| Revision as of 21:21, 15 January 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 04:49, 26 December 2024 edit undoWhywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,132 edits infobox |
| (71 intermediate revisions by 35 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox | verifiedrevid = 404196105 |
|
|
|
{{Use dmy dates|date=June 2024}} |
|
| |
|
|
|
{{cs1 config |name-list-style=vanc |display-authors=6}} |
|
| IUPAC_name = <nowiki>(2S)-N--1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl) |
|
|
|
{{Drugbox |
|
-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide</nowiki> |
|
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 408086549 |
|
| image = Deslorelin.svg |
|
| image = Deslorelin.svg |
|
| CAS_number = |
|
| width = 250 |
|
|
| alt = |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Suprelorin, others |
|
|
| Drugs.com = {{drugs.com|international|deslorelin}} |
|
|
| pregnancy_category = |
|
|
| routes_of_administration = ] |
|
|
| class = ]; ]; ] |
|
| ATCvet = yes |
|
| ATCvet = yes |
|
| ATC_prefix = H01 |
|
| ATC_prefix = H01 |
|
| ATC_suffix = CA93 |
|
| ATC_suffix = CA93 |
|
|
|
|
| PubChem = 7979044 |
|
|
|
<!-- Legal status --> |
|
| DrugBank = |
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
|
| C=64 | H=83| N=17| O=12| |
|
|
|
| legal_AU_comment = |
|
| molecular_weight = 1282.45 g/mol |
|
|
|
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> |
|
| protein_bound= |
|
|
|
| legal_BR_comment = |
|
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_CA_comment = |
|
|
| legal_DE = <!-- Anlage I, II, III or Unscheduled --> |
|
|
| legal_DE_comment = |
|
|
| legal_NZ = <!-- Class A, B, C --> |
|
|
| legal_NZ_comment = |
|
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> |
|
|
| legal_UK_comment = |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_US_comment = |
|
|
| legal_EU = Rx-only |
|
|
| legal_EU_comment = <ref>{{cite web | title=Suprelorin EPAR | website=European Medicines Agency | date=11 July 2007 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/suprelorin | access-date=15 June 2024}}</ref><ref>{{cite web | title=Suprelorin PI | website=Union Register of medicinal products | date=12 July 2007 | url=https://ec.europa.eu/health/documents/community-register/html/v072.htm | access-date=26 December 2024}}</ref> |
|
|
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> |
|
|
| legal_UN_comment = |
|
|
| legal_status = <!-- For countries not listed above --> |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
|
| CAS_number = 57773-65-6 |
|
|
| PubChem = 16133804 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2365665 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = TKG3I66TVE |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 16736553 |
|
| synonyms = |
|
| synonyms = |
|
|
|
|
| elimination_half-life= |
|
|
|
<!--Chemical data--> |
|
| excretion = renal |
|
|
|
| IUPAC_name = <nowiki>(2S)-N--1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide</nowiki> |
|
| pregnancy_category = X (]) |
|
|
|
| C=64 | H=83 | N=17 | O=12 |
|
| legal_status = |
|
|
| smiles = CCNC(=O)C1CCCN1C(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CO)NC(=O)C(NC(=O)C(CC3=CC=N3)NC(=O)C4CCC(=O)N4)CC5=CC6=C5C=CC=C6)CC7=CC8=C7C=CC=C8 |
|
| SMILES = CCNC(=O)1CCCN1C(=O)(CCCNC(=N)N)NC(=O)(CC(C)C)NC(=O)(Cc2cc3c2cccc3)NC(=O)(Cc4ccc(cc4)O)NC(=O)(CO)NC(=O)(Cc5cc6c5cccc6)NC(=O)(Cc7cnc7)NC(=O)8CCC(=O)N8 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| routes_of_administration = ] / Inhalation |
|
|
|
