Misplaced Pages

Dimefline: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 15:12, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit Latest revision as of 23:11, 1 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,242 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(22 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| verifiedrevid = 444451416
| IUPAC_name = 8-(dimethylaminomethyl)-7-methoxy-3-methyl-2-phenylchromen-4-one
| image = Dimefline.svg

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|dimefline}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number = 1165-48-6
| ATC_prefix = R07
| ATC_suffix = AB08
| PubChem = 3078
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL = 519364
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9WII5M0DU3 | UNII = 9WII5M0DU3
| verifiedrevid = 443334251
| IUPAC_name = 8-(dimethylaminomethyl)-7-methoxy-3-methyl-2-phenylchromen-4-one
| image = Dimefline.svg
| CAS_number = 1165-48-6
| ATC_prefix = R07
| ATC_suffix = AB08
| PubChem = 3078
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07847 | KEGG = D07847
| ChemSpiderID = 2969
| C=20 | H=21 | N=1 | O=3
| smiles = O=C\1c3c(O/C(=C/1C)c2ccccc2)c(c(OC)cc3)CN(C)C
| molecular_weight = 323.38564 g/mol
| StdInChI = 1S/C20H21NO3/c1-13-18(22)15-10-11-17(23-4)16(12-21(2)3)20(15)24-19(13)14-8-6-5-7-9-14/h5-11H,12H2,1-4H3
| bioavailability =
| StdInChIKey = ZXFQRFXLFWWKLX-UHFFFAOYSA-N
| protein_bound =

| metabolism =
<!--Chemical data-->
| elimination_half-life =
| excretion = | C=20 | H=21 | N=1 | O=3
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}
'''Dimefline''' is a respiratory stimulant.<ref>{{cite book | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391 | page = 100 | chapter = Dimefline | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&dq=Dimefline&pg=PA100 }}</ref>
'''Dimefline''' is a ].


== References ==
{{Other respiratory system products}}
{{reflist}}

]
]
]


{{Other respiratory system products}}
{{respiratory-system-drug-stub}} {{respiratory-system-drug-stub}}
]

]
]
]