| Revision as of 06:06, 16 February 2011 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Benzoic acids using HotCat← Previous edit |
Latest revision as of 20:55, 20 May 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name |
| (45 intermediate revisions by 33 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Fenamic acid.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 414204436 |
|
|IUPACName=2-(phenylamino)benzoic acid |
|
|
⚫ |
| ImageFile=Fenamic acid.png |
| ⚫ |
|OtherNames=N-phenylanthranilic acid |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1=Fenamic acid 3D ball.png |
| ⚫ |
| CASNo=91-40-7 |
|
|
|
| ImageAlt1=Ball-and-stick model of fenamic acid |
| ⚫ |
| PubChem=4386 |
|
|
|
| PIN=2-Anilinobenzoic acid |
| ⚫ |
| SMILES=C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O |
|
|
⚫ |
| OtherNames=N-phenylanthranilic acid |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4182 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=91-40-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 952VN06WBB |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 34756 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 23832 |
|
⚫ |
| SMILES=C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O |
|
⚫ |
| PubChem = 4386 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4233 |
|
|
| InChI = 1/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16) |
|
|
| InChIKey = ZWJINEZUASEZBH-UHFFFAOYAQ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZWJINEZUASEZBH-UHFFFAOYSA-N |
|
|
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>13</sub>H<sub>11</sub>NO<sub>2</sub> |
|
| Formula=C<sub>13</sub>H<sub>11</sub>NO<sub>2</sub> |
|
| MolarMass=213.23 g/mol |
|
| MolarMass=213.23 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Fenamic acid''' is an ], which, especially in its ester form, is called '''fenamate'''.<ref>Gupta, PK. Drug NomenclatureUnited States Adopted Names. Ch 27 in Remington: The Science and Practice of Pharmacy, Vol 1. Eds. David B. Troy, Paul Beringer. Lippincott Williams & Wilkins, 2006 {{ISBN|9780781746731}}</ref>{{rp|458}} serves as a parent structure for several ]s (NSAIDs), including ], ], ], and ]. These drugs are commonly referred to as "anthranilic acid derivatives" or "fenamates" because fenamic acid is a derivative of ].<ref name=Sriram>Sriram D, Yogeeswari P. . Pearson Education India, 2010. {{ISBN|9788131731444}}</ref>{{rp|235}}<ref>Auburn University course material. Jack DeRuiter, Principles of Drug Action 2, Fall 2002 1: </ref>{{rp|17}}<ref name=Sriram/> |
|
'''Fenamic acid''' is a molecule which serves as a parent structure for several ]s, including ], ], ], and ]. |
|
|
|
|
|
|
This compound may be synthesized by the reaction of ] and ], with base and ] catalyst in the ].<ref name = allen/> |
|
Fenamic acid can be synthesized from ] and can be converted into ].<ref>{{cite journal| title = Acridone | author = C. F. H. Allen, G. H. W. McKee | journal = Organic Syntheses | volume = 2 | pages = 6| doi= 10.15227/orgsyn.019.0006| year = 1939}}</ref> |
|
|
|
|
:] |
|
|
|
|
|
The self-condensation of fenamic acid yields ].<ref name = allen>{{OrgSynth | title = Acridone | author = C. F. H. Allen and G. H. W. McKee | collvol = 2 | collvolpages = 15 | prep = cv2p0015 | year = 1943}}</ref> |
|
|
|
|
|
|
==References== |
|
==References== |
|
|
{{Reflist|2}} |
|
<references/> |
|
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{Prostanoidergics}} |
|
{{NSAIDs}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|
|
] |
|