| Revision as of 19:46, 22 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:52, 12 March 2024 edit undoTautropfli (talk | contribs)149 editsm Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.Tag: 2017 wikitext editor |
| (21 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 403259233 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref>'']'', 11th Edition, '''4032'''.</ref> |
|
|
⚫ |
| verifiedrevid = 420197997 |
| ⚫ |
|ImageFile=Flavoxanthin.png |
|
|
⚫ |
| Reference =<ref>'']'', 11th Edition, '''4032'''.</ref> |
| ⚫ |
|ImageSize=350px |
|
|
⚫ |
| ImageFile =Flavoxanthin.png |
| ⚫ |
|IUPACName= <small>(2''R'',6''S'',7a''R'')-2-<br/>-1,5,10,14-<br/>tetramethylhexadeca-<br/>1,3,5,7,9,11,13,15-<br/>octaenyl]-4,4,7a-trimethyl-2,5,6,7-<br/>tetrahydrobenzofuran-6-ol</small> |
|
|
⚫ |
| ImageSize =320px |
|
|OtherNames=•5,8-Epoxy-5,8-dihydro-γ<br/>-carotene-3,3'-diol<br>•''all''-''trans''-Flavoxanthin<br>•E161a |
|
|
|
| ImageAlt = Skeletal formula of flavoxanthin |
|
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1 = Flavoxanthin 3D spacefill.png |
| ⚫ |
| CASNo=512-29-8 |
|
|
|
| ImageSize1 = 320 |
| ⚫ |
| PubChem=5281238 |
|
|
|
| ImageAlt1 = Space-filling model of the flavoxanthin molecule |
| ⚫ |
| SMILES=CC1=C(CC(<br>1\C=C\C(=C\C=C\C<br/>(=C\C=C\C=C(/C)\C=<br/>C\C=C(/C)\2C=C3C<br/>(C(C3(O2)C)O)<br/>(C)C)\C)\C)(C)C)O |
|
|
|
| IUPACName = (3''R'',5''R'',8''R'',3′''R'',6′''R'')-5,8-Epoxy-5,8-dihydro-β,ε-carotene-3,3′-diol |
|
⚫ |
| SystematicName = (2''R'',6''S'',7a''R'')-2-{(2''E'',4''E'',6''E'',8''E'',10''E'',12''E'',14''E'',16''E'')-17--6,11,15-trimethylheptadeca-2,4,6,8,10,12,14,16-octaen-2-yl}-4,4,7a-trimethyl-2,4,5,6,7,7a-hexahydro-1-benzofuran-6-ol |
|
|
| OtherNames ={{Unbulleted list |
|
|
| 5,8-Epoxy-5,8-dihydro-γ-carotene-3,3'-diol |
|
|
| ''all''-''trans''-Flavoxanthin |
|
⚫ |
| E161a |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| Formula=C<sub>40</sub>H<sub>56</sub>O<sub>3</sub> |
|
|
⚫ |
| CASNo =512-29-8 |
| ⚫ |
| MolarMass=584.87 g/mol |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| Appearance=Yellow solid |
|
|
|
| UNII = S1D2WO17XX |
|
| Density= |
|
|
⚫ |
| PubChem =5281238 |
|
| MeltingPt=184 °C |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| BoilingPt= |
|
|
|
| ChemSpiderID = 4444650 |
|
| Solubility= |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 5087 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C08594 |
|
⚫ |
| SMILES = CC1=C(CC(1\C=C\C(=C\C=C\C(=C\C=C\C=C(/C)\C=C\C=C(/C)\2C=C3C(C(C3(O2)C)O)(C)C)\C)\C)(C)C)O |
|
|
| InChI = 1/C40H56O3/c1-28(17-13-18-30(3)21-22-35-32(5)23-33(41)25-38(35,6)7)15-11-12-16-29(2)19-14-20-31(4)36-24-37-39(8,9)26-34(42)27-40(37,10)43-36/h11-24,33-36,41-42H,25-27H2,1-10H3/b12-11+,17-13+,19-14+,22-21+,28-15+,29-16+,30-18+,31-20+/t33-,34-,35-,36+,40+/m0/s1 |
|
|
| InChIKey = JRHJXXLCNATYLS-NGZWBNMCBG |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C40H56O3/c1-28(17-13-18-30(3)21-22-35-32(5)23-33(41)25-38(35,6)7)15-11-12-16-29(2)19-14-20-31(4)36-24-37-39(8,9)26-34(42)27-40(37,10)43-36/h11-24,33-36,41-42H,25-27H2,1-10H3/b12-11+,17-13+,19-14+,22-21+,28-15+,29-16+,30-18+,31-20+/t33-,34-,35-,36+,40+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JRHJXXLCNATYLS-NGZWBNMCSA-N |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section2={{Chembox Properties |
|
⚫ |
| Formula =C<sub>40</sub>H<sub>56</sub>O<sub>3</sub> |
|
| MainHazards= |
|
|
⚫ |
| MolarMass =584.87 g/mol |
|
| FlashPt= |
|
|
⚫ |
| Appearance =Yellow solid |
|
| Autoignition= |
|
|
|
| Density = |
|
|
| MeltingPtC = 184 |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Flavoxanthin''' is a natural ] ] with a golden-yellow color found in small quantities in a variety of plants. As a ] it used under the ] E161a as a ]. |
|
'''Flavoxanthin''' is a natural ] ] with a golden-yellow color found in small quantities in a variety of plants. As a ] it used under the ] E161a as a ] although it is not approved for use in the EU<ref>UK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |access-date=2011-10-27}}</ref> or USA.{{citation needed|date=October 2011}} It is listed as ] 161a in Australia and New Zealand where it is approved for usage as an ingredient in food products.<ref>Australia New Zealand Food Standards Code{{cite web |url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |access-date=2011-10-27}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Carotenoids}} |
|
|
|
|
|
] |
|
] |
| Line 36: |
Line 64: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
| ⚫ |
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|