| Revision as of 11:10, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 00:00, 1 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (19 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401003979 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| name = Dihydromorin |
|
|
⚫ |
| verifiedrevid = 424669619 |
| ⚫ |
| ImageFile = Dihydromorin.svg |
|
|
⚫ |
| Name = Dihydromorin |
|
| ImageSize = 250px |
|
|
⚫ |
| ImageFile = Dihydromorin.svg |
| ⚫ |
| IUPACName = (2''R'',3''R'')-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
|
|
| OtherNames = |
|
| ImageSize = 250px |
|
|
| IUPACName = (2''R'',3''R'')-2′,3,4′,5,7-Pentahydroxyflavan-4-one |
| ⚫ |
| Section1= {{Chembox Identifiers |
|
|
⚫ |
| SystematicName = (2''R'',3''R'')-2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4''H''-1-benzopyran-4-one |
| ⚫ |
| CASNo = 18422-83-8 |
|
|
| PubChem = 5458714 |
|
| OtherNames = |
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| SMILES = C1=CC(=C(C=C1O)O)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 18422-83-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = BHC9FB8RFH |
|
|
| PubChem = 5458714 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4572618 |
|
⚫ |
| SMILES = C1=CC(=C(C=C1O)O)2(C(=O)C3=C(C=C(C=C3O2)O)O)O |
|
|
| InChI = 1/C15H12O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,14-19,21H/t14-,15+/m0/s1 |
|
|
| InChIKey = QIWOFDHUQPJCJF-LSDHHAIUBR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H12O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,14-19,21H/t14-,15+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QIWOFDHUQPJCJF-LSDHHAIUSA-N |
|
}} |
|
}} |
|
| Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>12</sub>O<sub>7</sub> |
|
| Formula=C<sub>15</sub>H<sub>12</sub>O<sub>7</sub> |
|
| MolarMass = 304.25 g/mol |
|
| MolarMass = 304.25 g/mol |
|
|
| Appearance = |
|
| ExactMass = 304.058303 |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Dihydromorin''' is a ], a type of flavonoid. It can be found in '']'' (Black mulberry)<ref></ref>, in '']''<ref name="liberherbarum"></ref>, '']'' (''Maclura aurantiaca'' or Osage-Orange)<ref name="liberherbarum"/> and in the ] (''Artocarpus heterophyllus'')<ref name="Zong-Ping"></ref>. |
|
'''Dihydromorin''' is a ], a type of flavonoid. It can be found in plants of the family Moraceae including '']'' (Black mulberry),<ref></ref> in '']'',<ref name="liberherbarum"></ref> '']'' (''Maclura aurantiaca'' or Osage-Orange),<ref name="liberherbarum"/> in the ] (''Artocarpus heterophyllus'')<ref name="Zong-Ping">{{Cite journal|doi=10.1021/jf9014685|title=Chemical Components and Tyrosinase Inhibitors from the Twigs of Artocarpus heterophyllus|year=2009|last1=Zheng|first1=Zong-Ping|last2=Chen|first2=Sibao|last3=Wang|first3=Shiyun|last4=Wang|first4=Xia-Chang|last5=Cheng|first5=Ka-Wing|last6=Wu|first6=Jia-Jun|last7=Yang|first7=Dajiang|last8=Wang|first8=Mingfu|journal=Journal of Agricultural and Food Chemistry|volume=57|issue=15|pages=6649–55|pmid=19588925}}</ref> and in '']''.<ref>{{Cite journal|pmid=11858749|year=2002|last1=Su|first1=BN|last2=Cuendet|first2=M|last3=Hawthorne|first3=ME|last4=Kardono|first4=LB|last5=Riswan|first5=S|last6=Fong|first6=HH|last7=Mehta|first7=RG|last8=Pezzuto|first8=JM|last9=Kinghorn|first9=AD|title=Constituents of the bark and twigs of Artocarpus dadah with cyclooxygenase inhibitory activity|volume=65|issue=2|pages=163–9|journal=Journal of Natural Products|doi=10.1021/np010451c}}</ref> |
|
|
|
|
|
Dihydromorin is an inhibitor of ]<ref name="Zong-Ping"/>. |
|
Dihydromorin is an inhibitor of ].<ref name="Zong-Ping"/> |
|
|
|
|
|
==References== |
|
== See also == |
|
|
* ], the corresponding flavone |
|
|
|
|
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|