| Revision as of 22:59, 29 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:12, 30 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (15 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 426639471 |
|
| verifiedrevid = 426640917 |
|
| Name = Diffutidin |
|
| Name = Diffutidin |
|
| ImageFile = Diffutidin.svg |
|
| ImageFile = Diffutidin.svg |
| Line 6: |
Line 7: |
|
| ImageName = Chemical structure of diffutidin |
|
| ImageName = Chemical structure of diffutidin |
|
| ImageAlt = Chemical structure of diffutidin |
|
| ImageAlt = Chemical structure of diffutidin |
|
| IUPACName = (S) -2- (3,4-Dimethoxyphenyl) -3,4-dihydro-2H-1-benzopyran-5,7-diol |
|
| IUPACName = (2''S'')-3′,4′-Dimethoxyflavan-5,7-diol |
|
|
| SystematicName = (2''S'')-2-(3,4-Dimethoxyphenyl)-3,4-dihydro-2''H''-1-benzopyran-5,7-diol |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 89289-92-9 |
|
| CASNo = 89289-92-9 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
| PubChem = 44257194 |
|
| PubChem = 44257194 |
|
|
| SMILES = COc(c3)c(OC)cc(c3)(C2)Oc(c1)c(C2)c(O)cc(O)1 |
|
| SMILES = COc(c3)c(OC)cc(c3)(C2)Oc(c1)c(C2)c(O)cc(O)1 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 24842661 |
|
| ChemSpiderID = 24842661 |
|
| SMILES = COc1ccc(cc1OC)2CCc3c(cc(cc3O2)O)O |
|
| SMILES2 = COc1ccc(cc1OC)2CCc3c(cc(cc3O2)O)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C17H18O5/c1-20-15-5-3-10(7-17(15)21-2)14-6-4-12-13(19)8-11(18)9-16(12)22-14/h3,5,7-9,14,18-19H,4,6H2,1-2H3/t14-/m0/s1 |
|
| StdInChI = 1S/C17H18O5/c1-20-15-5-3-10(7-17(15)21-2)14-6-4-12-13(19)8-11(18)9-16(12)22-14/h3,5,7-9,14,18-19H,4,6H2,1-2H3/t14-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NMMYBAVYBMEWOL-AWEZNQCLSA-N |
|
| StdInChIKey = NMMYBAVYBMEWOL-AWEZNQCLSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>17</sub>H<sub>18</sub>O<sub>5</sub> |
|
| Formula = C<sub>17</sub>H<sub>18</sub>O<sub>5</sub> |
|
| MolarMass = 302.32 g/mol |
|
| MolarMass = 302.32 g/mol |
|
| ExactMass = 302.115423686 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
|
| GHSPictograms = |
|
| RPhrases = <!-- {{R}}, {{R}}, {{R}}, {{R}} etc. --> |
|
|
|
| GHSSignalWord = |
|
| SPhrases = <!-- {{S}}, {{S}}, {{S}}, {{S}}, {{S}}, {{S}}, {{S}} etc. --> |
|
|
|
| HPhrases = {{HPhrases|}} |
| ⚫ |
}} |
|
|
|
| PPhrases = {{PPhrases|}} |
|
|
| GHS_ref = <!-- no GHS data in pubchem Dec2021 --> |
|
⚫ |
}} |
|
}} |
|
}} |
|
'''Diffutidin''' is a ], a type of flavonoid. It can be found in '']''.<ref name=Ghosal>Diffutin, a new adaptogenic glucosyloxyflavan from Canscora diffusa. Shibnath Ghosal, Saini K. S. and Sinha B. N., Journal of chemical research. Synopses, 1983, no12<!--, {{doi|}} --></ref> |
|
'''Diffutidin''' is a ], a type of flavonoid. It can be found in '']''.<ref name=Ghosal>Diffutin, a new adaptogenic glucosyloxyflavan from Canscora diffusa. Shibnath Ghosal, Saini K. S. and Sinha B. N., Journal of chemical research. Synopses, 1983, no12<!--, {{doi|}} --></ref> |
|
|
|
|
|
==Metabolism== |
|
== Metabolism == |
|
] is a glucoside of diffutidin.<ref name=Ghosal/> |
|
] is a glucoside of diffutidin.<ref name=Ghosal/> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Flavan}} |
|
{{Flavan}} |
|
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{aromatic-stub}} |