Revision as of 13:52, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470707393 of page Fast_Green_FCF for the Chem/Drugbox validation project (updated: 'KEGG'). |
Latest revision as of 20:55, 18 October 2024 edit Citation bot (talk | contribs)Bots5,424,121 edits Add: publisher, authors 1-1. | Use this bot. Report bugs. | Suggested by Spinixster | Category:Chemicals using indexlabels | #UCB_Category 557/831 |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 402117468 |
|
| verifiedrevid = 477004138 |
|
|ImageFile=Fast Green FCF.png |
|
| ImageFile=Fast Green FCF.svg |
|
|ImageSize=250px |
|
| ImageSize=250px |
|
|
| ImageFile1=Fast Green FCF ball-and-stick.png |
⚫ |
|IUPACName= <small>ethyl - amino] phenyl] - (4 - hydroxy - 2 - sulfophenyl) methylidene] - 1 - cyclohexa - 2, 5 - dienylidene] - azanium</small> |
|
|
|
| ImageSize1=250px |
|
|OtherNames=Food green 3, <br />FD&C Green No. 3, <br />Green 1724, <br />Solid Green FCF, and <br />C.I. 42053 |
|
|
|
| ImageFile2=Fast_Green_FCF_ball-and-stick_animation.gif |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageSize2=250px |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| IUPACName= ethyl-amino]phenyl]-(4-hydroxy-2-sulfophenyl)methylidene]-1-cyclohexa-2,5-dienylidene]-azanium |
|
|
| OtherNames={{Unbulleted list |
|
|
| Food green 3 |
|
|
| FD&C Green No. 3 |
|
|
| Green 1724 |
|
|
| Solid Green FCF |
|
|
| C.I. 42053 |
|
|
}} |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| index1_label = acid |
|
|
| ChEMBL = 3188843 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16002 |
|
| ChemSpiderID = 16002 |
|
|
| EINECS = 219-091-5 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 3P3ONR6O1S |
|
| UNII = 9J3VQ0Y6BV |
|
| InChI = 1/C37H36N2O10S3.2Na/c1-3-38(24-26-7-5-9-33(21-26)50(41,42)43)30-15-11-28(12-16-30)37(35-20-19-32(40)23-36(35)52(47,48)49)29-13-17-31(18-14-29)39(4-2)25-27-8-6-10-34(22-27)51(44,45)46;;/h5-23H,3-4,24-25H2,1-2H3,(H3,41,42,43,44,45,46,47,48,49);;/q;2*+1/p-2 |
|
| InChI = 1/C37H36N2O10S3.2Na/c1-3-38(24-26-7-5-9-33(21-26)50(41,42)43)30-15-11-28(12-16-30)37(35-20-19-32(40)23-36(35)52(47,48)49)29-13-17-31(18-14-29)39(4-2)25-27-8-6-10-34(22-27)51(44,45)46;;/h5-23H,3-4,24-25H2,1-2H3,(H3,41,42,43,44,45,46,47,48,49);;/q;2*+1/p-2 |
|
| InChIKey = RZSYLLSAWYUBPE-NUQVWONBAL |
|
| InChIKey = RZSYLLSAWYUBPE-NUQVWONBAL |
Line 19: |
Line 31: |
|
| StdInChIKey = RZSYLLSAWYUBPE-UHFFFAOYSA-L |
|
| StdInChIKey = RZSYLLSAWYUBPE-UHFFFAOYSA-L |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=2353-45-9 |
|
| CASNo= 2353-45-9 |
|
| PubChem=16888 |
|
| PubChem = 16887 |
|
|
| PubChem1=16888 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: C19423 --> |
|
| KEGG = C19423 |
|
| SMILES = ..S(=O)(=O)c1cccc(c1)CN(c2ccc(cc2)\C(=C\4/C=C\C(=(\CC)Cc3cccc(c3)S()(=O)=O)/C=C/4)c5ccc(O)cc5S()(=O)=O)CC |
|
| SMILES = CCN(CC1=CC(=CC=C1)S(=O)(=O))C2=CC=C(C=C2)C(=C3C=CC(=(CC)CC4=CC(=CC=C4)S(=O)(=O))C=C3)C5=C(C=C(C=C5)O)S(=O)(=O).. |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=37|H=34|N=2|O=10|S=3|Na=2 |
|
| Formula=C<sub>37</sub>H<sub>37</sub>N<sub>2</sub>O<sub>10</sub>S<sub>3</sub><small>+</small> |
|
|
|
| Appearance= |
|
| MolarMass=765.89 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
|
| NFPA-H = 2 |
⚫ |
| MainHazards= |
|
|
| FlashPt= |
|
| NFPA-F = 1 |
|
|
| NFPA-R = 0 |
|
| Autoignition= |
|
|
⚫ |
| MainHazards= |
|
| RPhrases={{R36}} {{R37}} {{R38}} |
|
|
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
|
| Hazards_ref=<ref>{{cite web |title=Summary of Classification and Labelling |url=https://echa.europa.eu/information-on-chemicals/cl-inventory-database/-/discli/details/4904 |access-date=4 December 2021}}</ref> |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|201|202|261|264|271|280|281|302+352|304+340|305+351+338|308+313|312|321|332+313|337+313|362|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Fast Green FCF''', also called '''Food green 3''', '''FD&C Green No. 3''', '''Green 1724''', '''Solid Green FCF''', and '''] 42053''', is a ] triarylmethane ]. Its ] is E143. |
|
|
|
|
|
Fast Green FCF is recommended as a replacement of ] in ], as its color is more brilliant and less likely to fade. It is used as a quantitative ] for ]s at alkaline pH after acid extraction of ]. It is also used as a protein stain in ]. Its absorption maximum is at 625 nm. |
|
|
|
|
|
Fast Green FCF is poorly absorbed by the intestines.<ref name="IPCS">{{cite web |title= Fast Green FCF |publisher= IPCS INchem |url= http://www.inchem.org/documents/jecfa/jecmono/v16je12.htm |access-date= 2007-10-18 |archive-url= https://web.archive.org/web/20140701082939/http://inchem.org/documents/jecfa/jecmono/v16je12.htm |archive-date= 2014-07-01 |url-status= dead }}</ref> Its use as a food dye is prohibited in the ] and some other countries. In the United States, Fast Green FCF is the least used of the seven main FDA approved dyes. |
|
|
|
|
|
==Toxicology== |
|
|
A reevaluation of Fast Green FCF published by the World Health Organization in 2017 concluded that it has low toxicity and is not carcinogenic or genotoxic, and that there were no health concerns with consumption of Fast Green FCF at the previously established allowable daily intake (which itself is much higher than estimates of actual dietary exposure to Fast Green FCF).<ref name="WHO">{{cite book |title=Evaluation of certain food additives: eighty-fourth report of the Joint FAO/WHO Expert Committee on Food Additives |pages=36–41 |date=2017 |isbn=9789241210164 |url=http://apps.who.int/iris/bitstream/handle/10665/259483/9789241210164-eng.pdf#page36 |access-date=2 September 2021 |last1=Organization |first1=World Health |publisher=World Health Organization }}</ref> |
|
|
|
|
|
==Notes== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |