| Revision as of 20:44, 8 May 2011 editLuckas-bot (talk | contribs)929,662 editsm r2.7.1) (robot Adding: hu:Fluoreszkamin← Previous edit |
Latest revision as of 03:58, 12 May 2024 edit undoBeland (talk | contribs)Autopatrolled, Administrators236,669 editsm mu not micro per MOS:NUM#Specific units and Unicode compatibility characters (via WP:JWB) |
| (26 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 385697486 |
|
| verifiedrevid = 428136922 |
|
|Reference=<ref> at ]</ref> |
|
| Reference =<ref> at ]</ref> |
|
|ImageFile= Fluorescamine.png |
|
| ImageFile = Fluorescamine.png |
|
|ImageSize=200px |
|
| ImageSize = |
|
|IUPACName=4'-phenylspiro-1,3'-dione |
|
| IUPACName =4'-phenylspiro-1,3'-dione |
|
|OtherNames=Fluram |
|
| OtherNames =Fluram |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=38183-12-9 |
|
| CASNo =38183-12-9 |
|
| PubChem=37927 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C1=CC=C(C=C1)C2=COC3(C2=O)C4=CC=CC=C4C(=O)O3 |
|
|
|
| UNII = Y6859V58YW |
|
|
| PubChem =37927 |
|
⚫ |
| SMILES =C1=CC=C(C=C1)C2=COC3(C2=O)C4=CC=CC=C4C(=O)O3 |
|
|
| InChI = 1S/C17H10O4/c18-15-13(11-6-2-1-3-7-11)10-20-17(15)14-9-5-4-8-12(14)16(19)21-17/h1-10H |
|
|
| InChIKey = ZFKJVJIDPQDDFY-UHFFFAOYSA-N |
|
|
| MeSHName = D005450 |
|
|
| ChemSpiderID = 34768 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>17</sub>H<sub>10</sub>O<sub>4</sub> |
|
| Formula =C<sub>17</sub>H<sub>10</sub>O<sub>4</sub> |
|
| MolarMass=278.26 g/mol |
|
| MolarMass =278.26 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt=153-157 °C |
|
| MeltingPtC = 153 to 157 |
|
|
| MeltingPt_notes = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Fluorescamine''' is a ] that is not fluorescent itself, but reacts with primary amines to form highly fluorescent products. It hence has been used as a reagent for the detection of ]s and ]s. 1-100µg of protein and down 10pg protein can be detected<ref>Böhlen P. , S. Stein,W. Dairman, and S. Undenfriend, Arch. Biochem. Biophys. 155, 1973, 213–220</ref> <ref>] ]</ref>. This method is found to suffer of high blanks resulting of high rate of hydrolysis due to used excess concentration. Alternative methods are based on ], ] and ]. |
|
'''Fluorescamine''' is a ] that is not fluorescent itself, but reacts with primary amines to form highly fluorescent products, i.e. it is ]. It hence has been used as a reagent for the detection of ]s and ]s.<ref>{{cite journal |doi=10.1016/S0021-9673(00)82285-2 |title=Cactus alkaloids : XL. Identification of mescaline and other β-phenethylamines in ''Pereskia'', ''Pereskiopsis'' and ''Islaya'' by use of fluorescamine conjugates |journal=Journal of Chromatography A |volume=189 |pages=79–85 |year=1980 |last1=Doetsch |first1=Paul W. |last2=Cassady |first2=John M. |last3=McLaughlin |first3=Jerry L. }}</ref> 1-100 μg of protein and down to 10 pg of protein can be detected.<ref>{{cite journal |doi=10.1016/S0003-9861(73)80023-2 |pmid=4736505 |title=Fluorometric assay of proteins in the nanogram range |journal=Archives of Biochemistry and Biophysics |volume=155 |issue=1 |pages=213–220 |year=1973 |last1=Böhlen |first1=Peter |last2=Stein |first2=Stanley |last3=Dairman |first3=Wallace |last4=Udenfriend |first4=Sidney }}</ref><ref>{{dead link|date=February 2019}} by ] </ref> Once bound to protein the excitation wavelength is 381 nm (near ultraviolet) and the emission wavelength is 470 nm (blue).<ref>{{cite web |last1=Biotium |title=Fluorescamine PRODUCT AND SAFETY DATA SHEET |url=https://biotium.com/wp-content/uploads/2017/10/PI-90092.pdf |publisher=Biotium |access-date=21 February 2023}}</ref> This method is found to suffer from high blanks resulting from a high rate of hydrolysis due to requiring a large excess concentration.<ref></ref> Alternative methods are based on ] (OPA), ] (DTNB), or ]. |
|
|
|
|
|
==Reaction== |
|
|
:]{{clear-left}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
| ⚫ |
{{organic-compound-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
] |
|
|
⚫ |
{{organic-compound-stub}} |