| Revision as of 22:06, 21 December 2010 editLouisajb (talk | contribs)Extended confirmed users4,402 editsNo edit summary← Previous edit |
Latest revision as of 23:19, 5 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,044 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (21 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{expert-subject|date=March 2010}} |
|
{{Technical|date=March 2021}} |
|
{{drugbox | |
|
|
|
{{Infobox drug |
| ⚫ |
| IUPAC_name = 3-(6-aminopurin-9-yl)nonan-2-ol hydrochloride |
|
|
|
| verifiedrevid = 403603363 |
|
⚫ |
| IUPAC_name = 3-(6-aminopurin-9-yl)nonan-2-ol |
|
| image = EHNA.svg |
|
| image = EHNA.svg |
|
| width = 180 |
|
| width = 180 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
| CAS_number = 59262-86-1 |
|
| CAS_number = 59262-86-1 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 359137 |
|
| PubChem = 3206 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 50378 |
|
| ChEMBL = 50378 |
|
| DrugBank = |
|
| ChemSpiderID = 3094 |
|
|
|
| ⚫ |
| C = 14 | H = 24 | Cl = 1 | N = 5 | O = 1 |
|
|
|
<!--Chemical data--> |
|
| molecular_weight = 313.826 g/mol |
|
|
⚫ |
| C=14 | H=23 | N=5 | O=1 |
| ⚫ |
| bioavailability = |
|
|
|
| smiles = CCCCCCC(C(C)O)n1cnc2c1ncnc2N |
| ⚫ |
| protein_bound = |
|
|
|
| StdInChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17) |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey = IOSAAWHGJUZBOG-UHFFFAOYSA-N |
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
| ⚫ |
'''EHNA''' ('''e'''rythro-9-(2-'''h'''ydroxy-3-'''n'''only)'''a'''denine) is a ] that selectively inhibits phosphodiesterase type-2 (PDE2).<ref>{{cite journal | doi = 10.1016/0898-6568(95)00042-N | last1 = Podzuweit | first1 = T | last2 = Nennstiel | first2 = P | last3 = Muller | first3 = A | year = 1995 | title = Isozyme selective inhibition of cGMP-stimulated cyclic nucleotide phosphodiesterases by erythro-9-(2-hydroxy-3-nonyl) adenine | url = | journal = Cell Signal | volume = 7 | issue = 7| pages = 733–8 | pmid = 8519602 }}</ref><ref>{{cite journal | last1 = Méry | first1 = PF | last2 = Pavoine | first2 = C | last3 = Pecker | first3 = F | last4 = Fischmeister | first4 = R | year = 1995 | title = Erythro-9-(2-hydroxy-3-nonyl)adenine inhibits cyclic GMP-stimulated phosphodiesterase in isolated cardiac myocytes | url = | journal = Mol Pharmacol | volume = 48 | issue = 1| pages = 121–130 | pmid = 7623766 }}</ref> |
|
|
|
|
|
|
⚫ |
'''EHNA''' ('''e'''rythro-9-(2-'''h'''ydroxy-3-'''n'''only)'''a'''denine) is a potent ] inhibitor,<ref>{{cite web|title=Sigma Aldrich|url=http://www.sigmaaldrich.com/catalog/product/sigma/e114?lang=en®ion=US|access-date=16 January 2013}}</ref> which also acts as a ] that selectively inhibits ] (PDE2).<ref>{{cite journal | vauthors = Podzuweit T, Nennstiel P, Müller A | title = Isozyme selective inhibition of cGMP-stimulated cyclic nucleotide phosphodiesterases by erythro-9-(2-hydroxy-3-nonyl) adenine | journal = Cellular Signalling | volume = 7 | issue = 7 | pages = 733–8 | date = September 1995 | pmid = 8519602 | doi = 10.1016/0898-6568(95)00042-N }}</ref><ref>{{cite journal | vauthors = Méry PF, Pavoine C, Pecker F, Fischmeister R | title = Erythro-9-(2-hydroxy-3-nonyl)adenine inhibits cyclic GMP-stimulated phosphodiesterase in isolated cardiac myocytes | journal = Molecular Pharmacology | volume = 48 | issue = 1 | pages = 121–30 | date = July 1995 | pmid = 7623766 }}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
<references/> |
|
|
⚫ |
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Phosphodiesterase inhibitors}} |
|
{{Phosphodiesterase inhibitors}} |
| Line 37: |
Line 53: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|