| Revision as of 07:36, 10 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 21:16, 15 October 2023 edit undoCitation bot (talk | contribs)Bots5,418,885 edits Add: bibcode. | Use this bot. Report bugs. | Suggested by Abductive | Category:Phytoalexins | #UCB_Category 14/15 |
| (25 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 426856886 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 428385498 |
|
| Name = Danielone |
|
| Name = Danielone |
|
| ImageFile = Danielone.png |
|
| ImageFile = Danielone.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of danielone |
|
| ImageName = Chemical structure of danielone |
|
| ImageAlt = Chemical structure of danielone |
|
| ImageAlt = Chemical structure of danielone |
|
| IUPACName = 2-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)ethanone |
|
| PIN = 2-Hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)ethan-1-one |
|
| OtherNames = 3',5'-dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone<!-- <br> --> |
|
| OtherNames = {{ubl|α-Hydroxyacetosyringone | 3',5'-Dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone}} |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 90426-22-5 |
|
| CASNo = 90426-22-5 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
|
| PubChem = 146167 |
|
| PubChem = 146167 |
|
| SMILES = COC1=CC(=CC(=C1O)OC)C(=O)CO |
|
| SMILES = COC1=CC(=CC(=C1O)OC)C(=O)CO |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 128934 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 4316 |
|
|
| InChI = 1/C10H12O5/c1-14-8-3-6(7(12)5-11)4-9(15-2)10(8)13/h3-4,11,13H,5H2,1-2H3 |
|
|
| InChIKey = ZTBAPEIDNUHRNC-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H12O5/c1-14-8-3-6(7(12)5-11)4-9(15-2)10(8)13/h3-4,11,13H,5H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZTBAPEIDNUHRNC-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=10 | H=12 | O=5 |
|
| Formula = C<sub>10</sub>H<sub>12</sub>O<sub>5</sub> |
|
|
| MolarMass = 212.19 g/mol |
|
|
| ExactMass = 212.068473 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
| GHS_ref =<!-- no GHS in pubchem Dec2021 --> |
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Danielone''' is a ] found in the ] fruit.<ref>Danielone, a phytoalexin from papaya fruit. Echeverri F., Torres F., Quinones W., Cardona G., Archbold R., Roldan J., Brito I., Luis J.G., and LahlouU E.-H., Phytochemistry, 1997, vol. 44, no2, pp. 255-256, {{INIST|2558881}}</ref> |
|
'''Danielone''' is a ] found in the ] fruit. This compound showed high antifungal activity against '']'', a pathogenic fungus of papaya.<ref>{{Cite journal | pmid = 9004541| year = 1997| last1 = Echeverri| first1 = F.| title = Danielone, a phytoalexin from papaya fruit| journal = Phytochemistry| volume = 44| issue = 2| pages = 255–6| last2 = Torres| first2 = F.| last3 = Quiñones| first3 = W.| last4 = Cardona| first4 = G.| last5 = Archbold| first5 = R.| last6 = Roldan| first6 = J.| last7 = Brito| first7 = I.| last8 = Luis| first8 = J. G.| last9 = Lahlou| first9 = E. H.| doi=10.1016/s0031-9422(96)00418-9| bibcode = 1997PChem..44..255E}}</ref> A laboratory synthesis of danielone has been reported.<ref>{{Cite journal | doi = 10.1039/A808061E| title = Synthesis of Danielone (α-Hydroxyacetosyringone)| journal = Journal of Chemical Research| issue = 3| pages = 220–221| year = 1999| last1 = Luis| first1 = Javier G.| last2 = Andrés| first2 = Lucía S.}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenols-stub}} |
|
|
|
{{aromatic-stub}} |