Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Eriochrome Black T: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 10:48, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477032646 of page Eriochrome_Black_T for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CASNo').  Latest revision as of 06:15, 22 December 2024 edit Graeme Bartlett (talk | contribs)Administrators249,429 editsm chemspider 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 461095034 | verifiedrevid = 477163251
| ImageFile = Erio T.svg | ImageFile = Eriochrome black T.svg
| ImageName = Wireframe model of an eriochrome black T minor tautomer | ImageName = Wireframe model of an eriochrome black T minor tautomer
| ImageFile1 = Sample of Eriochrome Black T.jpg
| PIN = Sodium 4-[(1-hydroxynaphthalen-2-yl-<br />
| ImageSize1 = 200
hydrazinylidene]-7-nitro-3-oxo-''Y''-naphthalene-<br />
| ImageName1 = Sample of Eriochrome Black T
1-sulfonate
| SystematicName = Sodium 4-[2-(1-hydroxynaphthalen-2-yl)<br /> | PIN = Sodium 1--6-nitro-2-naphthol-4-sulfonate
hydrazin-1-ylidene]-7-nitro-3-oxo-3,4-<br /> | SystematicName = Sodium 4--7-nitro-3-oxo-3,4-dihydronaphthalene-1-sulfonate
| OtherNames = Sodium 4--7-nitro-3-oxonaphthalene-1-sulfonate; Solochrome Black T; ET-00; Erio T
dihydronaphthalene-1-sulfonate
| OtherNames = Sodium 4-[2-(1-hydroxynaphthalen-2-yl)<br />
hydrazin-1-ylidene]-7-nitro-3-oxonaphthalene-<br />
1-sulfonate<br />
Solochrome Black T
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| Abbreviations = EBT | Abbreviations = EBT
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | InChI = 1/C20H13N3O7S.Na/c24-17-10-18(31(28,29)30)15-9-12(23(26)27)6-7-14(15)19(17)22-21-16-8-5-11-3-1-2-4-13(11)20(16)25;/h1-10,24-25H,(H,28,29,30);/q;+1/p-1/b22-21+;
| CASNo = 1787-61-7
⚫ | InChIKey = AMMWFYKTZVIRFN-YJURRCIZBT
⚫ | ChemSpiderID = 10483790
| SMILES1 = .S(=O)(=O)c3cc(O)c(/N=N/c2ccc1ccccc1c2O)c4ccc(cc34)()=O
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI1 = 1S/C20H13N3O7S.Na/c24-17-10-18(31(28,29)30)15-9-12(23(26)27)6-7-14(15)19(17)22-21-16-8-5-11-3-1-2-4-13(11)20(16)25;/h1-10,24-25H,(H,28,29,30);/q;+1/p-1/b22-21+;
| UNII = MPC0KHJ23C
| InChIKey1 = AMMWFYKTZVIRFN-QUABFQRHSA-M
⚫ | PubChem = 6808871
⚫ | CASNo_Ref = {{cascite|changed|??}}
⚫ | PubChem1 = 5359641
| CASNo = <!-- blanked - oldvalue: 1787-61-7 -->
⚫ | PubChem1_Comment = (4''E'')
⚫ | PubChem = 6808871
⚫ | PubChem2 = 5351620
| PubChem_Ref = {{Pubchemcite}}
⚫ | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫ | PubChem1 = 5359641
⚫ | EINECS = 217-250-3
⚫ | PubChem1_Comment = (4''E'')
⚫ | UNNumber = 2923
| PubChem1_Ref = {{Pubchemcite}}
⚫ | MeSHName = Eriochrome+black+T
⚫ | PubChem2 = 5351620
⚫ | RTECS = QK2197000
| PubChem2_Comment = (4''Z'')
| SMILES = C1=CC=C2C(=C1)C=CC(=C2O)/N=N/C3=C4C=CC(=CC4=C(C=C3O)S(=O)(=O))(=O).
| PubChem2_Ref = {{Pubchemcite}}
⚫ | InChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | ChemSpiderID = 10483790
⚫ | InChI = InChI=1S/C20H13N3O7S.Na/c24-17-10-18(31(28,29)30)15-9-12(23(26)27)6-7-14(15)19(17)22-21-16-8-5-11-3-1-2-4-13(11)20(16)25;/h1-10,24-25H,(H,28,29,30);/q;+1/p-1/b22-21+;
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | InChIKey_Ref = {{stdinchicite|correct|chemspider}}
| ChemSpiderID1 = 4508620
⚫ | InChIKey = AMMWFYKTZVIRFN-QUABFQRHSA-M
| ChemSpiderID1_Comment = (4''Z'')
⚫ | Beilstein = 4121162}}
| ChemSpiderID1_Ref = {{Chemspidercite}}
⚫ | EINECS = 217-250-3
⚫ | UNNumber = 2923
⚫ | MeSHName = Eriochrome+black+T
⚫ | RTECS = QK2197000
| SMILES = .OC1=C(NN=C2C(=O)C=C(C3=C2C<br />
==CC(==C3)N(=O)=O)S()(=O)=O)C=C<br />
C2=C1C=CC=C2
⚫ | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C20H13N3O7S.Na/c24-17-10-18(31(28,29)30)15-9-12(23(26)27)6-7-14(15)19(17)22-21-16-8-5-11-3-1-2-4-13(11)20(16)25;/h1-10,24-25H,(H,28,29,30);/q;+1/p-1/b22-21+;
⚫ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = AMMWFYKTZVIRFN-QUABFQRHSA-M
⚫ | Beilstein = 4121162}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>20</sub>H<sub>12</sub>N<sub>3</sub>O<sub>7</sub>SNa | Formula = C<sub>20</sub>H<sub>12</sub>N<sub>3</sub>O<sub>7</sub>SNa
| MolarMass = 461.381 g/mol | MolarMass = 461.381 g/mol
| Appearance = Dark red/brown powder | pKa = 6.2, 11.55
| Appearance = dark red/brown powder
| Density = | MeltingPt =
| MeltingPt = | BoilingPt =
| BoilingPt = | Solubility =
| Solubility =
}} }}
}} }}

'''Eriochrome Black T''' is a ] that is used in ]s, e.g. in the ] determination process. It is an ]. Eriochrome is a trademark of ].<ref>{{cite web |url=http://www.sigmaaldrich.com/catalog/product/sial/858390?lang=en&region=US |title = Eriochrome Black T ACS reagent indicator grade 1787-61-7}}</ref>

In its deprotonated form, Eriochrome Black T is blue. It turns red when it forms a ] with ], ], or other metal ions.

] at pH 10. It turns red when Ca<sup>2+</sup> ions are added.]]

==Applications==

When used as an indicator in an ] titration, the characteristic blue ] is reached when sufficient EDTA is added and the metal ions bound to the indicator are ] by EDTA, leaving the free indicator molecule.

Eriochrome Black T has also been used to detect the presence of rare earth metals.<ref>{{cite journal | author1 = Dubenskaya, L. O. | author2 = Levitskaya, G. D. | title = Use of Eriochrome black T for the polarographic determination of rare-earth metals | journal = Journal of Analytical Chemistry | issn = 1061-9348 | year = 1999 | volume = 54 | pages = 655&ndash;657 | issue = 7 | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=1896853 | access-date = 2007-06-05 | archive-date = 2010-10-01 | archive-url = https://web.archive.org/web/20101001034040/http://cat.inist.fr/?aModele=afficheN&cpsidt=1896853 | url-status = dead }}</ref>

==References==
{{Reflist}}

==External links==
*
*

]
]

]
]
]
]
]
]
]