Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 11:56, 17 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL KEGG.← Previous edit		Latest revision as of 13:38, 7 November 2024 edit undoRustyOldShip (talk | contribs)495 editsm chloropenoxy now a link
(24 intermediate revisions by 16 users not shown)
Line 1:		Line 1:
	{{chembox		{{Chembox
			| Verifiedfields = changed
⚫	| verifiedrevid = 401988043
			| Watchedfields = changed
⚫	| ImageFile = Dichlorprop.svg
		⚫	| verifiedrevid = 414420337
			| ImageFile_Ref = {{chemboximage|correct|??}}
		⚫	| ImageFile = (RS)-Dichlorprop Structural Formula V.1a.svg
	| ImageSize =		| ImageSize =
	| ImageFile1 =		| ImageFile1 =
	| IUPACName = (''R'')-2-(2,4-dichlorophenoxy)propanoic acid		| IUPACName = (''R'')-2-(2,4-dichlorophenoxy)propanoic acid
	| OtherNames = 2,4-DP		| OtherNames = 2,4-DP
	| Section1 = {{Chembox Identifiers		|Section1={{Chembox Identifiers
	| Abbreviations =		| Abbreviations =
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
	| ChemSpiderID = 8120		| ChemSpiderID = 8120
	| InChIKey = MZHCENGPTKEIGP-UHFFFAOYAD		| InChIKey = MZHCENGPTKEIGP-UHFFFAOYAD
			| ChEBI_Ref = {{ebicite|correct|EBI}}
		⚫	| ChEBI = 75375
			| ChEMBL_Ref = {{ebicite|correct|EBI}}
	| ChEMBL = 573221		| ChEMBL = 573221
	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}		| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 18:		Line 24:
	| CASNo_Ref = {{cascite|correct|CAS}}		| CASNo_Ref = {{cascite|correct|CAS}}
	| CASNo = 120-36-5		| CASNo = 120-36-5
			| UNII_Ref = {{fdacite|correct|FDA}}
⚫	| EINECS =
			| UNII = J7YV2RKO6Q
		⚫	| EINECS = 204-390-5
			| UNNumber = 3077 2765
	| PubChem = 8427		| PubChem = 8427
	| SMILES = Clc1cc(Cl)ccc1OC(C(=O)O)C		| SMILES = Clc1cc(Cl)ccc1OC(C(=O)O)C
	| InChI = 1/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)		| InChI = 1/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)
	| RTECS =		| RTECS = UF1050000
	| MeSHName =		| MeSHName =
			| KEGG_Ref = {{keggcite|correct|kegg}}
⚫	| ChEBI =
	| KEGG = C11020		| KEGG = C11020
			}}
	| ATCCode = }}
	| Section2 = {{Chembox Properties		|Section2={{Chembox Properties
	| Formula = C<sub>9</sub>H<sub>8</sub>Cl<sub>2</sub>O<sub>3</sub>		| Formula = C<sub>9</sub>H<sub>8</sub>Cl<sub>2</sub>O<sub>3</sub>
	| MolarMass = 235.064 g/mol		| MolarMass = 235.064 g/mol
	| Appearance = white solid		| Appearance = white solid
	| Density =		| Density =
	| MeltingPt = 116-120°C		| MeltingPtC = 116 to 120
	| Melting_notes = ''R''-isomer		| MeltingPt_notes = ''R''-isomer
	| BoilingPt =		| BoilingPt = 215 °C
	| Boiling_notes =		| BoilingPt_notes =
	| Solubility = 720 mg/L at 20°C (''R''-isomer)		| Solubility = 720 mg/L at 20&nbsp;°C (''R''-isomer)
	| SolubleOther =		| SolubleOther =
	| Solvent = water		| Solvent = water
Line 47:		Line 56:
	| RefractIndex =		| RefractIndex =
	| Viscosity =		| Viscosity =
	| Dipole = }}		| Dipole =
			}}
	| Section3 = {{Chembox Structure		|Section3={{Chembox Structure
	| CrystalStruct =		| CrystalStruct =
	| Coordination =		| Coordination =
	| MolShape =		| MolShape =
	| Dipole = }}		| Dipole =
			}}
	| Section4 = {{Chembox Thermochemistry		|Section4={{Chembox Thermochemistry
	| DeltaHf =		| DeltaHf =
	| DeltaHc =		| DeltaHc =
	| Entropy =		| Entropy =
	| HeatCapacity = }}		| HeatCapacity =
			}}
	| Section5 = {{Chembox Pharmacology		|Section5={{Chembox Pharmacology
	| AdminRoutes =		| AdminRoutes =
	| Bioavail =		| Bioavail =
Line 70:		Line 82:
	| Legal_AU =		| Legal_AU =
	| Legal_CA =		| Legal_CA =
	| PregCat =		| Pregnancy_category =
	| PregCat_AU =		| Pregnancy_AU =
	| PregCat_US = }}		| Pregnancy_US =
			}}
	| Section6 = {{Chembox Explosive
		⚫	|Section7={{Chembox Hazards
	| ShockSens =
	| FrictionSens =		| ExternalSDS =
	| ExplosiveV =
	| REFactor = }}
⚫	| Section7 = {{Chembox Hazards
	| ExternalMSDS =
	| EUClass =
	| EUIndex =
	| MainHazards =		| MainHazards =
	| NFPA-H =		| NFPA-H =
	| NFPA-F =		| NFPA-F =
	| NFPA-R =		| NFPA-R =
	| NFPA-O =		| NFPA-S =
	| RPhrases = {{R21/22}} {{R38}} {{R41}}		| GHSPictograms = {{GHS05}}{{GHS07}}
			| GHSSignalWord = Danger
	| SPhrases = {{S2}} {{S26}} {{S36/37}}
			| HPhrases = {{H-phrases|302|312|315|318}}
	| RSPhrases =
			| PPhrases = {{P-phrases|264|270|280|301+312|302+352|305+351+338|310|312|321|322|330|332+313|362|363|501}}
	| FlashPt =
	| Autoignition =		| FlashPtC = 204
			| AutoignitionPt =
	| ExploLimits =		| ExploLimits =
	| PEL = }}		| PEL =
			}}
	| Section8 = {{Chembox Related		|Section8={{Chembox Related
	| OtherAnions =		| OtherAnions =
	| OtherCations =		| OtherCations =
	| OtherFunctn =		| OtherFunction =
	| Function =		| OtherFunction_label =
	| OtherCpds = ]}}		| OtherCompounds = ]}}
	}}		}}
	'''Dichlorprop''' is a chlorophenoxy ] similar in structure to ] that is used to kill annual and perennial broadleaf weeds. It is a component of many common weedkillers. About 4 million ] of dichlorprop are used annually in the ].		'''Dichlorprop''' is a ] ] similar in structure to ] that is used to kill annual and perennial broadleaf weeds. It is a component of many common weedkillers. About 4 million ] of dichlorprop are used annually in the ].
	==Chemistry==		==Chemistry==
			]
	Dichlorprop possesses a single ] and is therefore a ] molecule, however only the ]-isomer is active as an herbicide. When dichlorprop was first marketed in 1960s, it was sold as ] of ]s, but since then advances in ] have made possible the production of the enantiopure compound. Today, only ''R''-dichlorprop (also called dichlorprop-p or 2,4-DP-p) and its derivatives are sold as ] in the United States.		Dichlorprop possesses a single ] and is therefore a ] molecule, however only the ]-isomer is active as an herbicide. When dichlorprop was first marketed in the 1960s, it was sold as ] of ]s, but since then advances in ] have made possible the production of the enantiopure compound. Today, only ''R''-dichlorprop (also called dichlorprop-p or 2,4-DP-p) and its derivatives are sold as ] in the United States.
	Dichlorprop is a ], and like related herbicides with free acid groups, it is often sold as a ] or ]. Currently, the ] ester is used commercially. The butoxyethyl and isooctyl esters were once popular, but are no longer approved for agricultural use. For the salts, the ] salt is still available, while the ] salt is no longer used.		Dichlorprop is a ], and like related herbicides with free acid groups, it is often sold as a ] or ]. Currently, the ] ester is used commercially. The butoxyethyl and isooctyl esters were once popular, but are no longer approved for agricultural use. For the salts, the ] salt is still available, while the ] salt is no longer used.
	According the ] (EPA), "2,4-DP-p is thought to increase ] plasticity, biosynthesis of ], and the production of ]. The abnormal increase in these processes result in abnormal and excessive cell division and growth, damaging vascular tissue. The most susceptible tissues are those that are undergoing active cell division and growth."<ref name=RED>, US EPA, August 29, 2007]</ref>		According to the ] (EPA), "2,4-DP-p is thought to increase ] plasticity, biosynthesis of ], and the production of ]. The abnormal increase in these processes result in abnormal and excessive cell division and growth, damaging vascular tissue. The most susceptible tissues are those that are undergoing active cell division and growth."<ref name=RED>, US EPA, August 29, 2007]</ref>
	==Health effects==		==Health effects==
	The EPA rates the oral ] of dichlorprop as "slight" based on a rat {{LD50}} of 537 mg/kg, and its derivatives are even less toxic. It is, however, considered to be a severe eye irritant.<ref name=RED/> There has been concern that chlorophenoxy herbicides including dichlorprop may cause cancer, and in 1987 the ] (IARC) ranked this class of compounds as ] "possibly carcinogenic to humans".<ref>, International Agency for Research on Cancer (IARC), 1987</ref> The EPA classifies the ''R''-isomer as “Not Likely to be Carcinogenic to Humans.”<ref name=RED/>		The EPA rates the oral ] of dichlorprop as "slight" based on a rat {{LD50}} of 537&nbsp;mg/kg, and its derivatives are even less toxic. It is, however, considered to be a severe eye irritant.<ref name=RED/> There has been concern that chlorophenoxy herbicides including dichlorprop may cause cancer, and in 1987 the ] (IARC) ranked this class of compounds as ] "possibly carcinogenic to humans".<ref>, International Agency for Research on Cancer (IARC), 1987</ref> The EPA classifies the ''R''-isomer as “Not Likely to be Carcinogenic to Humans.”<ref name=RED/>
	==References==		==References==
Line 117:		Line 127:
	==External links==		==External links==
	*
	{{Herbicides}}		{{Herbicides}}
⚫	]
	]		]
	]		]
	]
	]		]
	]		]
		⚫	]
	]
	]
	]