| Revision as of 12:18, 30 April 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm chalconoids← Previous edit |
Latest revision as of 10:46, 23 December 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,686 edits more ids |
| (25 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 374863002 |
|
| verifiedrevid = 426713965 |
|
| ImageFile = Flavokavain B.png |
|
| ImageFile = Flavokavain B.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| PIN = 2′-Hydroxy-4′,6′-dimethoxychalcone |
|
| IUPACName = (''E'')-1-(2-Hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-propenone |
|
|
| OtherNames = 2'-hydroxy-4',6'-dimethoxychalcone<br>Flavokawain B |
|
| OtherNames = Flavokawain B |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 1775-97-9 |
|
| CASNo = 1775-97-9 |
|
|
| ChEBI = 65899 |
|
|
| ChEMBL = 104255 |
|
|
| ChemSpiderID = 4511912 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = R9WC6SM4UQ |
|
| PubChem = 5356121 |
|
| PubChem = 5356121 |
|
| Beilstein = 2059845 |
|
| Beilstein = 2059845 |
|
|
| StdInChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+ |
|
|
| StdInChIKey = QKQLSQLKXBHUSO-CMDGGOBGSA-N |
|
| SMILES = O=C(C2=C(O)C=C(OC)C=C2OC)/C=C/C1=CC=CC=C1 |
|
| SMILES = O=C(C2=C(O)C=C(OC)C=C2OC)/C=C/C1=CC=CC=C1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C= 17| H= 16| O=4 |
|
| C=17 | H=16 | O=4 |
|
| ExactMass = 284.104859 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 20: |
Line 27: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Flavokavain B''' is a ] found in the ] plant.<ref name='Dharmaratne 2002-01-30'> {{cite journal|title=Kavalactones from Piper methysticum, and their 13C NMR spectroscopic analyses.|journal=Phytochemistry|date=2002 February|first=H. Ranjith W.|last=Dharmaratne|coauthors=N. P. Dhammika Nanayakkara, Ikhlas A. Khan|pmid=11830162|volume=59|issue=4|pages=429|doi=10.1016/S0031-9422(01)00443-5|url=|format=|accessdate=2009-09-04 }}</ref> |
|
'''Flavokavain B''' is a ] found in the ] plant.<ref name='Dharmaratne 2002-01-30'>{{cite journal|title=Kavalactones from Piper methysticum, and their 13C NMR spectroscopic analyses|journal=Phytochemistry|date=February 2002|first=H. Ranjith W.|last=Dharmaratne|author2=N. P. Dhammika Nanayakkara |author3=Ikhlas A. Khan |pmid=11830162|volume=59|issue=4|pages=429–33|doi=10.1016/S0031-9422(01)00443-5}}</ref> In 2010 a paper was published identifying it as a glutathione-depleting ].<ref>Zhou P., Gross S., Liu J.-H., Yu B.-Y., Feng L.-L., Nolta J., Sharma V., Piwnica-Worms D., Qiu S.X 'Flavokawain B, the hepatotoxic constituent from kava root, induces GSH-sensitive oxidative stress through modulation of IKK/NF-κB and MAPK signaling pathways . FASEB Journal 2010 24:12 (4722-4732)</ref> |
|
|
|
|
|
FKB is said by enthusiasts to occur at higher concentrations in "tudei" kava strains, which are generally considered less desirable. |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 35: |
Line 44: |
|
|
|
|
|
==External links== |
|
==External links== |
|
* at the '']'' |
|
* at the '']'' |
|
|
|
|
|
{{Kava}} |
|
{{Kava}} |
|
{{chalconoid}} |
|
{{chalconoid}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{Aromatic-stub}} |