Revision as of 15:12, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit |
Latest revision as of 23:11, 1 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,242 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(22 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 444451416 |
|
⚫ |
| IUPAC_name = 8-(dimethylaminomethyl)-7-methoxy-3-methyl-2-phenylchromen-4-one |
|
⚫ |
| image = Dimefline.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|dimefline}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 1165-48-6 |
|
⚫ |
| ATC_prefix = R07 |
|
⚫ |
| ATC_suffix = AB08 |
|
⚫ |
| PubChem = 3078 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL = 519364 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 9WII5M0DU3 |
|
| UNII = 9WII5M0DU3 |
⚫ |
| verifiedrevid = 443334251 |
|
⚫ |
| IUPAC_name = 8-(dimethylaminomethyl)-7-methoxy-3-methyl-2-phenylchromen-4-one |
|
⚫ |
| image = Dimefline.svg |
|
⚫ |
| CAS_number = 1165-48-6 |
|
⚫ |
| ATC_prefix = R07 |
|
⚫ |
| ATC_suffix = AB08 |
|
⚫ |
| PubChem = 3078 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07847 |
|
| KEGG = D07847 |
|
|
| ChemSpiderID = 2969 |
|
| C=20 | H=21 | N=1 | O=3 |
|
|
|
| smiles = O=C\1c3c(O/C(=C/1C)c2ccccc2)c(c(OC)cc3)CN(C)C |
|
| molecular_weight = 323.38564 g/mol |
|
|
|
| StdInChI = 1S/C20H21NO3/c1-13-18(22)15-10-11-17(23-4)16(12-21(2)3)20(15)24-19(13)14-8-6-5-7-9-14/h5-11H,12H2,1-4H3 |
⚫ |
| bioavailability = |
|
|
|
| StdInChIKey = ZXFQRFXLFWWKLX-UHFFFAOYSA-N |
⚫ |
| protein_bound = |
|
|
|
|
⚫ |
| metabolism = |
|
|
|
<!--Chemical data--> |
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| C=20 | H=21 | N=1 | O=3 |
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
'''Dimefline''' is a respiratory stimulant.<ref>{{cite book | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391 | page = 100 | chapter = Dimefline | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&dq=Dimefline&pg=PA100 }}</ref> |
|
'''Dimefline''' is a ]. |
|
|
|
|
|
|
|
== References == |
⚫ |
{{Other respiratory system products}} |
|
|
|
{{reflist}} |
|
|
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
|
|
⚫ |
{{Other respiratory system products}} |
|
{{respiratory-system-drug-stub}} |
|
{{respiratory-system-drug-stub}} |
|
⚫ |
] |
|
|
|
|
⚫ |
] |
|
] |
|
|
⚫ |
] |