| Revision as of 14:47, 15 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI').← Previous edit |
Latest revision as of 18:49, 30 June 2022 edit undoCitation bot (talk | contribs)Bots5,418,717 edits Add: pmid. | Use this bot. Report bugs. | Suggested by Abductive | Category:Multiple chemicals in an infobox that need indexing | #UCB_Category 599/1863 |
| (31 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 460782986 |
|
| ImageFile = Dichlorofluorescein.svg |
|
| ImageFile = Dichlorofluorescein.svg |
|
| ImageSize = 205 |
|
| ImageSize = 205 |
|
| IUPACName = 2',7'-dichloro-3',6'-dihydroxy-3H-spiro-3-one |
|
| PIN = 2′,7′-Dichloro-3′,6′-dihydroxy-3''H''-spirobenzofuran-1,9′-xanthen]-3-one |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
|
| InChI = 1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
|
| InChIKey = VFNKZQNIXUFLBC-UHFFFAOYAO |
|
| InChIKey = VFNKZQNIXUFLBC-UHFFFAOYAO |
|
| InChI1 = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
|
| InChI1 = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
|
| InChIKey1 = VFNKZQNIXUFLBC-UHFFFAOYSA-N |
|
| InChIKey1 = VFNKZQNIXUFLBC-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = |
|
|
| PubChem = 64944 |
|
| CASNo = 76-54-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| ChemSpiderID = 58471 |
|
|
| ChEBI = 51596 |
|
| UNII = 56NQM5UZT1 |
|
|
| PubChem = 64944 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 58471 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 51596 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1908059 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VFNKZQNIXUFLBC-UHFFFAOYSA-N |
|
| StdInChIKey = VFNKZQNIXUFLBC-UHFFFAOYSA-N |
|
| SMILES = Clc5cc4c(Oc1cc(O)c(Cl)cc1C34OC(=O)c2c3cccc2)cc5O |
|
| SMILES = Clc5cc4c(Oc1cc(O)c(Cl)cc1C34OC(=O)c2c3cccc2)cc5O |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
|
| StdInChI = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
|
| C=20| H=10| Cl=2| O=5 |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
'''Dichlorofluorescein''' (DCF) is an organic dye of the ] family, being substituted at the 2 and 7 positions by chloride. |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| C = 20 |
|
|
| H = 10 |
|
|
| Cl = 2 |
|
|
| O = 5 |
|
| ⚫ |
| Appearance = |
|
| ⚫ |
| Density = |
|
| ⚫ |
| MeltingPt = |
|
| ⚫ |
| BoilingPt = |
|
| ⚫ |
| Solubility = |
|
| ⚫ |
}} |
|
| ⚫ |
| Section3 = {{Chembox Hazards |
|
| ⚫ |
| MainHazards = |
|
| ⚫ |
| FlashPt = |
|
|
| Autoignition = |
|
| ⚫ |
}} |
|
| ⚫ |
}} |
|
| ⚫ |
'''Dichlorofluorescein''' is an ] of the ] family, being substituted at the 2 and 7 positions by chloride. It is used as an indicator for ].<ref>{{cite journal | last1 = Kolthoff | first1 = I. M. | last2 = Lauer | first2 = W. M. | last3 = Sunde | first3 = C. J. | journal = Journal of the American Chemical Society | volume = 51 | pages = 3273 | year = 1929 | doi = 10.1021/ja01386a014 | title =The Use of Dichlorofluorescein as an Adsorption Indicator for the Argentometric Titration of Chlorides | issue = 11}}</ref><ref>{{cite journal | last1 =Bambach | first1 =Karl | last2 =Rider | first2 =T. H. | title =Volumetric Determinations of Halides: Use of Dichlorofluorescein as an Adsorption Indicator | journal =Industrial & Engineering Chemistry Analytical Edition | volume =7 | pages =165 | year =1935 | doi =10.1021/ac50095a012 | issue =3}}</ref> |
|
|
|
|
|
|
⚫ |
It is used as an indicator for ].<ref>{{cite journal | last1 = Kolthoff | first1 = I. M. | last2 = Lauer | first2 = W. M. | last3 = Sunde | first3 = C. J. | journal = Journal of the American Chemical Society | volume = 51 | pages = 3273 | year = 1929 | doi = 10.1021/ja01386a014 | title =The Use of Dichlorofluorescein as an Adsorption Indicator for the Argentometric Titration of Chlorides | issue = 11}}</ref><ref>{{cite journal | last1 =Bambach | first1 =Karl | last2 =Rider | first2 =T. H. | title =Volumetric Determinations of Halides: Use of Dichlorofluorescein as an Adsorption Indicator | journal =Industrial & Engineering Chemistry Analytical Edition | volume =7 | pages =165 | year =1935 | doi =10.1021/ac50095a012 | issue =3}}</ref> |
| ⚫ |
==References== |
|
| ⚫ |
{{Reflist}} |
|
|
|
|
|
|
|
When used as an indicator, upon reaching the equivalence point of a titration reaction the color shifts from colorless towards a faint pink. |
| ⚫ |
] |
|
|
|
|
|
|
It is also used in the ] (CAA) assay. Dichlorofluorescin (DCFH) is a probe that is trapped within cells and is easily oxidized to fluorescent dichlorofluorescein (DCF). The method measures the ability of compounds to prevent the formation of DCF by ] (ABAP)-generated peroxyl radicals in human hepatocarcinoma ] cells.<ref>{{Cite journal | last1 = Wolfe | first1 = K. L. | last2 = Liu | first2 = R. H. | doi = 10.1021/jf0715166 | title = Cellular Antioxidant Activity (CAA) Assay for Assessing Antioxidants, Foods, and Dietary Supplements | journal = Journal of Agricultural and Food Chemistry | volume = 55 | issue = 22 | pages = 8896–8907 | year = 2007 | pmid = 17902627}}</ref> By itself, dichlorofluorescin (DCFH) also quantifies intracellular hydrogen peroxide as well as cellular ].<ref>{{Cite journal | last1 = LeBel | first1 = C. P. | last2 = Ischiropoulos | first2 = Harry | last3 = Bondy | first3 = S. C. | doi = 10.1021/tx00026a012 | title = Evaluation of the probe 2',7'-dichlorofluorescin as an indicator of reactive oxygen species formation and oxidative stress | journal = Chem. Res. Toxicol. | volume = 5 | issue = 2 | pages = 227–231 | year = 1992 | pmid = 1322737 | url = https://escholarship.org/content/qt19r571vt/qt19r571vt.pdf?t=nsppk9 }}</ref> |
|
|
|
|
⚫ |
== References == |
|
⚫ |
{{Reflist}} |
|
|
|
|
|
|
] |
|
] |
|
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |