| Revision as of 20:01, 12 October 2011 editLamro (talk | contribs)Autopatrolled, Extended confirmed users84,236 edits →Occurance: Occurrence← Previous edit |
Latest revision as of 05:18, 19 April 2024 edit undo2409:40e2:b:c9db:8000:: (talk) Long names are sometimes confusing and hard to pronounceTags: Visual edit Mobile edit Mobile web edit |
| (14 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{More citations needed|date=March 2023}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 446534096 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 455259123 |
|
| ImageFile = Dicoronylene_structure.png |
|
| ImageFile = Dicoronylene_structure.png |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Skeletal formula of dicoronylene |
|
| ImageAlt = Structural formula of dicoronylene |
|
| ImageFile1 = Dicoronylene-3D-balls.png |
|
| ImageFile1 = Dicoronylene 3D ball.png |
|
| ImageSize1 = 250px |
|
| ImageSize1 = 250px |
|
| ImageName1 = Ball-and-stick model of dicoronylene |
|
| ImageAlt1 = Ball-and-stick model of the dicoronylene molecule |
|
| IUPACName = benzophenanthrochrysenocoronene |
|
| PIN = Benzodicoronene |
|
| OtherNames = benzodicoronene |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 98570-53-7 |
|
| CASNo = 98570-53-7 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| PubChem = |
|
| PubChem = 636081 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = }} |
|
|
|
| ChemSpiderID = 551959 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| SMILES = C1=CC2=C3C4=C1C=CC5=C4C6=C(C=C5)C=C7C8=CC9=C1C4=C(C=CC5=C4C4=C(C=C5)C=CC5=CC(=C8C1=C54)C1=C7C6=C3C(=C1)C=C2)C=C9 |
| ⚫ |
| C = 48 | H = 20 |
|
|
|
| InChI = 1/C48H20/c1-5-23-9-13-27-17-31-33-19-29-15-11-25-7-3-22-4-8-26-12-16-30-20-34(46(33)48-43(29)39(25)36(22)40(26)44(30)48)32-18-28-14-10-24-6-2-21(1)35-37(23)41(27)47(45(31)32)42(28)38(24)35/h1-20H |
|
|
| InChIKey = QOPWDVCEMZLGPK-UHFFFAOYAN |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C48H20/c1-5-23-9-13-27-17-31-33-19-29-15-11-25-7-3-22-4-8-26-12-16-30-20-34(46(33)48-43(29)39(25)36(22)40(26)44(30)48)32-18-28-14-10-24-6-2-21(1)35-37(23)41(27)47(45(31)32)42(28)38(24)35/h1-20H |
|
|
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QOPWDVCEMZLGPK-UHFFFAOYSA-N }} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| C=48 | H=20 |
|
| Formula = |
|
| Formula = |
|
| MolarMass = |
|
| MolarMass = |
|
| Appearance = |
|
| Appearance = dark red<ref name=str/> |
|
| Density = |
|
| Density = 1.57 g/cm<sup>3</sup> (calc.)<ref name=str/> |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Structure |
|
|
| Structure_ref =<ref name=str>{{cite journal|doi=10.1021/ja00106a004 |title=Crystallization of Large Planar Polycyclic Aromatic Hydrocarbons: The Molecular and Crystal Structures of Hexabenzo[bc,ef,hi,kl,no,qr]coronene and Benzo[1,2,3-bc:4,5,6-b'c']dicoronene |date=1995 |last1=Goddard |first1=Richard |last2=Haenel |first2=Matthias W. |last3=Herndon |first3=William C. |last4=Krueger |first4=Carl |last5=Zander |first5=Maximilian |journal=Journal of the American Chemical Society |volume=117 |pages=30–41 }}</ref> |
|
|
| CrystalStruct = |
|
|
| SpaceGroup = ], P2<sub>1</sub>/c |
|
|
| PointGroup = |
|
|
| LattConst_a = 1.0376(1) nm |
|
|
| LattConst_b = 0.3832(1) nm |
|
|
| LattConst_c = 3.1914(3) nm |
|
|
| LattConst_alpha = |
|
|
| LattConst_beta = 90.24(1) |
|
|
| LattConst_gamma = |
|
|
| LattConst_ref = |
|
|
| LattConst_Comment = |
|
|
| UnitCellVolume = |
|
|
| UnitCellFormulas = 2 |
|
|
| Coordination = |
|
|
| MolShape = |
|
|
| OrbitalHybridisation = |
|
|
| Dipole = |
|
|
}} |
|
|
|Section4={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Dicoronylene''' is the ] for a very large ]. Its formal name is benzophenanthrochrysenocoronene (] name) or benzodicoronene (name sometimes used in ]). It has 15 rings and is a brick-red solid. Its formula is {{chem|C|48|H|20}}.<ref>{{cite book | last = Fetzer | first = J. C. | title = The Chemistry and Analysis of the Large Polycyclic Aromatic Hydrocarbons | location = New York | publisher = Wiley | year = 2000 }}</ref> Dicoronylene sublimes under high vacuum, 0.001 ], between 250 °C and 300 °C. |
|
'''Dicoronylene''' is the ] for a very large ]. It has 15 rings and is a brick-red solid. Its formula is {{chem|C|48|H|20}}.<ref>{{cite book | last = Fetzer | first = J. C. | title = The Chemistry and Analysis of the Large Polycyclic Aromatic Hydrocarbons | location = New York | publisher = Wiley | year = 2000 }}</ref> Dicoronylene sublimes under high vacuum, 0.001 ], between 250 °C and 300 °C. |
|
|
|
|
|
==Structure== |
|
==Structure== |
|
Due to its large size and limited availability, the organic chemistry of dicoronylene is little known. Dicoronylene does undergo a ] with ] on one or both of the central bay regions on either side of the bridging ring. The ] of maleic anhydride forms two ] on the ends of the bay region, making a new six-membered ring. Heating removes the anhydride as ] gas and gives the corresponding 16-ring and 17-ring PAHs. |
|
Due to its large size and limited availability, the organic chemistry of dicoronylene is little known. Dicoronylene does undergo a ] with ] on one or both of the central bay regions on either side of the bridging ring. The ] of maleic anhydride forms two ]s on the ends of the bay region, making a new six-membered ring. Heating removes the anhydride as ] gas and gives the corresponding 16-ring and 17-ring PAHs. |
|
|
|
|
|
==Occurrence== |
|
==Occurrence== |
| Line 54: |
Line 86: |
|
|
|
|
|
] |
|
] |
|
|
|
|
] |
|