Misplaced Pages

Epirizole: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 06:26, 13 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit Latest revision as of 19:43, 27 February 2021 edit undoRitenerek (talk | contribs)Extended confirmed users1,818 edits Changing short description from "Chemical compound" to "Anti-inflammatory drug" (Shortdesc helper
(17 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Short description|Anti-inflammatory drug}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444583283
| IUPAC_name = 4-methoxy-2-(5-methoxy-3-methylpyrazol-1-yl)-6-methylpyrimidine
| image = Epirizole.png

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|epirizole}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Rx-only
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 18694-40-1
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 3242
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB08991
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3B46O2FH8I | UNII = 3B46O2FH8I
| verifiedrevid = 437139578
| IUPAC_name = 4-methoxy-2-(5-methoxy-3-methylpyrazol-1-yl)-6-methylpyrimidine
| image = Epirizole.png
| CAS_number = 18694-40-1
| CAS_supplemental =
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 3242
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01394 | KEGG = D01394
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| chemical_formula =
| ChemSpiderID = 3129
| smiles = n1c(OC)cc(nc1n2nc(cc2OC)C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C11H14N4O2/c1-7-5-9(16-3)13-11(12-7)15-10(17-4)6-8(2)14-15/h5-6H,1-4H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = RHAXSHUQNIEUEY-UHFFFAOYSA-N

<!--Chemical data-->
| chemical_formula =
| C=11 | H=14 | N=4 | O=2 | C=11 | H=14 | N=4 | O=2
| molecular_weight = 234.25 g/mol
| smiles = CC1=CC(=NC(=N1)N2C(=CC(=N2)C)OC)OC
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Rx-only
| routes_of_administration = Oral
}} }}


Line 39: Line 57:


{{Anti-inflammatory and antirheumatic products}} {{Anti-inflammatory and antirheumatic products}}
{{NSAIDs}}


] ]