| Revision as of 09:23, 3 June 2011 editرائد 1991 (talk | contribs)139 editsNo edit summary← Previous edit |
Latest revision as of 14:02, 21 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Added bibcode. |
| (23 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{drugbox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414055854 |
|
| verifiedrevid = 432325202 |
| ⚫ |
| IUPAC_name = 1-(4,8-dimethoxyfuroquinolin-7-yl)oxy-3-methylbutane-2,3-diol |
|
|
| image = Evoxine.png |
|
| ImageFile = Evoxine.svg |
|
|
| ImageAlt = |
|
| width = 200 |
|
|
⚫ |
| IUPACName = (±)-1-(4,8-Dimethoxyfuroquinolin-7-yl)oxy-3-methylbutane-2,3-diol |
| ⚫ |
| CAS_number = 522-11-2 |
|
|
|
| OtherNames = Haploperine |
|
| ATC_prefix = none |
|
|
|
|Section1={{Chembox Identifiers |
|
| ATC_suffix = |
|
|
⚫ |
| CASNo = 522-11-2 |
|
| PubChem = 73416 |
|
| PubChem = 73416 |
|
| DrugBank = |
|
|
|
| ChEMBL = 1416006 |
|
| C=11|H=12|O=2 |
|
|
⚫ |
| SMILES = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O |
|
| molecular_weight = 347.362 g/mol |
|
|
|
| ChemSpiderID = 66130 |
| ⚫ |
| smiles = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O |
|
|
|
| InChI = 1/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3 |
|
| bioavailability = |
|
|
|
| InChIKey = FGANMDNHTVJAHL-UHFFFAOYAV |
|
| protein_bound = |
|
|
|
| StdInChI = 1S/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3 |
|
| metabolism = |
|
|
|
| StdInChIKey = FGANMDNHTVJAHL-UHFFFAOYSA-N}} |
|
| elimination_half-life = |
|
|
|
|Section2={{Chembox Properties |
|
| excretion = |
|
|
|
| C=18 | H=21 | N=1 | O=6 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| Appearance = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| Density = |
|
| pregnancy_category= |
|
|
|
| MeltingPt = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| BoilingPt = |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| Solubility = }} |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
|Section3={{Chembox Hazards |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
| MainHazards = |
|
| legal_status = Legal |
|
|
|
| FlashPt = |
|
| routes_of_administration = |
|
|
|
| AutoignitionPt = }} |
|
|
|Section5={{Chembox Pharmacology |
|
|
| ATCCode_prefix = none |
|
|
|
|
|
| AdminRoutes = |
|
|
| Bioavail = |
|
|
| Metabolism = |
|
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| Pregnancy_category = |
|
|
| Pregnancy_AU = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Evoxine''' ('''Haploperine''') is an ] with ] and ] effects. It is found naturally in a variety of Australian and African plants including '']''<ref>{{cite journal | doi = 10.1071/CH9540087 | last1 = Eastwood | first1 = FW | last2 = Hughes | first2 = GK | last3 = Ritchie | first3 = E. | year = 1954 | title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine | url = | journal = Australian Journal of Chemistry | volume = 7 | issue = 1| pages = 87–98 }}</ref> and '']''.<ref>{{cite journal | last1 = Waffo | first1 = AF | last2 = Coombes | first2 = PH | last3 = Crouch | first3 = NR | last4 = Mulholland | first4 = DA | last5 = El Amin | first5 = SM | last6 = Smith | first6 = PJ | title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. | journal = Phytochemistry | volume = 68 | issue = 5 | pages = 663–7 | year = 2007 | pmid = 17174364 | doi = 10.1016/j.phytochem.2006.10.011 }}</ref> |
|
'''Evoxine''' ('''haploperine''') is a ] with ] and ] effects. It is found naturally in a variety of Australian and African plants including '']''<ref>{{cite journal | doi = 10.1071/CH9540087 | last1 = Eastwood | first1 = FW | last2 = Hughes | first2 = GK | last3 = Ritchie | first3 = E. | year = 1954 | title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine | journal = Australian Journal of Chemistry | volume = 7 | issue = 1| pages = 87–98 }}</ref> and '']''.<ref>{{cite journal | last1 = Waffo | first1 = AF | last2 = Coombes | first2 = PH | last3 = Crouch | first3 = NR | last4 = Mulholland | first4 = DA | last5 = El Amin | first5 = SM | last6 = Smith | first6 = PJ | title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. | journal = Phytochemistry | volume = 68 | issue = 5 | pages = 663–7 | year = 2007 | pmid = 17174364 | doi = 10.1016/j.phytochem.2006.10.011 | bibcode = 2007PChem..68..663K }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 37: |
Line 55: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|