| Revision as of 19:47, 6 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 12:48, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,111 edits removed Category:Phenol ethers; added Category:Methoxy compounds using HotCat |
| (34 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 426855502 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 448801023 |
|
| Name = Eugenin |
|
| Name = Eugenin |
|
| ImageFile = Eugenin.png |
|
| ImageFile = Eugenin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of eugenin |
|
| ImageName = Chemical structure of eugenin |
|
| ImageAlt = Chemical structure of eugenin |
|
| ImageAlt = Chemical structure of eugenin |
|
| IUPACName = 5-hydroxy-7-methoxy-2-methylchromen-4-one |
|
| PIN = 5-Hydroxy-7-methoxy-2-methyl-4''H''-1-benzopyran-4-one |
|
| OtherNames = 5-Hydroxy-7-methoxy-2-methylchrone<!-- <br> --> |
|
| OtherNames = 5-Hydroxy-7-methoxy-2-methylchromone |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 480-34-2 |
|
| CASNo = 480-34-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASNo_Ref = |
|
|
| CASOther = |
|
| UNII = E8D279U89S |
|
|
| CASNoOther = |
|
| PubChem =10189 |
|
| PubChem =10189 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| SMILES = CC1=CC(=O)C2=C(C=C(C=C2O1)OC)O |
|
|
| InChI = |
|
| ChemSpiderID = 9777 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 67374 |
|
⚫ |
| SMILES = O=C\1c2c(O/C(=C/1)C)cc(OC)cc2O |
|
|
| InChI = 1/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
|
|
| InChIKey = SUTUBQHKZRNZRA-UHFFFAOYAN |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SUTUBQHKZRNZRA-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=11 |
|
| Formula = C<sub>11</sub>H<sub>10</sub>O<sub>4</sub> |
|
|
|
| H=10 |
|
| MolarMass = 206.19 g/mol |
|
|
|
| O=4 |
|
| ExactMass = 206.057909 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Eugenin''' is a ] derivative, a ] compound found in ]s. It is also one of the compounds responsible for bitterness in ]s.<ref>{{cite journal | doi = 10.1021/jf034085+ | pmid = 12797757| year = 2003| last1 = Czepa| first1 = A| title = Structural and sensory characterization of compounds contributing to the bitter off-taste of carrots (Daucus carota L.) and carrot puree| journal = Journal of Agricultural and Food Chemistry| volume = 51| issue = 13| pages = 3865–73| last2 = Hofmann| first2 = T}}</ref> |
|
'''Eugenin''' is a ] derivative, a ] compound found in ]s. |
|
|
|
|
|
|
==Derivatives== |
|
== Derivatives == |
|
* ] can be isolated from the fungal species '']''<ref> |
|
* ] can be isolated from the fungal species '']''.<ref>{{cite journal | doi = 10.1007/BF01918708| pmid = 4579107| title = Isolation of 6-hydroxymethyl-eugenin from ''Chaetomium'' minutum| journal = Experientia| volume = 28| issue = 9| pages = 1114–5| year = 1972| last1 = Hauser| first1 = D.| last2 = Zardin| first2 = Therese| s2cid = 7551396| doi-access = free}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{phenol-stub}} |