| Revision as of 07:32, 11 February 2011 editLucienBOT (talk | contribs)103,060 editsm r2.6.4) (robot Adding: nl:Deoxycytidinedifosfaat← Previous edit |
Latest revision as of 17:14, 18 July 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,565 editsNo edit summary |
| (35 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced|date=October 2006}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=2'-Desoxycytidindiphosphat.svg |
|
|
|
| Watchedfields = changed |
|
|ImageSize= |
|
|
|
| verifiedrevid = 447288252 |
|
|IUPACName= |
|
|
⚫ |
| ImageFile = Desoxycytidindiphosphat protoniert.svg |
|
|OtherNames= |
|
|
|
| ImageAlt = Skeletal formula of deoxycytidine diphosphate as an anion (3- charge) |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1 = Deoxycytidine diphosphate anion 3D spacefill.png |
| ⚫ |
| CASNo=800-73-7 |
|
|
|
| ImageSize1 = 210 |
| ⚫ |
| PubChem=3972 |
|
|
|
| ImageAlt1 = Space-filling model of the deoxycytidine diphosphate molecule as an anion (3- charge) |
|
| SMILES=Nc1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
|
|
| MeSHName=deoxycytidine+diphosphate |
|
| IUPACName=2′-Deoxycytidine 5′-(trihydrogen diphosphate) |
|
|
| SystematicName=methyl trihydrogen diphosphate |
|
|
| OtherNames=2'-Deoxycytidine diphosphate |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=800-73-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = M07S1BKN37 |
|
⚫ |
| PubChem=150855 |
|
|
| MeSHName=deoxycytidine+diphosphate |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 132961 |
|
|
| SMILES = O=P(O)(O)OP(=O)(O)OC2O(N/1C(=O)/N=C(/N)\C=C\1)C2O |
|
|
| InChI = 1/C9H15N3O10P2/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
|
|
| InChIKey = FTDHDKPUHBLBTL-SHYZEUOFBT |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C9H15N3O10P2/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FTDHDKPUHBLBTL-SHYZEUOFSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=9 | H=15 | N=3 | O=10 | P=2 |
|
| Formula=C<sub>9</sub>H<sub>15</sub>N<sub>3</sub>O<sub>10</sub>P<sub>2</sub> |
|
|
|
| Appearance= |
|
| MolarMass=387.177 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Deoxycytidine diphosphate''' is a derivative of the common ], ] or (CTP), in which the ] or (-OH) group on the 2nd carbon of the nucleotide's ] has been removed—hence the ''deoxy-'' part of the name. The ] of the name indicates that one of the ] groups of CTP has been removed, most likely by ]. |
|
'''Deoxycytidine diphosphate''' is a ]. It is related to the common ] CTP, or ], with the -OH (]) group on the 2' carbon on the nucleotide's ] removed (hence the deoxy- part of the name), and with one fewer ] group than CTP . |
|
|
|
|
|
|
2'-Deoxycytidine diphosphate is abbreviated as ''dCDP''.<ref>, accessed Dec. 31, 2012</ref> |
|
Deoxyguanosine diphosphate would be abbreviated dCDP. |
|
|
|
|
|
|
== Synthesis of cytidine nucleotides == |
|
|
Deoxycytidine diphosphate is synthesized through the oxidation-reduction reaction of ] which is catalyzed by the presence of ].<ref>{{Cite journal |last1=Kandeel |first1=Mahmoud |last2=Al-Taher |first2=Abdulla |date=2020-11-01 |title=Metabolic drug targets of the cytosine metabolism pathways in the dromedary camel (Camelus dromedarius) and blood parasite Trypanosoma evansi |url=https://doi.org/10.1007/s11250-020-02366-8 |journal=Tropical Animal Health and Production |language=en |volume=52 |issue=6 |pages=3337–3358 |doi=10.1007/s11250-020-02366-8 |pmid=32926292 |s2cid=221722974 |issn=1573-7438}}</ref> Additionally, ribonucleoside-diphosphate reductase is capable of binding and catalyzing both the formation of deoxyribonucleotides from ribonucleotide.<ref>{{Cite journal |last=Torrents |first=Eduard |date=2014 |title=Ribonucleotide reductases: essential enzymes for bacterial life |journal=Frontiers in Cellular and Infection Microbiology |volume=4 |page=52 |doi=10.3389/fcimb.2014.00052 |pmid=24809024 |pmc=4009431 |issn=2235-2988|doi-access=free }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 35: |
Line 54: |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
==Further reading== |
|
|
* {{cite journal|author=Kennedy, Eugene P.|author2=Louise Fencil Borkenhagen|author3=Sylvia Wagner Smith|title=Possible Metabolic Functions of Deoxycytidine Diphosphate Choline and Deoxycytidine Diphosphate Ethanolamine|journal=Journal of Biological Chemistry|year=1959|volume=234|issue=8|pages=1998–2000|doi=10.1016/S0021-9258(18)69855-2|pmid=13673002|url=http://www.jbc.org/content/234/8/1998.full.pdf+html|doi-access=free}} |
|
|
* {{cite journal|author=Reichard, Peter|title=Enzymatic Synthesis of Deoxyribonucleotides: I. FORMATION OF DEOXYCYTIDINE DIPHOSPHATE FROM CYTIDINE DIPHOSPHATE WITH ENZYMES FROM ESCHERICHIA COLI|journal=Journal of Biological Chemistry|year=1962|volume=237|pages=3513–3519|doi=10.1016/S0021-9258(19)70849-7|pmid=13973714|url=http://www.jbc.org/content/237/11/3513.full.pdf+html|doi-access=free}}. |
|
|
|
|
|
{{Nucleobases, nucleosides, and nucleotides}} |
|
{{Nucleobases, nucleosides, and nucleotides}} |
| Line 40: |
Line 66: |
|
{{DEFAULTSORT:Deoxycytidine Diphosphate}} |
|
{{DEFAULTSORT:Deoxycytidine Diphosphate}} |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
{{Biochem-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|