| StdInChI = 1S/C64H83N17O12/c1-4-68-62(92)53-16-10-24-81(53)63(93)46(15-9-23-69-64(65)66)74-56(86)47(25-35(2)3)75-58(88)49(27-37-30-70-43-13-7-5-11-41(37)43)77-57(87)48(26-36-17-19-40(83)20-18-36)76-61(91)52(33-82)80-59(89)50(28-38-31-71-44-14-8-6-12-42(38)44)78-60(90)51(29-39-32-67-34-72-39)79-55(85)45-21-22-54(84)73-45/h5-8,11-14,17-20,30-32,34-35,45-53,70-71,82-83H,4,9-10,15-16,21-29,33H2,1-3H3,(H,67,72)(H,68,92)(H,73,84)(H,74,86)(H,75,88)(H,76,91)(H,77,87)(H,78,90)(H,79,85)(H,80,89)(H4,65,66,69)/t45-,46-,47-,48-,49+,50-,51-,52-,53-/m0/s1 |
|
| Excipients = Lactide/glycolide copolymer |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = GJKXGJCSJWBJEZ-XRSSZCMZSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Deslorelin''' acetate is an injectable ] super-agonist (]) also known as an LHRH agonist. It stops the production of sex hormones (] and ]). |
|
'''Deslorelin''', sold under the brand name '''Suprelorin''' among others, is an ] ] ] (]) which is used in ] for various indications. |
|
|
|
|
|
|
==Uses== |
|
Deslorelin Acetate is marketed by ] with the brand name '''Ovuplant'''.<ref></ref> It is currently approved for use in veterinary medicine and is used to induce ] in mares as part of the ] process. It is also used to stabilize high-risk pregnancies, mainly of ]. Unlike other GnRH agonists, which are mainly used to inhibit ] and ] by their ultimate ] of the ], Deslorelin is primarily used for the initial flare effect upon the pituitary, and its associated surge of LH secretion. |
|
|
|
|
|
|
|
===Veterinary=== |
|
==Pharmacokinetics== |
|
|
|
Deslorelin is used in ]. One commercial form of deslorelin acetate is marketed by Peptech with the brand name Ovuplant.<ref>{{Cite web |url=http://www.ovuplant.com/ |title=Peptech official Ovuplant site |access-date=6 February 2009 |archive-date=18 November 2009 |archive-url=https://web.archive.org/web/20091118154727/http://www.ovuplant.com/ |url-status=dead }}</ref> Another form is available in the United States, Sucromate Equine,<ref>{{Cite web |url=http://www.sucromate.com/ |title=Thorne BioScience official Sucromate site |access-date=17 July 2016 |archive-date=23 January 2021 |archive-url=https://web.archive.org/web/20210123005011/https://sucromate.com/ |url-status=dead }}</ref> which was FDA-approved for use in horses in November 2010.<ref></ref> This is manufactured by Thorne BioScience LLC and was introduced to the United States market following the withdrawal of Ovuplant. The deslorelin products are currently approved for use in veterinary medicine and to promote ] in mares as part of the ] process. It is also used to stabilize high-risk pregnancies, mainly of ]. Unlike other GnRH agonists, which are mainly used to inhibit ] and ] by their ultimate ] of the ], Deslorelin is primarily used for the initial flare effect upon the pituitary, and its associated surge of LH secretion. Suprelorin is a slowly releasing deslorelin implant used for chemical castration of dogs and ferrets. It is marketed by Virbac. Deslorelin is also used to treat benign prostate hyperplasia in dogs. It is also used to treat ] suffering from ] behavior.<ref name="yarmouth">{{cite web |title=TREATMENT OF CHRONIC EGG LAYING |url=https://yarmouthvetcenter.com/egg-laying-treatment-of-chronic-egg-laying.pml |website=Yarmouth Veterinary Center |access-date=29 December 2020 |archive-date=24 November 2020 |archive-url=https://web.archive.org/web/20201124004845/https://www.yarmouthvetcenter.com/egg-laying-treatment-of-chronic-egg-laying.pml |url-status=dead }}</ref> |
|
Deslorelin is a synthetic analogue of a naturally occurring luteinising-hormone releasing hormone (]). Bioavailability is almost complete. |
|
|
|
|
|
|
==Clinical trials== |
|
==Pharmacology== |
|
|
|
|
|
|
===Pharmacokinetics=== |
|
Deslorelin was successfully trialed in the US and was approved for veterinary use under certain circumstances. In Europe, it was approved for use in ] ].<ref> - European Agency for the Evaluation of Medicinal Products</ref> |
