| Revision as of 04:13, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:W← Previous edit |
Latest revision as of 05:18, 1 January 2024 edit undoOAbot (talk | contribs)Bots440,440 editsm Open access bot: doi updated in citation with #oabot. |
| (17 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Watchedfields = changed |
| ⚫ |
| UNII = OC71PP0F89 |
|
|
| verifiedrevid = 442314529 |
|
| verifiedrevid = 444196226 |
|
|ImageFile=Exatecan.png |
|
| ImageFile = Exatecan.svg |
|
|ImageSize=200px |
|
| ImageSize = 225 |
|
|IUPACName= <small>(1S,9S)-1-Amino-9-ethyl-5-fluoro-1,2,3,9,12,15-hexahydro-9-hydroxy-4-methyl-10H,13H-benzo(de)pyrano(3',4':6,7)indolizino(1,2-b)quinoline-10,13-dione</small>|OtherNames= |
|
| PIN = (1''S'',9''S'')-1-Amino-9-ethyl-5-fluoro-9-hydroxy-4-methyl-1,2,3,9,12,15-hexahydro-10''H'',13''H''-benzopyranoindolizinoquinoline-10,13-dione |
|
|
| OtherNames = |
|
|Section1= {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| ChemSpiderID = 133194 |
|
|
⚫ |
| UNII = OC71PP0F89 |
| ⚫ |
| InChI = 1/C24H22FN3O4/c1-3-24(31)14-6-18-21-12(8-28(18)22(29)13(14)9-32-23(24)30)19-16(26)5-4-11-10(2)15(25)7-17(27-21)20(11)19/h6-7,16,31H,3-5,8-9,26H2,1-2H3/t16-,24-/m0/s1 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| InChIKey = ZVYVPGLRVWUPMP-FYSMJZIKBW |
|
|
⚫ |
| ChemSpiderID = 133194 |
| ⚫ |
| SMILES1 = Fc2c(c6c1c(c5c(nc1c2)C=3N(C(=O)\C4=C(/C=3)(O)(C(=O)OC4)CC)C5)(N)CC6)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1614650 |
| ⚫ |
| StdInChI = 1S/C24H22FN3O4/c1-3-24(31)14-6-18-21-12(8-28(18)22(29)13(14)9-32-23(24)30)19-16(26)5-4-11-10(2)15(25)7-17(27-21)20(11)19/h6-7,16,31H,3-5,8-9,26H2,1-2H3/t16-,24-/m0/s1 |
|
|
⚫ |
| InChI = 1/C24H22FN3O4/c1-3-24(31)14-6-18-21-12(8-28(18)22(29)13(14)9-32-23(24)30)19-16(26)5-4-11-10(2)15(25)7-17(27-21)20(11)19/h6-7,16,31H,3-5,8-9,26H2,1-2H3/t16-,24-/m0/s1 |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = ZVYVPGLRVWUPMP-FYSMJZIKSA-N |
|
| InChIKey = ZVYVPGLRVWUPMP-FYSMJZIKBW |
|
⚫ |
| SMILES1 = Fc2c(c6c1c(c5c(nc1c2)C=3N(C(=O)\C4=C(/C=3)(O)(C(=O)OC4)CC)C5)(N)CC6)C |
| ⚫ |
| CASNo=171335-80-1 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| PubChem=151115 |
|
|
⚫ |
| StdInChI = 1S/C24H22FN3O4/c1-3-24(31)14-6-18-21-12(8-28(18)22(29)13(14)9-32-23(24)30)19-16(26)5-4-11-10(2)15(25)7-17(27-21)20(11)19/h6-7,16,31H,3-5,8-9,26H2,1-2H3/t16-,24-/m0/s1 |
| ⚫ |
| SMILES=CCC1(C2=C(COC1=O)C(=O)N3CC4=C5C(CCC6=C5C(=CC(=C6C)F)N=C4C3=C2)N)O |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = ZVYVPGLRVWUPMP-FYSMJZIKSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 171335-80-1 |
|
⚫ |
| PubChem = 151115 |
|
⚫ |
| SMILES=CCC1(C2=C(COC1=O)C(=O)N3CC4=C5C(CCC6=C5C(=CC(=C6C)F)N=C4C3=C2)N)O |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=24 | H=22 | F=1 | N=3 | O=4 |
|
| Formula=C<sub>24</sub>H<sub>22</sub>FN<sub>3</sub>O<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=435.447583 |
|
|
| Appearance= |
|
| Density= |
|
⚫ |
| MeltingPt= |
|
| Density= |
|
|
⚫ |
| BoilingPt= |
| ⚫ |
| MeltingPt= |
|
|
⚫ |
| Solubility= |
| ⚫ |
| BoilingPt= |
|
| ⚫ |
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Exatecan''' is a drug which is a ] of ] with ] activity.<ref>{{cite journal|last1=Abou-Alfa|first1=GK|last2=Letourneau|first2=R|last3=Harker|first3=G|last4=Modiano|first4=M|last5=Hurwitz|first5=H|last6=Tchekmedyian|first6=NS|last7=Feit|first7=K|last8=Ackerman|first8=J|last9=De Jager|first9=RL|last10=Eckhardt|first10=SG|last11=O'Reilly|first11=EM|title=Randomized Phase III Study of Exatecan and Gemcitabine Compared with Gemcitabine Alone in Untreated Advanced Pancreatic Cancer|journal=Journal of Clinical Oncology|date=20 September 2006|volume=24|issue=27|pages=4441–7|doi=10.1200/JCO.2006.07.0201|pmid=16983112|doi-access=free}}</ref> |
|
'''Exatecan''' is a drug which is an analogue of ]. |
|
|
|
|
|
|
A derivative is used in ]. |
|
|
|
|
|
==Synthesis== |
|
==Synthesis== |
|
⚫ |
] |
|
] |
|
|
|
|
|
|
==References== |
|
==References== |
|
|
{{reflist}} |
| ⚫ |
H. Terasawa, A. Ejima, S. Ohsuki, K. Uoto, {{US Patent|5,834,476}} (1998). |
|
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{biochem-stub}} |
|
{{antineoplastic-drug-stub}} |