| Revision as of 02:48, 11 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,582 editsmNo edit summary← Previous edit |
Latest revision as of 17:09, 14 March 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,886 editsm Added/Verified UNII and Verified CAS |
| (26 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 401004557 |
|
| verifiedrevid = 423446786 |
|
| Name = Dihydrokaempferide |
|
| Name = Dihydrokaempferide |
|
| ImageFile = Dihydrokaempferide.svg |
|
| ImageFile = Dihydrokaempferide.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = 3,5,7-trihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|
| IUPACName = 3,5,7-trihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
| Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 3570-69-2 |
|
|
| PubChem = 586387 |
|
| CASNo = 3570-69-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| SMILES = COC1=CC=C(C=C1)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O<!-- <br> --> |
|
|
|
| UNII = 9V3SE2M92C |
|
|
| PubChem = 586387 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 10305947 |
|
|
| SMILES = COc1ccc(cc1)2(C(=O)c3c(cc(cc3O2)O)O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H14O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,15-18,20H,1H3/t15-,16+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CKDYDMSDCNQHEB-JKSUJKDBSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>6</sub> |
|
| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>6</sub> |
|
| MolarMass = 302.27 g/mol |
|
| MolarMass = 302.27 g/mol |
|
|
| Appearance = |
|
| ExactMass = 302.079038 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Dihydrokaempferide''' is a ], a type of flavonoid. It can be found in '']''<ref>brazilian green ]<ref>. |
|
'''Dihydrokaempferide''' is a ], a type of flavonoid. It can be found in '']''<ref>{{cite journal |id={{INIST|4305555}} |doi=10.1016/0031-9422(92)80399-Y |title=Dihydroflavonols from ''Prunus domestica'' |year=1992 |last1=Parmar |first1=Virinder S. |last2=Vardhan |first2=Anand |last3=Nagarajan |first3=G.R. |last4=Jain |first4=Rajni |journal=Phytochemistry |volume=31 |issue=6 |pages=2185–6}}</ref> (plum tree), in the wood of '']''<ref>{{cite journal |id={{INIST|8569626}} |doi=10.1021/np50040a007 |title=Flavonoids from the Wood of Salix caprea as Inhibitors of Wood-Destroying Fungi |year=1985 |last1=Malterud |first1=Karl E. |last2=Bremnes |first2=Torgunn E. |last3=Faegri |first3=Agnete |last4=Moe |first4=Turid |last5=Dugstad |first5=Eva K. Sandanger |last6=Anthonsen |first6=Thorleif |last7=Henriksen |first7=Liv M. |journal=Journal of Natural Products |volume=48 |issue=4 |pages=559–63}}</ref> (goat willow) and in the Brazilian green ].<ref>{{cite journal |id={{INIST|21802341}} |doi=10.1248/bpb.32.1244 |title=Antihypertensive Effects of Flavonoids Isolated from Brazilian Green Propolis in Spontaneously Hypertensive Rats |year=2009 |last1=Maruyama |first1=Hiroe |last2=Sumitou |first2=Yoshiki |last3=Sakamoto |first3=Takashi |last4=Araki |first4=Yoko |last5=Hara |first5=Hideaki |journal=Biological & Pharmaceutical Bulletin |volume=32 |issue=7 |pages=1244–50|pmid=19571393 |doi-access=free }}</ref> |
|
|
|
|
<!-- ==Uses== |
|
<!-- ==Uses== |
|
can act as an --> |
|
can act as an --> |
|
|
|
|
<!--==Metabolism== |
|
<!--==Metabolism== |
|
The enzyme [[ --> |
|
The enzyme [[ --> |
|
|
|
|
<!-- ==Related compounds== |
|
<!-- ==Related compounds== |
|
] --> |
|
] --> |
|
|
|
|
<!-- ===Glycosides=== --> |
|
<!-- ===Glycosides=== --> |
|
⚫ |
== References == |
|
|
|
| ⚫ |
==References== |
|
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Flavanonol}} |
|
{{Flavanonol}} |
|
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |