| Revision as of 18:59, 8 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII').← Previous edit |
Latest revision as of 16:02, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:3-Hydroxyphenyl compounds using HotCat |
| (22 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Lignan formed by the action of intestinal bacteria on lignan precursors found in plants.}} |
|
{{chembox |
|
|
|
{{Chembox |
| ⚫ |
| verifiedrevid = 405873208 |
|
|
|
| Verifiedfields = changed |
|
|ImageFile=Enterodiol.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=180px |
|
|
⚫ |
| verifiedrevid = 443726976 |
| ⚫ |
|IUPACName= (2''R'',3''R'')-2,3-bisbutane-1,4-diol |
|
|
|OtherNames=(-)-Enterodiol |
|
| ImageFile = Enterodiol.png |
|
⚫ |
| ImageSize = 180px |
|
⚫ |
| PIN = (2''R'',3''R'')-2,3-Bisbutane-1,4-diol |
|
|
| OtherNames = (−)-Enterodiol |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=80226-00-2 |
|
| CASNo = 80226-00-2 |
|
| PubChem=115089 |
|
|
| UNII = BZF4X2AWRP |
|
| PubChem = 115089 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C1=CC(=CC(=C1)O)C(CO)(CC2=CC(=CC=C2)O)CO |
|
|
|
| UNII = BZF4X2AWRP |
| ⚫ |
}} |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C18166 |
|
⚫ |
| SMILES = C1=CC(=CC(=C1)O)C(CO)(CC2=CC(=CC=C2)O)CO |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 102992 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 471076 |
|
|
| InChI = 1/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 |
|
|
| InChIKey = DWONJCNDULPHLV-HOTGVXAUBO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = DWONJCNDULPHLV-HOTGVXAUSA-N |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=18|H=22|O=4 |
|
| C=18|H=22|O=4 |
|
| Appearance= |
|
| Appearance = colorless |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Enterodiol''' is an organic compound with the formula <sub>2</sub>. |
|
'''Enterodiol''' is a ] formed by the action of intestinal bacteria on lignan precursors found in plants.<ref>{{cite journal | author = Lampe JW | title = Isoflavonoid and lignan phytoestrogens as dietary biomarkers | journal = J Nutr | year = 2003 | volume = 133 | issue = Suppl 3 | pages = 956S–964S | pmid = 12612182}}</ref> |
|
|
|
|
|
|
It is formed by the action of intestinal bacteria on ] precursors. As such it is sometimes classified as a ] or mammalian lignan.<ref>{{cite journal |doi=10.1080/10408360701612942|title=Lignans and Human Health|year=2007|last1=Adlercreutz|first1=Herman|journal=Critical Reviews in Clinical Laboratory Sciences|volume=44|issue=5–6|pages=483–525|pmid=17943494|s2cid=31753060}}</ref><ref>{{cite journal | author = Lampe JW | title = Isoflavonoid and lignan phytoestrogens as dietary biomarkers | journal = J Nutr | year = 2003 | volume = 133 | issue = Suppl 3 | pages = 956S–964S | pmid = 12612182 | doi=10.1093/jn/133.3.956S| doi-access = free }}</ref> Elevated levels of enterodiol in urine are attributed consumption of tea and other lignan-rich foods.<ref>{{cite journal |doi=10.1093/ajcn/54.6.1093|title=Urinary excretion of lignans and isoflavonoid phytoestrogens in Japanese men and women consuming a traditional Japanese Diet|year=1991|last1=Adlercreutz|first1=H.|last2= Honjo|first2=H.|last3=Higashi|first3=A.|last4=Fotsis|first4=T.|last5= Hämäläinen|first5=E.|last6=Hasegawa|first6=T.|last7=Okada|first7=H.|journal=The American Journal of Clinical Nutrition|volume=54|issue=6|pages=1093–1100|pmid=1659780|doi-access=free}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 35: |
Line 54: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{aromatic-stub}} |