Misplaced Pages

EHNA: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 22:06, 21 December 2010 editLouisajb (talk | contribs)Extended confirmed users4,402 editsNo edit summary← Previous edit Latest revision as of 23:19, 5 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,044 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(21 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{expert-subject|date=March 2010}} {{Technical|date=March 2021}}
{{drugbox |
{{Infobox drug
| IUPAC_name = 3-(6-aminopurin-9-yl)nonan-2-ol hydrochloride
| verifiedrevid = 403603363
| IUPAC_name = 3-(6-aminopurin-9-yl)nonan-2-ol
| image = EHNA.svg | image = EHNA.svg
| width = 180 | width = 180

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = <!-- OTC / Rx-only -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number = 59262-86-1 | CAS_number = 59262-86-1
| ATC_prefix = | ATC_prefix =
| ATC_suffix = | ATC_suffix =
| PubChem = 359137 | PubChem = 3206
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 50378 | ChEMBL = 50378
| DrugBank = | ChemSpiderID = 3094

| C = 14 | H = 24 | Cl = 1 | N = 5 | O = 1
<!--Chemical data-->
| molecular_weight = 313.826 g/mol
| C=14 | H=23 | N=5 | O=1
| bioavailability =
| smiles = CCCCCCC(C(C)O)n1cnc2c1ncnc2N
| protein_bound =
| StdInChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17)
| metabolism =
| StdInChIKey = IOSAAWHGJUZBOG-UHFFFAOYSA-N
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = <!-- OTC / Rx-only -->
| legal_status =
| routes_of_administration =
}} }}
'''EHNA''' ('''e'''rythro-9-(2-'''h'''ydroxy-3-'''n'''only)'''a'''denine) is a ] that selectively inhibits phosphodiesterase type-2 (PDE2).<ref>{{cite journal | doi = 10.1016/0898-6568(95)00042-N | last1 = Podzuweit | first1 = T | last2 = Nennstiel | first2 = P | last3 = Muller | first3 = A | year = 1995 | title = Isozyme selective inhibition of cGMP-stimulated cyclic nucleotide phosphodiesterases by erythro-9-(2-hydroxy-3-nonyl) adenine | url = | journal = Cell Signal | volume = 7 | issue = 7| pages = 733–8 | pmid = 8519602 }}</ref><ref>{{cite journal | last1 = Méry | first1 = PF | last2 = Pavoine | first2 = C | last3 = Pecker | first3 = F | last4 = Fischmeister | first4 = R | year = 1995 | title = Erythro-9-(2-hydroxy-3-nonyl)adenine inhibits cyclic GMP-stimulated phosphodiesterase in isolated cardiac myocytes | url = | journal = Mol Pharmacol | volume = 48 | issue = 1| pages = 121–130 | pmid = 7623766 }}</ref>


'''EHNA''' ('''e'''rythro-9-(2-'''h'''ydroxy-3-'''n'''only)'''a'''denine) is a potent ] inhibitor,<ref>{{cite web|title=Sigma Aldrich|url=http://www.sigmaaldrich.com/catalog/product/sigma/e114?lang=en&region=US|access-date=16 January 2013}}</ref> which also acts as a ] that selectively inhibits ] (PDE2).<ref>{{cite journal | vauthors = Podzuweit T, Nennstiel P, Müller A | title = Isozyme selective inhibition of cGMP-stimulated cyclic nucleotide phosphodiesterases by erythro-9-(2-hydroxy-3-nonyl) adenine | journal = Cellular Signalling | volume = 7 | issue = 7 | pages = 733–8 | date = September 1995 | pmid = 8519602 | doi = 10.1016/0898-6568(95)00042-N }}</ref><ref>{{cite journal | vauthors = Méry PF, Pavoine C, Pecker F, Fischmeister R | title = Erythro-9-(2-hydroxy-3-nonyl)adenine inhibits cyclic GMP-stimulated phosphodiesterase in isolated cardiac myocytes | journal = Molecular Pharmacology | volume = 48 | issue = 1 | pages = 121–30 | date = July 1995 | pmid = 7623766 }}</ref>
==References==

<references/>
== References ==
{{reflist}}


{{Phosphodiesterase inhibitors}} {{Phosphodiesterase inhibitors}}
Line 37: Line 53:
] ]
] ]
] ]




EHNA: Difference between revisions Add topic