| Revision as of 06:54, 29 August 2011 editLuckas-bot (talk | contribs)929,662 editsm r2.7.1) (robot Adding: gl:Desoxicitidina trifosfato← Previous edit |
Latest revision as of 18:28, 30 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (24 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced|auto=yes|date=December 2009}} |
|
{{Refimprove|date=September 2014}} |
|
{{Expert-subject|Chemistry|date=November 2008}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 417224336 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Desoxycytidintriphosphat protoniert.svg |
|
|
⚫ |
| verifiedrevid = 447271417 |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile=Desoxycytidintriphosphat protoniert.svg |
|
|IUPACName= |
|
|
⚫ |
| ImageSize=240 |
| ⚫ |
|OtherNames= |
|
|
|
| ImageAlt = Skeletal formula of deoxycytidine triphosphate |
|
|
| ImageFile1 = Deoxycytidine triphosphate anion 3D spacefill.png |
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Space-filling model of the deoxycytidine triphosphate molecule as an anion (4- charge) |
|
|
| IUPACName=2′-Deoxycytidine 5′-(tetrahydrogen triphosphate) |
|
|
| SystematicName=''O''<sup>1</sup>-<nowiki/>{methyl} tetrahydrogen triphosphate |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=2056-98-6 |
|
| CASNo=2056-98-6 |
|
| PubChem=65091 |
|
| PubChem=65091 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| SMILES=C1C(C(OC1N2C=CC(=NC2=O)N) COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |
|
|
|
| ChemSpiderID = 58601 |
|
|
| ChEBI = 16311 |
|
⚫ |
| SMILES = C1((O1N2C=CC(=NC2=O)N)CO(=O)(O)O(=O)(O)OP(=O)(O)O)O |
|
|
| InChI = 1/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
|
|
| InChIKey = RGWHQCVHVJXOKC-SHYZEUOFBW |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RGWHQCVHVJXOKC-SHYZEUOFSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=9 | H=16 | N=3 | O=13 | P=3 |
|
| Formula=C<sub>9</sub>H<sub>16</sub>N<sub>3</sub>O<sub>13</sub>P<sub>3</sub> |
|
|
|
| Appearance= |
|
| MolarMass=467.156923 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Deoxycytidine triphosphate''' ('''dCTP''') is a ] that is used whenever ] is synthesized, such as in the ]. |
|
|
e.g.: |
|
|
|
|
|
|
|
'''Deoxycytidine triphosphate''' ('''dCTP''') is a ] that contains the ] base ]. The triphosphate group contains high-energy phosphoanhydride bonds, which liberate energy when ]. |
|
A ] can be written that represents the process: |
|
|
|
|
|
|
] enzymes use this energy to incorporate ] into a newly synthesized strand of ]. A ] can be written that represents the process: |
|
|
|
|
|
: (DNA)<sub>n</sub> + dCTP ↔ (DNA)<sub>n</sub>-C + PP<sub>i</sub> |
|
: (DNA)<sub>n</sub> + dCTP ↔ (DNA)<sub>n</sub>-C + PP<sub>i</sub> |
| Line 38: |
Line 52: |
|
Subsequent hydrolysis of the PP<sub>i</sub> drives the equilibrium of the reaction toward the right side, i.e. incorporation of the nucleotide in the growing DNA chain. |
|
Subsequent hydrolysis of the PP<sub>i</sub> drives the equilibrium of the reaction toward the right side, i.e. incorporation of the nucleotide in the growing DNA chain. |
|
|
|
|
|
|
Like other nucleoside triphosphates, manufacturers recommend that dCTP be stored in aqueous solution at −20 °C.<ref>{{cite web | url=http://www.bioline.com/media/pdf/dNTP_GBLV2.pdf | title=Definitive Guide to dNTPs | access-date=July 29, 2017}}</ref> |
|
It is stored at -20 degrees Celsius. |
|
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
{{Nucleobases, nucleosides, and nucleotides}} |
|
{{Nucleobases, nucleosides, and nucleotides}} |
| Line 48: |
Line 68: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
{{Biochemistry-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|