| Revision as of 17:24, 12 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 04:02, 8 September 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,518 edits consistent citation formatting |
| (36 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 407191096 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (6''R'',7''R'')-7-<nowiki>amino]-3-<nowiki> sulfanylmethyl]- |
|
|
⚫ |
| verifiedrevid = 413515463 |
|
7-methoxy-8-oxo-5-oxa-1-azabicyclooct-2-ene-2-carboxylic acid |
|
|
⚫ |
| IUPAC_name = (6''R'',7''R'')-7-<nowiki>amino]-3-<nowiki>sulfanylmethyl]-7-methoxy-8-oxo-5-oxa-1-azabicyclooct-2-ene-2-carboxylic acid |
|
| image = Flomoxef.png |
|
| image = Flomoxef.png |
| ⚫ |
| CAS_number = 99665-00-6 |
|
|
|
|
| ⚫ |
| CAS_supplemental = |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
| tradename = Flumarin |
|
|
| Drugs.com = {{drugs.com|international|flomoxef}} |
| ⚫ |
| ATC_supplemental = |
|
|
| PubChem = 65864 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| DrugBank = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 99665-00-6 |
|
⚫ |
| CAS_supplemental = |
|
⚫ |
| ATC_prefix = J01 |
|
|
| ATC_suffix = DC14 |
|
⚫ |
| ATC_supplemental = |
|
|
| PubChem = 65864 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = V9E5U5XF42 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07963 |
|
| KEGG = D07963 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| chemical_formula = |
|
|
|
| ChEMBL = 15413 |
|
| C=15 | H=18 | F=2 | N=6 | O=7 | S=2 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| molecular_weight = 496.46 g/mol |
|
|
|
| ChemSpiderID = 59274 |
| ⚫ |
| bioavailability = |
|
|
|
|
| ⚫ |
| protein_bound = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| metabolism = |
|
|
⚫ |
| chemical_formula = |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| C=15 | H=18 | F=2 | N=6 | O=7 | S=2 |
|
|
| smiles = CO1(2N(C1=O)C(=C(CO2)CSc3nnnn3CCO)C(=O)O)NC(=O)CSC(F)F |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| StdInChI = 1S/C15H18F2N6O7S2/c1-29-15(18-8(25)6-31-13(16)17)11(28)23-9(10(26)27)7(4-30-12(15)23)5-32-14-19-20-21-22(14)2-3-24/h12-13,24H,2-6H2,1H3,(H,18,25)(H,26,27)/t12-,15+/m1/s1 |
| ⚫ |
| pregnancy_category= |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
|
| StdInChIKey = UHRBTBZOWWGKMK-DOMZBBRYSA-N |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| melting_point = 82.5 |
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
|
| melting_high = 87.5 |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Flomoxef''' (]) is an ] antibiotic. |
|
'''Flomoxef''' is an ] antibiotic that was developed by ]. |
|
|
|
|
|
It has been identified as second-generation <ref name="pmid18401677">{{cite journal |author=Masuda Z, Kurosaki Y, Ishino K, Yamauchi K, Sano S |title=Pharmacokinetic analysis of flomoxef in children undergoing cardiopulmonary bypass and modified ultrafiltration |journal=Gen Thorac Cardiovasc Surg |volume=56 |issue=4 |pages=163–9 |year=2008 |month=April |pmid=18401677 |doi=10.1007/s11748-007-0208-5 }}</ref> and fourth generation.<ref name="pmid1783441">{{cite journal |author=Ito M, Ishigami T |title=The meaning of the development of flomoxef and clinical experience in Japan |journal=Infection |volume=19 Suppl 5 |issue= |pages=S253–7 |year=1991 |pmid=1783441 |doi= |url=}}</ref> |
|
It has been classified either as a second-generation <ref name="pmid18401677">{{cite journal | vauthors = Masuda Z, Kurosaki Y, Ishino K, Yamauchi K, Sano S | title = Pharmacokinetic analysis of flomoxef in children undergoing cardiopulmonary bypass and modified ultrafiltration | journal = General Thoracic and Cardiovascular Surgery | volume = 56 | issue = 4 | pages = 163–169 | date = April 2008 | pmid = 18401677 | doi = 10.1007/s11748-007-0208-5 | s2cid = 23845740 }}</ref> or fourth-generation cephalosporin.<ref name="pmid1783441">{{cite journal | vauthors = Ito M, Ishigami T | title = The meaning of the development of flomoxef and clinical experience in Japan | journal = Infection | volume = 19 | issue = Suppl 5 | pages = S253–S257 | year = 1991 | pmid = 1783441 | doi = 10.1007/bf01645536 | s2cid = 25339977 }}</ref> |
|
|
|
|
|
<!-- Society and culture --> |
|
|
It was patented in 1982 and approved for medical use in 1988 under the trade name '''Flumarin'''.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR | title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=496 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA496 |language=en}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
⚫ |
{{Cell wall disruptive antibiotics}} |
| ⚫ |
{{antibiotic-stub}} |
|
|
|
|
| ⚫ |
{{Beta-lactam antibiotics}} |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{antibiotic-stub}} |