| Revision as of 16:15, 31 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipe← Previous edit |
Latest revision as of 13:43, 19 March 2024 edit undoTautropfli (talk | contribs)149 editsm Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.Tag: 2017 wikitext editor |
| (20 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced|auto=yes|date=December 2009}} |
|
{{Refimprove|date=December 2009}} |
|
{{Chembox |
|
{{Chembox |
|
⚫ |
| verifiedrevid = 431847509 |
|
| Watchedfields = changed |
|
|
⚫ |
| ImageFile = Fast yellow AB.svg |
| ⚫ |
| verifiedrevid = 414584258 |
|
|
⚫ |
| ImageSize = 240 |
| ⚫ |
| ImageFile = Fast Yellow AB.png |
|
|
|
| ImageAlt = Skeletal formula of Fast Yellow AB |
| ⚫ |
| ImageSize = |
|
|
|
| ImageFile1 = Fast Yellow AB 3D ball.png |
|
|
| ImageSize1 = 240 |
|
|
| ImageAlt1 = Ball-and-stick model of the Fast Yellow AB molecule |
|
| IUPACName = 2-amino-5-benzenesulfonic acid |
|
| IUPACName = 2-amino-5-benzenesulfonic acid |
|
| OtherNames = Fast Yellow <br /> Acid Yellow<br /> Food Yellow 2 <br/> C.I. 13015 |
|
| OtherNames = {{Unbulleted list|Fast Yellow|Acid Yellow|Food Yellow 2|C.I. 13015}} |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 2706-28-7 |
|
|
| PubChem = |
|
| CASNo = 101-50-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = Nc1ccc(cc1OS(O)=O)/N=N/c2ccc(OS(O)=O)cc2 |
|
|
|
| UNII = 2ZQE5CCH2H |
|
|
| EC_number = 202-947-7 |
|
|
| ChEBI = 86124 |
|
|
| ChEMBL = 2172377 |
|
|
| PubChem = 60996 |
|
|
| PubChem1 = 75918 |
|
|
| PubChem1_Comment = Na salt |
|
|
| ChemSpiderID = 54957 |
|
|
| StdInChI=1S/C12H11N3O6S2/c13-11-6-3-9(7-12(11)23(19,20)21)15-14-8-1-4-10(5-2-8)22(16,17)18/h1-7H,13H2,(H,16,17,18)(H,19,20,21) |
|
|
| StdInChIKey = DCYBHNIOTZBCFS-UHFFFAOYSA-N |
|
⚫ |
| SMILES = Nc1ccc(cc1OS(O)=O)/N=N/c2ccc(OS(O)=O)cc2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12|H=11|N=3|O=6|S=2 |
|
| Formula = C<sub>12</sub>H<sub>11</sub>N<sub>3</sub>O<sub>6</sub>S<sub>2</sub> |
|
|
| MolarMass = 357.36 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Fast Yellow AB''' is an ] denoted by ] '''E105'''. It was used as a ]. It is now delisted in both Europe and USA and is forbidden if used in foods and drinks, as toxicological data has shown it is harmful. E105 has been implicated in non-atopic asthma.{{Citation needed|date=April 2010}} |
|
'''Fast Yellow AB''' is an ]. It used to be used as a ], designated in Europe by the ] '''E105'''. It is now delisted in both Europe and USA and is forbidden if used in foods and drinks, as toxicological data has shown it is harmful. E105 has been implicated in non-atopic asthma.<ref> pdf</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Fast Yellow Ab}} |
|
{{DEFAULTSORT:Fast Yellow Ab}} |
| Line 35: |
Line 55: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{Organic-compound-stub}} |
|
{{Organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|