| Revision as of 12:18, 30 April 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm chalconoids← Previous edit |
Latest revision as of 21:31, 20 May 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name |
| (16 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 412888459 |
|
| verifiedrevid = 426713919 |
|
| ImageFile = Flavokavain C.png |
|
| ImageFile = Flavokavain C.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| PIN = 2′-Hydroxy-4,4′,6′-trimethoxychalcone |
|
| IUPACName = (E)-1-(2-Hydroxy-4,6-dimethoxy-phenyl)-3-(4-hydroxy-phenyl)-propenone |
|
|
| OtherNames = 2'-hydroxy-4,4',6'-trimethoxychalcone<br>Flavokawain C |
|
| OtherNames = Flavokawain C |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 37308-75-1 |
|
| CASNo = 37308-75-1 |
|
| PubChem = 6293081 |
|
| PubChem = 6293081 |
|
|
| ChEBI = 157718 |
|
| Beilstein=2059845 |
|
| Beilstein=2059845 |
|
| SMILES = O=C(C2=C(O)C=C(OC)C=C2OC)/C=C/C1=CC=C(O)C=C1 |
|
| SMILES = O=C(C2=C(O)C=C(OC)C=C2OC)/C=C/C1=CC=C(O)C=C1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C= 17| H= 16| O=5 |
|
| C=17 | H=16 | O=5 |
|
| ExactMass = 300.099774 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 20: |
Line 21: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Flavokavain C''' is a ] found in the ] plant.<ref name='Dharmaratne 2002-01-30'> {{cite journal|title=Kavalactones from Piper methysticum, and their 13C NMR spectroscopic analyses.|journal=Phytochemistry|date=2002 February|first=H. Ranjith W.|last=Dharmaratne|coauthors=N. P. Dhammika Nanayakkara, Ikhlas A. Khan|volume=59|issue=4|pages=429|pmid=11830162 |url=|format=|accessdate=2009-09-04|doi=10.1016/S0031-9422(01)00443-5 }}</ref> |
|
'''Flavokavain C''' is a ] found in the ] plant.<ref name='Dharmaratne 2002-01-30'>{{cite journal|title=Kavalactones from Piper methysticum, and their 13C NMR spectroscopic analyses|journal=Phytochemistry|date=February 2002|first=H. Ranjith W.|last=Dharmaratne|author2=N. P. Dhammika Nanayakkara |author3=Ikhlas A. Khan |volume=59|issue=4|pages=429–33|pmid=11830162 |doi=10.1016/S0031-9422(01)00443-5 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 37: |
Line 38: |
|
{{chalconoid}} |
|
{{chalconoid}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{Aromatic-stub}} |