| Revision as of 06:54, 8 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit |
Latest revision as of 10:03, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits added Category:4-Hydroxyphenyl compounds using HotCat |
| (120 intermediate revisions by 75 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Redirect|DCIP|the children's rights organization|Defence for Children Palestine}} |
|
|
{{More citations needed|date=June 2015}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 414420183 |
|
|
|
| Watchedfields = changed |
|
| Name = DCPIP |
|
|
⚫ |
| verifiedrevid = 443636065 |
|
| ImageFile1 = DCPIP-2D-skeletal.png |
|
| ImageFile1 = DCPIP-2D-skeletal.png |
|
| ImageSize1 = 150px |
|
| ImageSize1 = 150px |
|
| ImageFileL2 = Dichlorphenolindophenol-3D-balls.png |
|
| ImageFileL2 = Dichlorphenolindophenol-3D-balls.png |
|
| ImageSizeL2 = 100px |
|
|
| ImageFileR2 = Dichlorphenolindophenol-3D-vdW.png |
|
| ImageFileR2 = Dichlorphenolindophenol-3D-vdW.png |
|
|
| PIN = 4-(3,5-dichloro-4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one |
|
| ImageSizeR2 = 100px |
|
|
⚫ |
| OtherNames = Dichloroindophenol ();<br /> |
|
| IUPACName = 2,6-dichlorophenol-indophenol |
|
|
|
2,6-Dichlorophenolindophenol;<br /> |
| ⚫ |
| OtherNames = 2,5-cyclohexadien-1-one;<br /> |
|
|
dichloroindophenol;<br /> |
|
2,6-Dichloroindophenol;<br /> |
|
2,6-dichloro-4- -2,6-dichloroindophenol;<br /> |
|
2,6-Dichloro-4--2,5-cyclohexadien-1-one |
|
⚫ |
|Section1={{Chembox Identifiers |
|
2,6-Dichloro-4-((4-hydroxyphenyl)imino) -2,5-cyclohexadien-1-one |
|
|
|
| Abbreviations = DCPIP, DCIP, DPIP |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 10661857 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C00102 |
|
| KEGG = C00102 |
| Line 22: |
Line 22: |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 500871 |
|
| ChEMBL = 500871 |
|
|
| PubChem = 13726 |
|
⚫ |
| ChemSpiderID = 10661857 |
|
|
| UNII = C35QN2Z58B |
|
|
| EC_number = 213-479-8 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H |
|
| StdInChI = 1S/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H |
| Line 28: |
Line 32: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 956-48-9 |
|
| CASNo = 956-48-9 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 945 |
|
| ChEBI = 945 |
|
| SMILES = Cl\C2=CC(=N/c1ccc(O)cc1)/C=C(/Cl)C2=O |
|
| SMILES = Cl\C2=CC(=N/c1ccc(O)cc1)/C=C(/Cl)C2=O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C = 12 |
|
| Formula = C<sub>12</sub>H<sub>7</sub>NCl<sub>2</sub>O<sub>2</sub> |
|
|
|
| H = 7 |
|
| MolarMass = 268.1 g mol<sup>−1</sup> |
|
|
| Density = |
|
| N = 1 |
|
| MeltingPt = |
|
| Cl = 2 |
|
| BoilingPt = |
|
| O = 2 |
|
}} |
|
}} |
|
|
|Section7 = {{Chembox Hazards |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|403+233|405|501}} |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
⚫ |
'''2,6-Dichlorophenolindophenol''' ('''DCPIP''', '''DCIP''' or '''DPIP''') is a ] used as a ]. When ], DCPIP is blue with a maximal absorption at 600 nm; when ], DCPIP is colorless. |
|
{{cleanup|reason=Needs rewrite to remove unnecessary duplication|date=May 2011}} |
|
| ⚫ |
'''2,6-dichlorophenolindophenol''', ( '''DCPIP''' ) is a blue ] used as a ]. ] DCPIP is blue, ] DCPIP is colorless. |
|
|
|
|
|
|
The rate of photosynthesis can be measured by the rate at which this dye changes color (is reduced) when exposed to light in a photosynthetic system. This reaction is reversible, as colorless DCPIP can be reoxidized to blue. It is often used in measurements of the ] in plants because of its higher ] for electrons than ]. For example, it is possible to compare rates of ] with DCPIP. Due to the reductions that occur during the light reactions, DCPIP can be substituted for ], the final electron carrier in the light reactions. The ] will reduce the DCPIP and turn it colorless. As DCPIP is reduced and becomes colorless, the following increase in light transmittance can be measured by a ]. |
|
DCPIP can be used to measure the rate of ]. It is part of the ]s family. When exposed to light in a photosynthetic system, the dye is decolorised by chemical reduction. DCPIP has a higher ] for electrons than ] and the photosynthetic electron transport chain can reduce DCPIP as a substitute for ], that is normally the final electron carrier in photosynthesis. As DCPIP is reduced and becomes colorless, the resultant increase in ] can be measured using a ]. |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
⚫ |
