| Revision as of 04:04, 15 August 2011 editArcadian (talk | contribs)163,050 edits removed Category:Antivirals; added Category:Antiretroviral drugs using HotCat← Previous edit |
Latest revision as of 19:03, 30 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (23 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444914527 |
|
⚫ |
| ImageFile = Dexelvucitabine.svg |
|
|
| IUPACName = 2′,3′-Didehydro-2′,3′-dideoxy-5-fluorocytidine |
|
⚫ |
| SystematicName = 4-Amino-5-fluoro-1-pyrimidin-2(1''H'')-one |
|
⚫ |
| OtherNames = Reverset |
|
⚫ |
|Section1 = {{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = KU8SPJ271W |
|
| UNII = KU8SPJ271W |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| verifiedrevid = 437184543 |
|
|
⚫ |
| CASNo = 134379-77-4 |
| ⚫ |
|ImageFile=Dexelvucitabine.svg |
|
|
⚫ |
| PubChem = 64973 |
|
|ImageSize=200px |
|
| ⚫ |
|IUPACName=4-Amino-5-fluoro-1-pyrimidin-2-one |
|
| ⚫ |
|OtherNames=Reverset |
|
| ⚫ |
|Section1={{Chembox Identifiers |
|
| ⚫ |
| CASNo=134379-77-4 |
|
| ⚫ |
| PubChem=64973 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03981 |
|
| KEGG = D03981 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES=C1=CC(OC1CO)N2C=C(C(=NC2=O)N)F |
|
|
|
| ChemSpiderID = 58498 |
| ⚫ |
}} |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
|Section2={{Chembox Properties |
|
|
|
| ChEMBL = 109831 |
|
| Formula=C<sub>9</sub>H<sub>10</sub>FN<sub>3</sub>O<sub>3</sub> |
|
|
|
| SMILES = F\C1=C\N(C(=O)\N=C1\N)/2O(\C=C\2)CO |
|
| MolarMass=227.19 g/mol |
|
|
|
| InChI = 1/C9H10FN3O3/c10-6-3-13(9(15)12-8(6)11)7-2-1-5(4-14)16-7/h1-3,5,7,14H,4H2,(H2,11,12,15)/t5-,7+/m0/s1 |
|
| Appearance= |
|
|
|
| InChIKey = HSBKFSPNDWWPSL-CAHLUQPWBD |
|
| Density= |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| MeltingPt= |
|
|
|
| StdInChI = 1S/C9H10FN3O3/c10-6-3-13(9(15)12-8(6)11)7-2-1-5(4-14)16-7/h1-3,5,7,14H,4H2,(H2,11,12,15)/t5-,7+/m0/s1 |
|
| BoilingPt= |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| Solubility= |
|
|
|
| StdInChIKey = HSBKFSPNDWWPSL-CAHLUQPWSA-N |
| ⚫ |
}} |
|
|
⚫ |
}} |
|
|
|
|
⚫ |
| Section2 = {{Chembox Properties |
|
|
| C=9 |
|
|
| H=10 |
|
|
| F=1 |
|
|
| N=3 |
|
|
| O=3 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
⚫ |
| Solubility = |
|
⚫ |
}} |
|
|
|
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Dexelvucitabine''' is a failed experimental agent for the management of ]. It is a ] nucleoside analog and nucleoside ].<ref name=":0" /> that inhibits HIV-1 replication in vitro. During ] there was some indication of a decreased mean viral load in patients with infected human immunodeficiency virus.<ref>{{Cite journal |last1=Hernandez-Santiago |first1=Brenda I. |last2=Mathew |first2=Judy S. |last3=Rapp |first3=Kim L. |last4=Grier |first4=Jason P. |last5=Schinazi |first5=Raymond F. |date=June 2007 |title=Antiviral and Cellular Metabolism Interactions between Dexelvucitabine and Lamivudine |journal=Antimicrobial Agents and Chemotherapy |volume=51 |issue=6 |pages=2130–2135 |doi=10.1128/aac.01543-06 |issn=0066-4804 |pmc=1891415 |pmid=17403996}}</ref><ref>{{Cite journal |last1=Sobieszczyk |first1=Magdalena E |last2=Talley |first2=Angela K |last3=Wilkin |first3=Timothy |last4=Hammer |first4=Scott M |date=2005-03-01 |title=Advances in antiretroviral therapy |url=https://europepmc.org/article/med/15849370 |journal=Topics in HIV Medicine |volume=13 |issue=1 |pages=24–44 |issn=2161-5845 |pmid=15849370}}</ref> |
|
'''Dexelvucitabine''' is a failed experimental agent for the treatment of ]. Dexelvucitabine is a cytidine nucleoside analog and nucleoside reverse transcriptase inhibitor. It was found to inhibit HIV-1 replication in vitro and during Phase II clinical trials, it was found to decrease mean viral load in patients with HIV. |
|
|
|
|
|
|
On April 3, 2006, Pharmasset and Incyte Corporation, the pharmaceutical companies developing dexelvucitabine announced the decision to cease further trials and development of the drug due to an increased incidence of grade 4 hyperlipasemia in a phase II trial. |
|
On April 3, 2006, ] and ], the pharmaceutical companies developing dexelvucitabine, announced the decision to cease further trials and development of the drug due to an increased incidence of grade 4 hyperlipasemia (an excess of the pancreatic enzyme ] in the bloodstream) in a phase II trial.<ref name=":0">{{Cite web |last=PubChem |title=Dexelvucitabine |url=https://pubchem.ncbi.nlm.nih.gov/compound/64973 |access-date=2022-04-07 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref><ref>{{Cite journal |last=Ryder |first=Neil S |date=2007-12-01 |title=Discontinued drugs in 2006: anti-infectives |url=https://doi.org/10.1517/13543784.16.12.1867 |journal=Expert Opinion on Investigational Drugs |volume=16 |issue=12 |pages=1867–1878 |doi=10.1517/13543784.16.12.1867 |issn=1354-3784 |pmid=18041997|s2cid=40129603 }}</ref> |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
|
{{Antiretroviral drug}} |
|
{{Antiretroviral drug}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|