| Revision as of 10:32, 12 May 2011 editLuckas-bot (talk | contribs)929,662 editsm r2.7.1) (robot Adding: pl:Europinidyna← Previous edit |
Latest revision as of 03:08, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,419,031 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated anthocyanidins | #UCB_Category 8/8 |
| (25 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400999165 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Europinidin (chloride) |
|
|
⚫ |
| verifiedrevid = 428730617 |
| ⚫ |
| ImageFile = Europinidin.svg |
|
|
⚫ |
| Name = Europinidin |
| ⚫ |
| ImageSize = 250px |
|
|
⚫ |
| ImageFile = Europinidin.svg |
|
| IUPACName = |
|
|
⚫ |
| ImageSize = 250px |
| ⚫ |
| OtherNames = 5,3′-di-O-methyldelphinidin |
|
|
|
| IUPACName = 3,3′,4′,7-Tetrahydroxy-5,5′-dimethoxyflavylium |
| ⚫ |
| Section1={{Chembox Identifiers |
|
|
|
| SystematicName = 2-(3,4-Dihydroxy-5-methoxyphenyl)-5-methoxy-3,7-dimethyl-1λ<sup>4</sup>-benzopyran-1-ylium |
| ⚫ |
| CASNo = 19077-87-3 |
|
|
⚫ |
| OtherNames = 5,3′-Di-''O''-methyldelphinidin |
| ⚫ |
| PubChem = |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| SMILES = |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 19077-87-3 |
|
⚫ |
| PubChem = 14496547 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 24842463 |
|
|
| SMILES = Oc1cc2c(OC)cc(O)cc2c1c3cc(OC)c(O)c(O)c3 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H14O7/c1-22-13-5-9(18)6-14-10(13)7-12(20)17(24-14)8-3-11(19)16(21)15(4-8)23-2/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XJXMPIWHBIOJSH-UHFFFAOYSA-O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>17</sub>H<sub>15</sub>O<sub>7</sub>+ (, Cl-) |
|
| Formula = C<sub>17</sub>H<sub>15</sub>O<sub>7</sub><sup>+</sup> (, Cl<sup>−</sup>) |
|
| MolarMass = 331,30 g/mol |
|
| MolarMass = 331.30 g/mol |
|
|
| Appearance = |
|
| ExactMass = 331,0817772 |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
| ⚫ |
'''Europinidin''' (Eu) is an ]. It is a water soluble, bluish red plant dye<ref></ref>. It is a rare O-methylated flavonoid, a derivative of ]. It can be found in species of '']'' and '']''<ref name="Harborne">. |
|
|
|
|
|
|
⚫ |
'''Europinidin''' (Eu) is an ]. It is a water-soluble, bluish red plant dye.<ref></ref> It is a rare O-methylated ], a derivative of ]. It can be found in some species of '']'' and '']''.<ref name="Harborne">{{cite journal | doi = 10.1016/S0031-9422(00)82884-8 | title = Comparative biochemistry of the flavonoids-IV | year = 1967 | last1 = Harborne | first1 = J.B. | journal = Phytochemistry | volume = 6 | issue = 10 | pages = 1415–1428 | bibcode = 1967PChem...6.1415H }}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
==External links== |
|
|
* |
|
|
* |
|
|
|
|
|
|
{{anthocyanins}} |
|
{{anthocyanins}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
] |
|
|
|
{{polyphenol-stub}} |