|
|
|
{{unreferenced section|date=June 2024}} |
|
|
|
|
|
|
] is almost complete. |
|
It is also being trialed in humans to study its efficacy in treatment of ] in women,<ref> - ]</ref> and in treating ] and ] in male and female children.<ref> - ]</ref> |
|
|
|
|
|
|
|
==Chemistry== |
|
As of early 2009, this drug is not approved for use in the US, other than within approved clinical trials. |
|
|
|
{{unreferenced section|date=June 2024}} |
|
|
|
|
|
|
Deslorelin is a ] ] of ] ] (GnRH). |
|
==References== |
|
|
|
|
|
|
==History== |
|
|
Deslorelin was successfully trialed in the U.S. and was approved for veterinary use under certain circumstances. In Europe, it was approved for use in ] ].<ref> {{Webarchive|url=https://web.archive.org/web/20180124135619/http://www.ema.europa.eu/ema/index.jsp?curl=pages%2Fincludes%2Fdocument%2Fdocument_detail.jsp%3FwebContentId%3DWC500013629&mid=WC0b01ac058008d7ad |date=24 January 2018 }} - European Medicines Agency</ref> |
|
|
|
|
|
Ovuplant was withdrawn from the U.S. market following issues with mares which did not become pregnant failing to return to estrus in a timely manner. Techniques were developed where the implant was removed 48 hours after implantation in the mare,<ref>{{cite journal | vauthors = McCue PM, Farquhar VJ, Carnevale EM, Squires EL | title = Removal of deslorelin (Ovuplant) implant 48 h after administration results in normal interovulatory intervals in mares | journal = Theriogenology | volume = 58 | issue = 5 | pages = 865–70 | date = September 2002 | pmid = 12212887 | doi = 10.1016/s0093-691x(02)00923-8 }}</ref> however compounded biorelease Deslorelin products were at the time available as well as more commonly used ovulation promoters such as ], which did not produce the same failure effect. Upon "Sucromate Equine" receiving FDA-approval, the compounded products were no longer legally available within the U.S., however they remain available in Australia and New Zealand where an approved version is marketed. |
|
|
|
|
|
It is also being trialed in humans to study its efficacy in treatment of ] in women,<ref>{{ClinicalTrialsGov|NCT00080756|Deslorelin Combined With Low-Dose Add-Back Estradiol and Testosterone in Preventing Breast Cancer in Premenopausal Women Who Are at High Risk for This Disease}}</ref> and in treating ] and ] in male and female children.<ref>{{ClinicalTrialsGov|NCT00001521|Three Drug Combination Therapy Versus Conventional Treatment of Children With Congenital Adrenal Hyperplasia}}</ref> |
|
|
|
|
|
As of August 2011 this drug was not approved for general use outside the FDA-licensed functions in the U.S., other than within approved clinical trials. ] has been designated in the U.S., though approval had not been issued as of 2011.<ref>{{cite web|title=Results for Orphan Drug Product Designations Search|url=http://www.accessdata.fda.gov/scripts/opdlisting/oopd/OOPD_Results_2.cfm?Index_Number=016086|publisher=FDA|access-date=3 September 2011}}</ref> |
|
|
|
|
|
==Research== |
|
|
Deslorelin was under development for the treatment of ], ], ], ], and ] in humans and reached ] ]s for prostate cancer but development was discontinued for all of these indications by 2001.<ref name="AdisInsight">{{cite web | title = Deslorelin | url = http://adisinsight.springer.com/drugs/800006408 | work = Adis Insight | publisher = Springer Nature Switzerland AG}}</ref> |
|
|
|
|
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Gonadotropins and GnRH}} |
|
{{GnRH and gonadotropins}} |
|
|
{{GnRH and gonadotropin receptor modulators}} |
|
|
{{Portal bar | Medicine}} |
|
|
{{Authority control}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
{{genito-urinary-drug-stub}} |
|