| Revision as of 21:45, 30 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Dr← Previous edit |
Latest revision as of 01:45, 2 September 2024 edit undo98.178.241.102 (talk) Cats. |
| (79 intermediate revisions by 47 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 430154327 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 447557117 |
|
| IUPAC_name = (''RS'')-1-(1,3-benzodioxol-5-yl)-2-(ethylamino)propan-1-one |
|
| IUPAC_name = (''RS'')-1-(1,3-benzodioxol-5-yl)-2-(ethylamino)propan-1-one |
|
| image = Bk-MDEA.svg |
|
| image = Bk-MDEA.svg |
|
| width = 250px |
|
| width = 200px |
|
| imagename = 1 : 1 mixture (racemate) |
|
| chirality = ] |
|
| drug_name = Ethylone |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = N (US) |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
|
| legal_status = |
|
|
|
| legal_BR = F2 |
| ⚫ |
| routes_of_administration = |
|
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=] |language=pt-BR |publication-date=2023-07-25}}</ref> |
|
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_DE = Anlage I |
|
|
| legal_NZ = <!-- Class A, B, C --> |
|
|
| legal_UK = Class B |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_UN = P II |
|
|
| legal_UN_comment = <ref>{{Cite web |title=Substance Details Ethylone |url=https://www.unodc.org/LSS/Substance/Details/2d91de8d-13b7-4c69-9a1b-b1b379c4223e |access-date=2024-01-22}}</ref> |
|
|
| legal_EU = |
|
⚫ |
| routes_of_administration = Oral, nasal, IV |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 17: |
Line 28: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
| CAS_number = |
|
| CAS_number = 1112937-64-0 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = L91C78FW96 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = 57252245 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C22709 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 21106271 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H15NO3/c1-3-13-8(2)12(14)9-4-5-10-11(6-9)16-7-15-10/h4-6,8,13H,3,7H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MJEMIOXXNCZZFK-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=15 | N=1 | O=3 |
|
| C=12 | H=15 | N=1 | O=3 |
|
| molecular_weight = 221.2524 g/mol |
|
|
| smiles = CC(NCC)C(=O)c1ccc2OCOc2c1 |
|
| smiles = CC(NCC)C(=O)c1ccc2OCOc2c1 |
|
}} |
|
}} |
|
|
|
|
|
'''Ethylone''', also known as '''3,4-methylenedioxy-''N''-ethylcathinone''' ('''MDEC''', '''bk-MDEA'''), is an ], ], and ] of the ], ], and ] ]es. It is the ] ] of ] ("Eve"). Ethylone has only a short history of human use and is reported to be less potent than its relative ]. Very little data exists about the pharmacological properties, metabolism, and toxicity of ethylone. |
|
'''Ethylone''', also known as '''3,4-methylenedioxy-''N''-ethylcathinone''' ('''MDEC''', '''βk-MDEA'''), is a ] ] classified as an ], ], and ] of the ], ], and ] ]es. It is the ] ] of ] ("Eve"). Ethylone has only a short history of human use and is reported to be less potent than its relative ].{{citation needed|date=May 2015}} In the United States, it began to be found in cathinone products in late 2011.<ref name="jat">{{cite journal | vauthors = Lee D, Chronister CW, Hoyer J, Goldberger BA | title = Ethylone-Related Deaths: Toxicological Findings | journal = Journal of Analytical Toxicology | volume = 39 | issue = 7 | pages = 567–71 | date = September 2015 | pmid = 26025164 | doi = 10.1093/jat/bkv053 | doi-access = free }}</ref> |
|
|
|
|
|
Very little data exists about the pharmacological properties, metabolism, and toxicity of ethylone, and although several ethylone-related deaths have been reported, the cause of death was not due to ingestion of ethylone.<ref name=jat/> |
|
|
|
|
|
==Pharmacokinetics== |
|
|
Analysis of human and rat urine for the metabolites of ] suggested that ethylone was degraded in the following metabolic steps:<ref>{{cite journal | vauthors = Meyer MR, Wilhelm J, Peters FT, Maurer HH | title = Beta-keto amphetamines: studies on the metabolism of the designer drug mephedrone and toxicological detection of mephedrone, butylone, and methylone in urine using gas chromatography-mass spectrometry | journal = Analytical and Bioanalytical Chemistry | volume = 397 | issue = 3 | pages = 1225–33 | date = June 2010 | pmid = 20333362 | doi = 10.1007/s00216-010-3636-5 | s2cid = 21471611 }}</ref> |
|
|
# N-] to the ]. |
|
|
# ] of the ] to the respective ]. |
|
|
|
|
|
==Legal Status== |
|
|
|
|
|
As of October 2015 Ethylone is a controlled substance in China.<ref>{{cite web | url=http://www.sfda.gov.cn/WS01/CL0056/130753.html | title=关于印发《非药用类麻醉药品和精神药品列管办法》的通知 | publisher=China Food and Drug Administration | date=27 September 2015 | language=Chinese | access-date=1 October 2015 | archive-date=1 October 2015 | archive-url=https://web.archive.org/web/20151001222554/http://www.sfda.gov.cn/WS01/CL0056/130753.html | url-status=dead }}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Unreferenced|date=September 2009}} |
|
|
{{Reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
== External links == |
|
== External links == |
|
* |
|
* |
|
|
* |
|
|
|
|
|
{{Entactogens}} |
|
{{Entactogens}} |
|
{{Hallucinogens}} |
|
{{Hallucinogens}} |
|
{{Stimulants}} |
|
{{Stimulants}} |
|
|
{{Monoamine releasing agents}} |
|
{{Adrenergics}} |
|
|
{{Dopaminergics}} |
|
|
{{Serotonergics}} |
|
|
{{Phenethylamines}} |
|
{{Phenethylamines}} |
|
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
|
|
|
|
|
|
{{hallucinogen-stub}} |
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
] |
|