Revision as of 17:50, 30 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or [[user ta← Previous edit |
Latest revision as of 20:23, 15 September 2024 edit undoCitation bot (talk | contribs)Bots5,417,091 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:Thioesters | #UCB_Category 14/24 |
(23 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 431585933 |
|
| verifiedrevid = 431687371 |
|
| ImageFile = Dithiopyr.png |
|
| ImageFile = Dithiopyr.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| ImageAlt = Skeletal formula |
|
|
| ImageFile1 = Dithiopyr-3D-spacefill.png |
|
|
| ImageAlt1 = Ball-and-stick model |
|
| IUPACName = Dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioate |
|
| IUPACName = Dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioate |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 82855 |
|
| ChemSpiderID = 82855 |
Line 16: |
Line 19: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 97886-45-8 |
|
| CASNo = 97886-45-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2TXF17HAV1 |
|
| PubChem = 91757 |
|
| PubChem = 91757 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
Line 21: |
Line 26: |
|
| SMILES = FC(F)(F)c1nc(c(c(c1C(=O)SC)CC(C)C)C(=O)SC)C(F)F |
|
| SMILES = FC(F)(F)c1nc(c(c(c1C(=O)SC)CC(C)C)C(=O)SC)C(F)F |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>16</sub>F<sub>5</sub>NO<sub>2</sub>S<sub>2</sub> |
|
| Formula = C<sub>15</sub>H<sub>16</sub>F<sub>5</sub>NO<sub>2</sub>S<sub>2</sub> |
|
| MolarMass = 401.42 g/mol |
|
| MolarMass = 401.42 g/mol |
Line 29: |
Line 34: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Dithiopyr''' is a ] for ] control in turf and ornamental grasses. It is effective on 45 grassy and broadleaf weeds.<ref>{{Cite web|url=http://www.dowagro.com/turf/products/herbicides/dimension.htm|title=Dimension - Turf and Ornamental - Dow AgroSciences|website=www.dowagro.com|access-date=2016-04-23|archive-date=2016-04-16|archive-url=https://web.archive.org/web/20160416091948/http://www.dowagro.com/turf/products/herbicides/dimension.htm|url-status=dead}}</ref> Dithiopyr inhibits root growth of susceptible weeds as well as turf grass and thus should be used only on established turf with a well-developed root system. Its duration of efficacy is approximately 4 months, so lawns should not be reseeded during this time frame following application of the chemical. Dithiopyr acts primarily as a preemergent herbicide but can also be used in early postemergent control of crabgrass. |
⚫ |
'''Dithiopyr''' is a chemical used as an ] used to prevent ] seeds from sprouting in the spring.<ref>{{cite news |author= |coauthors= |title=Time is right to prevent crabgrass from sprouting |url=http://www.graphic-online.com/201004078335/opinion/columns/time-is-right-to-prevent-crabgrass-from-sprouting.html |quote= Most of the products that prevent crabgrass contain Dimension (chemical name — dithiopyr) or Barricade (chemical name — prodiamine). Both of these chemicals work well and are long-lasting, so they stop crabgrass throughout the summer. |work=] |date=April 7, 2010 |accessdate=2010-04-21 }}</ref> Dithiopyr may alter ] polymerization and stability by "interacting with microtubule associated proteins and/or microtubule organizing centers rather than interaction directly with tubulin."<ref>{{cite journal |title=Effects of the herbicide dithiopyr on cell division in wheat root tips | author=Barbara L. Armbruster, William T. Molin, and M. Wayne Bugg | journal =Pesticide Biochemistry and Physiology | volume =39 | issue =2 | pages =110–120 |accessdate=2010-04-21 |quote=The mode of action of dithiopyr may be to alter microtubule polymerization and stability by interacting with microtubule associated proteins and/or microtubule organizing centers rather than interaction directly with tubulin. |date=February 1, 1991 | doi=10.1016/0048-3575(91)90131-5}}</ref> |
|
|
|
|
|
|
It is an ingredient in many products including ] from ].<ref> for Dimension</ref> |
|
It is an ingredient in many products including ''Dimension'' from ].<ref> for Dimension</ref> |
|
|
|
|
|
== Mode of action == |
|
⚫ |
Dithiopyr acts as a root growth inhibitor, causing cessation of root elongation and inhibition of mitotic cell division. It inhibits formation of microtubules and spindle organizing centers. Dithiopyr may alter ] polymerization and stability by "interacting with microtubule associated proteins or microtubule organizing centers rather than interaction directly with tubulin."<ref>{{cite journal |title=Effects of the herbicide dithiopyr on cell division in wheat root tips |author1=Barbara L. Armbruster |author2=William T. Molin |author3=M. Wayne Bugg | journal =Pesticide Biochemistry and Physiology | volume =39 | issue =2 | pages =110–120 |quote=The mode of action of dithiopyr may be to alter microtubule polymerization and stability by interacting with microtubule associated proteins and/or microtubule organizing centers rather than interaction directly with tubulin. |date=February 1, 1991 | doi=10.1016/0048-3575(91)90131-5|bibcode=1991PBioP..39..110A }}<!--|accessdate=2010-04-21 --></ref> Mitotic cells are arrested in late prometaphase. Cell entry into mitosis is unaffected. |
|
|
|
|
|
== Synthesis == |
|
|
Dithiopyr can be obtained through a multi-step process starting from ] and ].<ref name=unger>{{cite book| author = Thomas A. Unger | title = Pesticide Synthesis Handbook | publisher = William Andrew Inc. | isbn = 0-81551853-6 | date = 1996 | page = 531 }} </ref> |
|
|
:]{{clear-left}} |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{Herbicides}} |
|
{{Herbicides}} |
Line 48: |
Line 59: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
] |
|
{{Agriculture-stub}} |
|
|
{{heterocyclic-stub}} |
|