Revision as of 14:25, 1 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 01:52, 11 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
(34 intermediate revisions by 29 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox | |
|
|
|
{{Drugbox |
|
|
| verifiedrevid = 447764085 |
|
| IUPAC_name = ''N''-ethyl-''N''-methyl-4,4-dithiophen-2-yl-but-3-en-2-amine |
|
| IUPAC_name = ''N''-ethyl-''N''-methyl-4,4-dithiophen-2-yl-but-3-en-2-amine |
|
| image = Ethylmethylthiambutene structure.svg |
|
| image = Ethylmethylthiambutene structure.svg |
|
|
| image_class = skin-invert-image |
|
| width = 140 |
|
| width = 140 |
|
|
|
⚫ |
| ChemSpiderID = 42256 |
|
|
|
<!--Clinical data--> |
⚫ |
| InChI = 1/C15H19NS2/c1-4-16(3)12(2)11-13(14-7-5-9-17-14)15-8-6-10-18-15/h5-12H,4H2,1-3H3 |
|
|
|
| tradename = |
⚫ |
| InChIKey = MORSAEFGQPDBKM-UHFFFAOYAM |
|
|
⚫ |
| pregnancy_AU = |
|
| smiles1 = s1cccc1/C(c2sccc2)=C/C(N(CC)C)C |
|
|
⚫ |
| pregnancy_US = |
|
| StdInChI = 1S/C15H19NS2/c1-4-16(3)12(2)11-13(14-7-5-9-17-14)15-8-6-10-18-15/h5-12H,4H2,1-3H3 |
|
|
⚫ |
| pregnancy_category = |
|
| StdInChIKey = MORSAEFGQPDBKM-UHFFFAOYSA-N |
|
|
⚫ |
| legal_AU = |
|
|
| legal_BR = A1 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|
⚫ |
| legal_CA = Schedule I |
|
|
| legal_US = Schedule I |
|
|
| legal_DE = Anlage I |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
| CAS_number = 441-61-2 |
|
| CAS_number = 441-61-2 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 46424 |
|
| PubChem = 46424 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| smiles = CCN(C)C(C)C=C(c1cccs1)c1cccs1 |
|
|
|
| DrugBank = DB01468 |
⚫ |
| C=15 | H=19 | N=1 | S=2 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| molecular_weight = 277.45 g/mol |
|
|
⚫ |
| ChemSpiderID = 42256 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 722BFZ899Q |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D12663 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=15 | H=19 | N=1 | S=2 |
|
| smiles = CCN(C)C(C)C=C(C1=CC=CS1)C2=CC=CS2 |
|
| smiles = CCN(C)C(C)C=C(C1=CC=CS1)C2=CC=CS2 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| melting_point = |
|
|
⚫ |
| StdInChI = 1S/C15H19NS2/c1-4-16(3)12(2)11-13(14-7-5-9-17-14)15-8-6-10-18-15/h5-12H,4H2,1-3H3 |
⚫ |
| melting_high = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
⚫ |
| bioavailability = |
|
|
⚫ |
| StdInChIKey = MORSAEFGQPDBKM-UHFFFAOYSA-N |
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| melting_point = |
|
⚫ |
| melting_high = |
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = |
|
⚫ |
| pregnancy_US = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = |
|
|
| legal_CA = |
|
|
| legal_UK = |
|
⚫ |
| legal_US = Schedule I |
|
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Ethylmethylthiambutene''' (''N''-ethyl-''N''-methyl-1-methyl-3,3-di-2-thienylallylamine, Emethibutin) is an ] ] drug from the ] family, around 1.3x the potency of ].<ref>Adamson DW, Green AF. A new series of analgesics. ''Nature''. 1950 Jan 21;165(4186):122. PMID 15409854</ref><ref>Adamson DW, Duffin WM, Green AF. Dithienylbutylamines as analgesics. ''Nature''. 1951 Jan 27;167(4239):153-4. PMID 14806409</ref><ref>Green AF. Analgesic and other properties of 3: 3-dithienylalkenylamines. ''British Journal of Pharmacology and Chemotherapy''. 1953 Mar;8(1):2-9. PMID 13066683</ref> It is under international control under Schedule I of the UN Single Convention On Narcotic Drugs 1961, presumably due to high abuse potential. |
|
'''Ethylmethylthiambutene''' ({{not a typo|''N''-ethyl-''N''-methyl-1-methyl-3,3-di-2-thienylallylamine}}; '''Emethibutin''') is an ] ] drug from the ] family, around 1.3x the potency of ].<ref>{{cite journal | vauthors = Adamson DW, Green AF | s2cid = 4190157 | title = A new series of analgesics | journal = Nature | volume = 165 | issue = 4186 | pages = 122 | date = January 1950 | pmid = 15409854 | doi = 10.1038/165122a0 | bibcode = 1950Natur.165..122A | doi-access = free }}</ref><ref>{{cite journal | vauthors = Adamson DW, Duffin WM, Green AF | s2cid = 4280042 | title = Dithienylbutylamines as analgesics | journal = Nature | volume = 167 | issue = 4239 | pages = 153–4 | date = January 1951 | pmid = 14806409 | doi = 10.1038/167153b0 | bibcode = 1951Natur.167..153A }}</ref><ref>{{cite journal | vauthors = Green AF | title = Analgesic and other properties of 3: 3-dithienylalkenylamines | journal = British Journal of Pharmacology and Chemotherapy | volume = 8 | issue = 1 | pages = 2–9 | date = March 1953 | pmid = 13066683 | pmc = 1509239 | doi = 10.1111/j.1476-5381.1953.tb00739.x }}</ref> It is under international control under Schedule I of the UN Single Convention On Narcotic Drugs 1961, presumably due to high abuse potential. |
|
|
|
|
|
It is a Schedule I controlled substance in the United States with a DEA ACSCN of 9623 and zero annual manufacturing quota as of 2013.{{citation needed|date=June 2014}} |
|
|
|
|
|
⚫ |
== References == |
|
{{Opioids}} |
|
|
|
|
⚫ |
==References== |
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Analgesics}} |
⚫ |
] |
|
|
|
{{Opioidergics}} |
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
⚫ |
{{analgesic-stub}} |
|
|
|
|
|
|
⚫ |
{{analgesic-stub}} |
|
] |
|