| Revision as of 15:41, 31 July 2011 editLilHelpa (talk | contribs)Extended confirmed users, Pending changes reviewers413,676 editsm Typo fixing, replaced: Refernce → Reference using AWB← Previous edit |
Latest revision as of 10:39, 23 December 2024 edit undoGraeme Bartlett (talk | contribs)Administrators250,106 edits chemspider |
| (22 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 441178083 |
|
| verifiedrevid = 442366566 |
|
| Name = Flavogallonic acid dilactone |
|
| Name = Flavogallonic acid dilactone |
|
| ImageFile = Flavogallonic acid dilactone.png |
|
| ImageFile = Flavogallonic acid dilactone.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of flavogallonic acid dilactone |
|
| ImageName = Chemical structure of flavogallonic acid dilactone |
|
| ImageAlt = Chemical structure of flavogallonic acid dilactone |
|
| ImageAlt = Chemical structure of flavogallonic acid dilactone |
|
|
| PIN = 3,4,5-Trihydroxy-2-(1,6,7-trihydroxy-4,9-dioxo-4,9-dihydrobenzopyranobenzopyran-2-yl)benzoic acid |
|
| IUPACName = |
|
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 103744-88-3 |
|
| CASNo = 103744-88-3 |
|
|
| ChemSpiderID = 57539155 |
|
| CASNo_Ref = |
|
|
| CASOther = |
|
| PubChem = 71308199 |
|
|
| StdInChI=1S/C21H10O12/c22-8-2-5(19(28)29)10(16(27)14(8)25)4-1-6-11-12-7(21(31)32-17(11)13(4)24)3-9(23)15(26)18(12)33-20(6)30/h1-3,22-27H,(H,28,29) |
|
| PubChem = |
|
|
|
| StdInChIKey = ICEBGCDIMFYRLU-UHFFFAOYSA-N |
|
| SMILES = O=c4oc3c1c(c(c2O)oc(=O)c1cc(O)c3O)c4cc2-c(c(O)c5O)c(C(O)=O)cc5O |
|
| SMILES = O=c4oc3c1c(c(c2O)oc(=O)c1cc(O)c3O)c4cc2-c(c(O)c5O)c(C(O)=O)cc5O |
|
|
|
|
| InChI = |
|
|
| MeSHName = |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>10</sub>O<sub>12</sub> |
|
| Formula = C<sub>21</sub>H<sub>10</sub>O<sub>12</sub> |
|
| MolarMass = 454.29 g/mol |
|
| MolarMass = 454.29 g/mol |
|
| ExactMass = 454.017225 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
| GHS_ref=<!-- no GHS data in PubChem Dec2021 --> |
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Flavogallonic acid dilactone''' is a ] that can be found in '']'' seeds,<ref>Antiproliferative constituents in the plant 8. Seeds of Rhynchosia volubilis. Kinjo Junei, Nagao Tsuneatsu, Tanaka Takashi, Nonaka Gen-Ichiro and Okabe Hikaru, Biological & pharmaceutical bulletin, 2001, vol. 24, no12, pp. 1443-1445, {{INIST|13400364}}, {{doi|10.1248/bpb.24.1443}}</ref> in '']'',<ref>5A-Reductase inhibitory tannin-related compounds isolated from Shorea laeviforia. Yoshio Hirano, Ryuichiro Kondo and Kokki Sakai, Journal of wood science, Volume 49, Number 4, pp. 339-343, {{doi|10.1007/s10086-002-0481-y}}</ref> in '']'' and '']''.<ref>The use of microfluorometric method for activity-guided isolation of antiplasmodial compound from plant extracts. M. N. Shuaibu, P. A. Wuyep, T. Yanagi, K. Hirayama, T. Tanaka and I. Kouno, Parasitol Res (2008) 102, pp. 1119–1127, {{doi|10.1007/s00436-008-0879-6}}</ref> |
|
'''Flavogallonic acid dilactone''' is a ] that can be found in '']'' seeds,<ref>Antiproliferative constituents in the plant 8. Seeds of Rhynchosia volubilis. Kinjo Junei, Nagao Tsuneatsu, Tanaka Takashi, Nonaka Gen-Ichiro and Okabe Hikaru, Biological & pharmaceutical bulletin, 2001, vol. 24, no12, pp. 1443-1445, {{INIST|13400364}}, {{doi|10.1248/bpb.24.1443}}</ref> in '']'',<ref>5A-Reductase inhibitory tannin-related compounds isolated from Shorea laevifolia. Yoshio Hirano, Ryuichiro Kondo and Kokki Sakai, Journal of wood science, Volume 49, Number 4, pp. 339-343, {{doi|10.1007/s10086-002-0481-y}}</ref> in '']'' and '']''.<ref>The use of microfluorometric method for activity-guided isolation of antiplasmodial compound from plant extracts. M. N. Shuaibu, P. A. Wuyep, T. Yanagi, K. Hirayama, T. Tanaka and I. Kouno, Parasitol Res (2008) 102, pp. 1119–1127, {{doi|10.1007/s00436-008-0879-6}}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
| Line 46: |
Line 46: |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |