 | url = https://www.erowid.org/archive/rhodium/pdf/sar.psychotomimetics-1.pdf | access-date = 2025-01-07}}</ref> |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
==Further reading== |
|
|
* {{cite web |url= http://pihkal.info/read.php?domain=pk&id=59|title= #59 DMMDA-2: 2,3-Dimethoxy-4,5-methylenedioxyamphetamine|date= 10 November 2009|work= PiHKAL • info|access-date=20 November 2011}} |
|
|
* {{Cite journal | last1 = Shulgin | first1 = A. T. | last2 = Sargent | first2 = T. | doi = 10.1038/2151494b0 | title = Psychotropic Phenylisopropylamines derived from Apiole and Dillapiole | journal = Nature | volume = 215 | issue = 5109 | pages = 1494–5 | year = 1967 | pmid = 4861200| bibcode = 1967Natur.215.1494S | s2cid = 26334093 }} |
|
|
|
|
|
{{Phenethylamines}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |