| Revision as of 00:23, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 04:09, 12 January 2025 edit undoPreimage (talk | contribs)Extended confirmed users1,352 edits →Chembox: Add formula (for ethyl green cation); →Body: Copyedit/rework + remove duplicate SMILES and incorrect CAS (for ethyl green·ZnCl2) |
| (15 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=February 2009}} |
|
{{more citations needed|date=November 2022}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443743144 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443779358 |
|
| ImageFile1 = Ethyl green.png |
|
| ImageFile1 = Ethyl green.png |
|
| ImageSize1 = 200px |
|
| ImageSize1 = 200px |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID = 11941 |
|
| ChemSpiderID = 76382 |
|
| PubChem = 12449 |
|
| PubChem = 84672 |
|
|
| InChI1 = |
|
| InChI1 = 1/C27H33N2.H2O4S/c1-5-28(6-2)25-18-14-23(15-19-25)27(22-12-10-9-11-13-22)24-16-20-26(21-17-24)29(7-3)8-4;1-5(2,3)4/h9-21H,5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
|
|
| InChIKey1 = NNBFNNNWANBMTI-REWHXWOFAJ |
|
| InChIKey1 = |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C27H33N2.H2O4S/c1-5-28(6-2)25-18-14-23(15-19-25)27(22-12-10-9-11-13-22)24-16-20-26(21-17-24)29(7-3)8-4;1-5(2,3)4/h9-21H,5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
|
| StdInChI = InChI=1S/C27H35N3/c1-8-30(6,7)26-19-13-23(14-20-26)27(21-9-15-24(16-10-21)28(2)3)22-11-17-25(18-12-22)29(4)5/h9-20H,8H2,1-7H3/q+2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = NNBFNNNWANBMTI-UHFFFAOYSA-M |
|
| StdInChIKey = ZRJYQNPSWSGCMS-UHFFFAOYSA-N |
|
| SMILES = S(=O)(=O)O.(=C/1\C=C/C(C=C\1)=C(/c2ccccc2)c3ccc(N(CC)CC)cc3)(\CC)CC |
|
| SMILES = CC(C)(C)C1=CC=C(C=C1)C(=C2C=CC(=(C)C)C=C2)C3=CC=C(C=C3)N(C)C |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = 7114-03-6 |
|
| CASNo = 14855-76-6 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = QFQ95SNB21 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula = {{chem2|C27H35N3(2+)}} |
|
|
| MolarMass = |
|
|
| Appearance = |
|
|
| Density = |
|
|
| Solubility = |
|
|
| MeltingPtC = |
|
|
| MeltingPt_notes = decomposes |
|
|
| BoilingPt = |
|
|
| pKa = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Ethyl Green''' ('''C.I. 42590'''; {{chem2|C27H35BrClN3}}) is a water-soluble ].<ref name=":0">{{Cite web |title=ethyl green (CHEBI:88288) |url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:88288 |access-date=2022-11-14 |website=www.ebi.ac.uk}}</ref><ref>{{Cite web |last=PubChem |title=Ethyl Green cation |url=https://pubchem.ncbi.nlm.nih.gov/compound/84672 |access-date=2022-11-14 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref><ref name=":1">{{Cite web |title=Stainsfile - Ethyl green |url=https://stainsfile.info/dyes/42590.htm |access-date=2022-11-14 |website=stainsfile.info}}</ref> |
|
|
|
|
|
|
It is derived from ] by adding a N-]; crystal violet is therefore a possible contaminant.<ref name=":1" /> Changing the N-ethyl group to N-methyl yields ]. All three dyes are used as ] ]s.<ref name=":0" /><ref name=":1" /> |
|
The ] '''Ethyl Green''' ( '''C.I. 42590'''; C<sub>27</sub>H<sub>35</sub>N<sub>3</sub>ClBr is a triarylmethane dye. It is soluble in water. |
|
|
|
|
|
|
⚫ |
==External links== |
|
{{SMILESCAS|CAS=7114-03-6|SMILES=C/(C)=C (C=C3)/C=C\C3=C (C2=CC=C((C) (CC)C)C=C2)/C1=C C=C(N(C)C)C=C1}} |
|
|
|
* {{Webarchive|url=https://web.archive.org/web/20050218233025/http://stainsfile.info/StainsFile/dyes/42590.htm |date=2005-02-18 }} |
|
<!-- Would CC(C)(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)=C3C=CC(C=C3)=(C)C be a better formula? I'm not sure if the double bond isomer markers are really necessary.--> |
|
|
|
|
|
|
|
==References== |
|
Ethyl green is made of ] by adding an ]; crystal violet is therefore a possible contaminant. |
|
|
|
{{reflist}} |
|
|
|
|
] is a closely related dye used as a ] in ]. Methyl green and ethyl green are very similar and probably interchangeable. |
|
|
|
|
| ⚫ |
==External links== |
|
|
* |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antimicrobial-stub}} |
|
{{antimicrobial-stub}} |
|
|
|
|
] |
|
|
] |
|