DCPIP can also be used as an indicator for ].<ref>{{cite journal |vauthors=VanderJagt DJ, Garry PJ, Hunt WC |title=Ascorbate in plasma as measured by liquid chromatography and by dichlorophenolindophenol colorimetry |journal=Clin. Chem. |volume=32 |issue=6 |pages=1004–6 |date=June 1986 |pmid=3708799 |url=http://www.clinchem.org/cgi/pmidlookup?view=long&pmid=3708799}}</ref><ref>{{Citation |title=Design an investigation to compare the amount of vitamin C in different fruits and vegetables |url=https://www.youtube.com/watch?v=fxl4Ar2cD0A |access-date=2023-11-18 |language=en}}</ref> If vitamin C, which is a good reducing agent, is present, the blue dye, which turns pink in acid conditions, is reduced to a colorless compound by ascorbic acid. This reaction is a redox reaction: vitamin C (ascorbic acid) is oxidized to ], and DCPIP is reduced to the colorless compound DCPIPH<sub>2</sub> |
|
==DCPIP== |
|
|
'''DCPIP''' is a ] commonly used as a monitor of the ] in ] because it is an ] acceptor that is blue when ] and colorless when ]. It is part of the ]s family. DCPIP is commonly used as a substitute for ]. The dye changes ] when it is reduced, due to its ]. |
|
|
The rate of photosynthesis light-dependent reaction can be measured with this property of DCPIP, because one of the stages of the light reaction is an ] that normally ends with the reduction of NADP<sup>+</sup>. When DCPIP is present, it also gets reduced by the light reaction. The amount of DCPIP reduced can be found by measuring the solution's ] with a ]. |
|
|
|
|
|
|
⚫ |
:DCPIP (blue) + H<sup>+</sup> → DCPIPH (pink) |
| ⚫ |
DCPIP can also be used as an indicator for ].<ref>{{cite journal |author=VanderJagt DJ, Garry PJ, Hunt WC |title=Ascorbate in plasma as measured by liquid chromatography and by dichlorophenolindophenol colorimetry |journal=Clin. Chem. |volume=32 |issue=6 |pages=1004–6 |year=1986 |month=June |pmid=3708799 |url=http://www.clinchem.org/cgi/pmidlookup?view=long&pmid=3708799}}</ref> If vitamin C, which is a good reducing agent, is present, the blue dye, which turns pink in acid conditions, is reduced to a colorless compound by ascorbic acid. |
|
|
⚫ |
:DCPIPH (pink) + vitamin C → DCPIPH<sub>2</sub> (colorless) |
|
|
|
|
|
⚫ |
In this ], when all the ascorbic acid in the solution has been used up, there will not be any electrons available to reduce the DCPIPH and the solution remains pink due to the DCPIPH. The end point is a pink color that persists for 10 seconds or more, if there is not enough ascorbic acid to reduce all of the DCPIPH. Pharmacological experiments suggest that DCPIP may serve as a ] chemotherapeutic targeting human cancer cells in an animal model of human ]; DCPIP-induced cancer cell death occurs by depletion of intracellular ] and upregulation of ].<ref>{{cite journal |vauthors=Cabello CM, Bair WB, Bause AS, Wondrak GT |title=Antimelanoma activity of the redox dye DCPIP (2,6-dichlorophenolindophenol) is antagonized by NQO1 |journal=Biochem. Pharmacol. |volume=78 |issue=4 |pages=344–54 |date=August 2009 |pmid=19394313 |doi=10.1016/j.bcp.2009.04.016 |pmc=2742658}}</ref> |
| ⚫ |
:DCPIP (blue) + H<sup>+</sup> ——→ DCPIPH (pink) |
|
| ⚫ |
:DCPIPH (pink) + VitC ——→ DCPIPH2 (colorless) |
|
|
:C<sub>6</sub>H<sub>8</sub>O<sub>6</sub> + C<sub>12</sub>H<sub>7</sub>NCl<sub>2</sub>O<sub>2</sub> ——→ C<sub>6</sub>H<sub>6</sub>O<sub>6</sub> + C<sub>12</sub>H<sub>9</sub>NCl<sub>2</sub>O<sub>2</sub> |
|
|
|
|
| ⚫ |
In a ], when all the ascorbic acid in the solution has been used up, there will not be any electrons available to reduce the DCPIPH and the solution will remain pink due to the DCPIPH. The end point is a pink color that persists for 10 seconds or more. Pharmacological experiments suggest that DCPIP may serve as a ] chemotherapeutic targeting human cancer cells in an animal model of human ]; DCPIP-induced cancer cell death occurs by depletion of intracellular ] and upregulation of ].<ref>{{cite journal |author=Cabello CM, Bair WB, Bause AS, Wondrak GT |title=Antimelanoma activity of the redox dye DCPIP (2,6-dichlorophenolindophenol) is antagonized by NQO1 |journal=Biochem. Pharmacol. |volume=78 |issue=4 |pages=344–54 |year=2009 |month=August |pmid=19394313 |doi=10.1016/j.bcp.2009.04.016 |url=http://linkinghub.elsevier.com/retrieve/pii/S0006-2952(09)00301-3}}</ref> |
|
|
|
|
|
|
==See also== |
|
==See also== |
| Line 63: |
Line 68: |
|
*] |
|
*] |
|
*] |
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
*{{cite journal |author=Denby, Derek |journal=Chemistry Review |year=1996 |month=May}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|