Revision as of 06:26, 13 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 19:43, 27 February 2021 edit undoRitenerek (talk | contribs)Extended confirmed users1,818 edits Changing short description from "Chemical compound" to "Anti-inflammatory drug" (Shortdesc helper) |
(17 intermediate revisions by 11 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Anti-inflammatory drug}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444583283 |
|
⚫ |
| IUPAC_name = 4-methoxy-2-(5-methoxy-3-methylpyrazol-1-yl)-6-methylpyrimidine |
|
⚫ |
| image = Epirizole.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|epirizole}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 18694-40-1 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 3242 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB08991 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 3B46O2FH8I |
|
| UNII = 3B46O2FH8I |
⚫ |
| verifiedrevid = 437139578 |
|
⚫ |
| IUPAC_name = 4-methoxy-2-(5-methoxy-3-methylpyrazol-1-yl)-6-methylpyrimidine |
|
⚫ |
| image = Epirizole.png |
|
⚫ |
| CAS_number = 18694-40-1 |
|
|
| CAS_supplemental = |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 3242 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01394 |
|
| KEGG = D01394 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
⚫ |
| chemical_formula = |
|
|
|
| ChemSpiderID = 3129 |
|
|
| smiles = n1c(OC)cc(nc1n2nc(cc2OC)C)C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C11H14N4O2/c1-7-5-9(16-3)13-11(12-7)15-10(17-4)6-8(2)14-15/h5-6H,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RHAXSHUQNIEUEY-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
| C=11 | H=14 | N=4 | O=2 |
|
| C=11 | H=14 | N=4 | O=2 |
|
| molecular_weight = 234.25 g/mol |
|
|
| smiles = CC1=CC(=NC(=N1)N2C(=CC(=N2)C)OC)OC |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
Line 39: |
Line 57: |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{NSAIDs}} |
|
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|