| Revision as of 09:39, 29 August 2011 editChuispastonBot (talk | contribs)100,206 editsm r2.7.1) (robot Adding: gl:Desoxiadenosina difosfato← Previous edit |
Latest revision as of 17:26, 29 June 2024 edit undoTeaktl17 (talk | contribs)Extended confirmed users17,864 edits cat update |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 413258262 |
|
|
|
| Watchedfields = changed |
|
|ImageFile=DADP chemical structure.png |
|
|
⚫ |
| verifiedrevid = 447288226 |
| ⚫ |
|ImageSize= |
|
|
|
| ImageFile=Desoxyadenosindiphosphat protoniert.svg |
|
|IUPACName=<nowiki>[5-(6-aminopurin-9-yl)-3-hydroxyoxolan- |
|
|
⚫ |
| ImageSize=220 |
|
2-yl]methyl phosphono hydrogen</nowiki> |
|
|
|
| ImageAlt = Skeletal formula of adenosine diphosphate |
| ⚫ |
|OtherNames=dADP |
|
|
⚫ |
| ImageFile1 = Deoxyadenosine-diphosphate-anion-3D-balls.png |
| ⚫ |
|Reference=<ref>, ].</ref> |
|
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Ball-and-stick model of the adenosine diphosphate anion |
|
|
| IUPACName=2′-Deoxyadenosine 5′-(trihydrogen diphosphate) |
|
|
| SystematicName=methyl trihydrogen diphosphate |
|
⚫ |
| OtherNames=dADP |
|
⚫ |
| Reference=<ref>, ].</ref> |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=2793-06-8 |
|
| CASNo=2793-06-8 |
| ⚫ |
| PubChem=620 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| MeSHName=Deoxyadenosine+diphosphate |
|
|
|
| UNII = APQ916I0QD |
| ⚫ |
| SMILES=C1C(C(OC1N2C=NC3=C2N=CN=C3N) COP(=O)(O)OP(=O)(O)O)O |
|
|
|
| MeSHName=Deoxyadenosine+diphosphate |
|
⚫ |
| PubChem = 188966 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 164196 |
|
⚫ |
| SMILES = C1((O1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O)O |
|
|
| InChI = 1/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
|
|
| InChIKey = DAEAPNUQQAICNR-RRKCRQDMBL |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = DAEAPNUQQAICNR-RRKCRQDMSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>15</sub>N<sub>5</sub>O<sub>9</sub>P<sub>2</sub> |
|
| Formula=C<sub>10</sub>H<sub>15</sub>N<sub>5</sub>O<sub>9</sub>P<sub>2</sub> |
|
| MolarMass=411.201722 |
|
| MolarMass=411.201722 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Deoxyadenosine diphosphate''' is a derivative of the common ] ATP, or ], in which the -OH (]) group on the 2' carbon on the nucleotide's ] has been removed (hence the deoxy- part of the name). Additionally, the diphosphate of the name indicates that one of the ] groups of ATP has been removed, most likely by ]. |
|
'''Deoxyadenosine diphosphate''' is a ]. It is related to the common ] ATP, or ], with the -OH (]) group on the 2' carbon on the nucleotide's ] removed (hence the deoxy- part of the name), and with one fewer ] group than ATP. This makes it also similar to ] except with a hydroxyl group removed. |
|
|
|
|
|
Deoxyadenosine diphosphate would be abbreviated dADP. |
|
Deoxyadenosine diphosphate is abbreviated dADP. |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 43: |
Line 61: |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|