| Revision as of 01:27, 13 October 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validat...← Previous edit |
Latest revision as of 12:50, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
| (31 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Family of organic compounds found in buckwheat}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 426218737 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 455303239 |
|
| Name = Fagopyrin |
|
| Name = Fagopyrin |
|
| ImageFile = Fagopyrin.svg |
|
| ImageFile = Fagopyrin.svg |
|
⚫ |
| ImageAlt = Structural formula of fagopyrin |
|
| ImageSize = 200px |
|
|
|
| ImageFile1 = Fagopyrin 3D ball.png |
| ⚫ |
| ImageName = Chemical structure of fagopyrin |
|
|
|
| ImageAlt1 = Ball-and-stick model of the fagopyrin molecule |
|
| IUPACName = <nowiki>1,3,4,6,8,13-hexahydroxy-10,11-dimethyl-2,5-di(piperidin-2-yl)fenantroperyleen-7,14-dion</nowiki> |
|
| IUPACName = 1,3,4,6,8,13-Hexahydroxy-10,11-dimethyl-2,5-di(piperidin-2-yl)fenantroperyleen-7,14-dion |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 72393-03-4 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|changed|EPA}} |
|
| CASOther = |
|
| ChemSpiderID = 4589856 |
|
| PubChem = |
|
| PubChem = 5488537 |
|
| SMILES = O=C1C2=C(C3=C(O)C(C4CCCCN4)=C2O)C(C5=C6C(C)=CC(O)=C15)=C7C (C3=C(O)C(C8NCCCC8)=C9O)=C9C(C%10=C7C6=C(C)C=C%10O)=O |
|
| SMILES = O=C1C2=C(C3=C(O)C(C4CCCCN4)=C2O)C(C5=C6C(C)=CC(O)=C15)=C7C(C3=C(O)C(C8NCCCC8)=C9O)=C9C(C%10=C7C6=C(C)C=C%10O)=O |
|
|
| StdInChI=1S/C40H34N2O8/c1-13-11-17(43)23-25-19(13)20-14(2)12-18(44)24-26(20)28-27(25)29-31(35(45)21(15-7-3-5-9-41-15)37(47)33(29)39(23)49)32-30(28)34(40(24)50)38(48)22(36(32)46)16-8-4-6-10-42-16/h11-12,15-16,41-48H,3-10H2,1-2H3 |
|
| InChI = |
|
|
|
| StdInChIKey = ROFJUMITFMRBRF-UHFFFAOYSA-N |
|
| MeSHName = |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=40|H=34|N=2|O=8 |
|
| Formula = C<sub>40</sub>H<sub>34</sub>N<sub>2</sub>O<sub>8</sub> |
|
|
| MolarMass = 670,71 g/mol |
|
| Appearance = Red pigment |
|
| ExactMass = 670.231515 u |
|
|
| Appearance = red pigment |
|
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Fagopyrin''' is a naturally occurring substance in the ] plant.<ref>{{cite journal | doi = 10.1007/BF00645366 | title = Fagopyrin, ein photodynamischer Farbstoff aus Buchweizen (Fagopyrum esculentum) | year = 1950 | last1 = Brockmann | first1 = Hans | last2 = Weber | first2 = Erhard | last3 = Sander | first3 = Elsbeth | journal = Die Naturwissenschaften | volume = 37 | pages = 43 | issue = 2 }}</ref> |
|
'''Fagopyrin''' is a term used for several closely related naturally occurring substances in the ] plant.<ref>{{cite journal | doi = 10.1007/BF00645366 | title = Fagopyrin, ein photodynamischer Farbstoff aus Buchweizen (Fagopyrum esculentum) | year = 1950 | last1 = Brockmann | first1 = Hans | last2 = Weber | first2 = Erhard | last3 = Sander | first3 = Elsbeth | journal = Die Naturwissenschaften | volume = 37 | pages = 43 | issue = 2 | bibcode=1950NW.....37...43B| s2cid = 29975083 }}</ref> |
|
|
Their chemical structure contains a ] skeleton similar to that of ].<ref>{{cite journal | last1 = Tavčar Benković | first1 = Eva | last2 = Žigon | first2 = Dušan | last3 = Friedrich | first3 = Miha | last4 = Plavec | first4 = Janez | last5 = Kreft | first5 = Samo | year = 2014| title = Isolation, analysis and structures of phototoxic fagopyrins from buckwheat | journal = Food Chemistry | volume = 143 | pages = 432–439 | doi = 10.1016/j.foodchem.2013.07.118 | pmid = 24054263 }}</ref> |
|
Its chemical structure contains a ] skeleton similar that of to ].{{Citation needed|date=February 2010}} |
|
|
|
|
|
|
Fagopyrin is located almost exclusively in the ]s of the buckwheat herb. When ingested, fagopyrins cause ].<ref>{{cite journal |last1=Kreft |first1=S. |last2=Janeš |first2=D. |last3=Kreft |first3=I. |date=2013 |title=The content of fagopyrin and polyphenols in common and tartary buckwheat sprouts |journal=Acta Pharmaceutica |volume=63 |issue=4 |pages=553–60 |doi=10.2478/acph-2013-0031 |pmid=24451079 |doi-access=free }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 35: |
Line 39: |
|
|
|
|
|
==External links== |
|
==External links== |
|
* |
|
* |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
{{aromatic-stub}} |
|
] |
|